Explorar o código

Update to upstream ctypesgen version (#1651)

* update ctypesgen to community version

* ctypesgen patches needed for mac

* ctypesgen patch for python printer of preamble and loader

* patches applied to ctypesgen source code

* patch for ctypesgen POINTER

* Use ReturnString to create String from str object

* remove lextab.py from gitignore

* remove sed-file for preamble/loader replacement

* black on preamble patch

* add README

- with instructions on updating ctypesgen version
- remove patches dir and separate files

* set RASTER3D_DEFAULT_WINDOW=0

* libimagery unittest: adapt to community ctypesgen

* add win patches to README

* patches needed for Windows

* update README and run Black on a patch
nilason %!s(int64=3) %!d(string=hai) anos
pai
achega
ca2d28a592
Modificáronse 59 ficheiros con 7777 adicións e 3714 borrados
  1. 0 1
      .gitignore
  2. 1 1
      include/grass/raster3d.h
  3. 4 2
      lib/imagery/testsuite/test_imagery_signature_management.py
  4. 19 19
      lib/imagery/testsuite/test_imagery_sigsetfile.py
  5. 11 10
      python/grass/ctypes/Makefile
  6. 233 0
      python/grass/ctypes/README.md
  7. 0 178
      python/grass/ctypes/ctypesgen.py
  8. 0 0
      python/grass/ctypes/ctypesgen/LICENSE
  9. 28 7
      python/grass/ctypes/ctypesgencore/__init__.py
  10. 118 124
      python/grass/ctypes/ctypesgencore/ctypedescs.py
  11. 44 21
      python/grass/ctypes/ctypesgencore/descriptions.py
  12. 72 75
      python/grass/ctypes/ctypesgencore/expressions.py
  13. 364 0
      python/grass/ctypes/ctypesgen/libraryloader.py
  14. 391 0
      python/grass/ctypes/ctypesgen/main.py
  15. 7 9
      python/grass/ctypes/ctypesgencore/messages.py
  16. 11 8
      python/grass/ctypes/ctypesgencore/options.py
  17. 2 0
      python/grass/ctypes/ctypesgen/parser/.gitignore
  18. 3 2
      python/grass/ctypes/ctypesgencore/parser/__init__.py
  19. 290 0
      python/grass/ctypes/ctypesgen/parser/cdeclarations.py
  20. 647 422
      python/grass/ctypes/ctypesgencore/parser/cgrammar.py
  21. 89 72
      python/grass/ctypes/ctypesgencore/parser/cparser.py
  22. 56 48
      python/grass/ctypes/ctypesgencore/parser/ctypesparser.py
  23. 98 97
      python/grass/ctypes/ctypesgencore/parser/datacollectingparser.py
  24. 149 176
      python/grass/ctypes/ctypesgencore/parser/lex.py
  25. 8 0
      python/grass/ctypes/ctypesgen/parser/lextab.py
  26. 307 0
      python/grass/ctypes/ctypesgen/parser/parsetab.py
  27. 402 0
      python/grass/ctypes/ctypesgen/parser/pplexer.py
  28. 91 84
      python/grass/ctypes/ctypesgencore/parser/preprocessor.py
  29. 318 275
      python/grass/ctypes/ctypesgencore/parser/yacc.py
  30. 1 1
      python/grass/ctypes/ctypesgencore/printer/__init__.py
  31. 150 0
      python/grass/ctypes/ctypesgen/printer_json/printer.py
  32. 6 0
      python/grass/ctypes/ctypesgen/printer_json/test.py
  33. 10 0
      python/grass/ctypes/ctypesgen/printer_python/__init__.py
  34. 9 0
      python/grass/ctypes/ctypesgen/printer_python/defaultheader.py
  35. 98 77
      python/grass/ctypes/ctypesgencore/printer/preamble.py
  36. 95 93
      python/grass/ctypes/preamble.py
  37. 448 0
      python/grass/ctypes/ctypesgen/printer_python/preamble/3_2.py
  38. 0 0
      python/grass/ctypes/ctypesgen/printer_python/preamble/__init__.py
  39. 460 0
      python/grass/ctypes/ctypesgen/printer_python/printer.py
  40. 6 0
      python/grass/ctypes/ctypesgen/printer_python/test.py
  41. 1 1
      python/grass/ctypes/ctypesgencore/processor/__init__.py
  42. 46 27
      python/grass/ctypes/ctypesgencore/processor/dependencies.py
  43. 119 61
      python/grass/ctypes/ctypesgencore/processor/operations.py
  44. 16 18
      python/grass/ctypes/ctypesgencore/processor/pipeline.py
  45. 2 0
      python/grass/ctypes/ctypesgen/test/.gitignore
  46. 88 0
      python/grass/ctypes/ctypesgen/test/ctypesgentest.py
  47. 2352 0
      python/grass/ctypes/ctypesgen/test/testsuite.py
  48. 89 0
      python/grass/ctypes/ctypesgen/version.py
  49. 0 319
      python/grass/ctypes/ctypesgencore/libraryloader.py
  50. 0 198
      python/grass/ctypes/ctypesgencore/parser/cdeclarations.py
  51. 0 282
      python/grass/ctypes/ctypesgencore/parser/parsetab.py
  52. 0 346
      python/grass/ctypes/ctypesgencore/parser/pplexer.py
  53. 0 9
      python/grass/ctypes/ctypesgencore/printer/defaultheader.py
  54. 0 362
      python/grass/ctypes/ctypesgencore/printer/printer.py
  55. 0 6
      python/grass/ctypes/ctypesgencore/printer/test.py
  56. 0 7
      python/grass/ctypes/fix.sed
  57. 0 270
      python/grass/ctypes/loader.py
  58. 12 0
      python/grass/ctypes/run.py
  59. 6 6
      python/grass/pygrass/vector/table.py

+ 0 - 1
.gitignore

@@ -24,7 +24,6 @@ lib/db/sqlp/sqlp.output
 lib/db/sqlp/sqlp.tab.c
 lib/db/sqlp/sqlp.tab.c
 lib/db/sqlp/sqlp.tab.h
 lib/db/sqlp/sqlp.tab.h
 lib/db/sqlp/sqlp.yy.c
 lib/db/sqlp/sqlp.yy.c
-python/grass/ctypes/ctypesgencore/parser/lextab.py
 python/grass/script/setup.py.tmp
 python/grass/script/setup.py.tmp
 raster/r.mapcalc/mapcalc.output
 raster/r.mapcalc/mapcalc.output
 raster/r.mapcalc/mapcalc.tab.c
 raster/r.mapcalc/mapcalc.tab.c

+ 1 - 1
include/grass/raster3d.h

@@ -26,7 +26,7 @@
 #define RASTER3D_USE_CACHE_YZ -7
 #define RASTER3D_USE_CACHE_YZ -7
 #define RASTER3D_USE_CACHE_XYZ -8
 #define RASTER3D_USE_CACHE_XYZ -8
 
 
-#define RASTER3D_DEFAULT_WINDOW NULL
+#define RASTER3D_DEFAULT_WINDOW 0 /* NULL pointer, now (int)0 because issues with ctypesgen */
 
 
 #define RASTER3D_DIRECTORY      "grid3"
 #define RASTER3D_DIRECTORY      "grid3"
 #define RASTER3D_CELL_ELEMENT   "cell"
 #define RASTER3D_CELL_ELEMENT   "cell"

+ 4 - 2
lib/imagery/testsuite/test_imagery_signature_management.py

@@ -40,17 +40,19 @@ from grass.lib.imagery import (
     I_make_signatures_dir,
     I_make_signatures_dir,
 )
 )
 
 
+H_DIRSEP = HOST_DIRSEP.decode("utf-8")
+
 
 
 class GetSignaturesElementTestCase(TestCase):
 class GetSignaturesElementTestCase(TestCase):
     def test_get_sig(self):
     def test_get_sig(self):
         cdir = ctypes.create_string_buffer(GNAME_MAX)
         cdir = ctypes.create_string_buffer(GNAME_MAX)
         I_get_signatures_dir(cdir, I_SIGFILE_TYPE_SIG)
         I_get_signatures_dir(cdir, I_SIGFILE_TYPE_SIG)
-        self.assertEqual(utils.decode(cdir.value), f"signatures{HOST_DIRSEP}sig")
+        self.assertEqual(utils.decode(cdir.value), f"signatures{H_DIRSEP}sig")
 
 
     def test_get_sigset(self):
     def test_get_sigset(self):
         cdir = ctypes.create_string_buffer(GNAME_MAX)
         cdir = ctypes.create_string_buffer(GNAME_MAX)
         I_get_signatures_dir(cdir, I_SIGFILE_TYPE_SIGSET)
         I_get_signatures_dir(cdir, I_SIGFILE_TYPE_SIGSET)
-        self.assertEqual(utils.decode(cdir.value), f"signatures{HOST_DIRSEP}sigset")
+        self.assertEqual(utils.decode(cdir.value), f"signatures{H_DIRSEP}sigset")
 
 
 
 
 class MakeSignaturesElementTestCase(TestCase):
 class MakeSignaturesElementTestCase(TestCase):

+ 19 - 19
lib/imagery/testsuite/test_imagery_sigsetfile.py

@@ -36,7 +36,7 @@ from grass.lib.imagery import (
     I_init_group_ref,
     I_init_group_ref,
     I_add_file_to_group_ref,
     I_add_file_to_group_ref,
     I_free_group_ref,
     I_free_group_ref,
-    String,
+    ReturnString,
 )
 )
 
 
 
 
@@ -71,11 +71,11 @@ class SigSetFileTestCase(TestCase):
         self.assertEqual(So.ClassSig[0].nsubclasses, 1)
         self.assertEqual(So.ClassSig[0].nsubclasses, 1)
 
 
         # Fill sigset struct with data
         # Fill sigset struct with data
-        So.title = String("Signature title")
+        So.title = ReturnString("Signature title")
         So.bandrefs[0] = ctypes.create_string_buffer(b"The_Doors")
         So.bandrefs[0] = ctypes.create_string_buffer(b"The_Doors")
         So.ClassSig[0].used = 1
         So.ClassSig[0].used = 1
         So.ClassSig[0].classnum = 2
         So.ClassSig[0].classnum = 2
-        So.ClassSig[0].title = String("1st class")
+        So.ClassSig[0].title = ReturnString("1st class")
         So.ClassSig[0].type = 1
         So.ClassSig[0].type = 1
         So.ClassSig[0].SubSig[0].pi = 3.14
         So.ClassSig[0].SubSig[0].pi = 3.14
         So.ClassSig[0].SubSig[0].means[0] = 42.42
         So.ClassSig[0].SubSig[0].means[0] = 42.42
@@ -124,11 +124,11 @@ class SigSetFileTestCase(TestCase):
         self.assertEqual(So.ClassSig[0].nsubclasses, 1)
         self.assertEqual(So.ClassSig[0].nsubclasses, 1)
 
 
         # Fill sigset struct with data
         # Fill sigset struct with data
-        So.title = String("Signature title")
+        So.title = ReturnString("Signature title")
         So.bandrefs[0] = ctypes.create_string_buffer(tempname(252).encode())
         So.bandrefs[0] = ctypes.create_string_buffer(tempname(252).encode())
         So.ClassSig[0].used = 1
         So.ClassSig[0].used = 1
         So.ClassSig[0].classnum = 2
         So.ClassSig[0].classnum = 2
-        So.ClassSig[0].title = String("1st class")
+        So.ClassSig[0].title = ReturnString("1st class")
         So.ClassSig[0].type = 1
         So.ClassSig[0].type = 1
         So.ClassSig[0].SubSig[0].pi = 3.14
         So.ClassSig[0].SubSig[0].pi = 3.14
         So.ClassSig[0].SubSig[0].means[0] = 42.42
         So.ClassSig[0].SubSig[0].means[0] = 42.42
@@ -163,12 +163,12 @@ class SigSetFileTestCase(TestCase):
         self.assertEqual(So.ClassSig[0].nsubclasses, 1)
         self.assertEqual(So.ClassSig[0].nsubclasses, 1)
 
 
         # Fill sigset struct with data
         # Fill sigset struct with data
-        So.title = String("Signature title")
+        So.title = ReturnString("Signature title")
         So.bandrefs[0] = ctypes.create_string_buffer(b"The_Doors")
         So.bandrefs[0] = ctypes.create_string_buffer(b"The_Doors")
         So.bandrefs[1] = ctypes.create_string_buffer(b"The_Who")
         So.bandrefs[1] = ctypes.create_string_buffer(b"The_Who")
         So.ClassSig[0].used = 1
         So.ClassSig[0].used = 1
         So.ClassSig[0].classnum = 2
         So.ClassSig[0].classnum = 2
-        So.ClassSig[0].title = String("1st class")
+        So.ClassSig[0].title = ReturnString("1st class")
         So.ClassSig[0].type = 1
         So.ClassSig[0].type = 1
         So.ClassSig[0].SubSig[0].pi = 3.14
         So.ClassSig[0].SubSig[0].pi = 3.14
         So.ClassSig[0].SubSig[0].means[0] = 42.42
         So.ClassSig[0].SubSig[0].means[0] = 42.42
@@ -254,11 +254,11 @@ class SortSigSetByBandrefTest(TestCase):
         self.assertEqual(S.nclasses, 1)
         self.assertEqual(S.nclasses, 1)
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
-        S.title = String("Signature title")
+        S.title = ReturnString("Signature title")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Troggs")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Troggs")
         S.ClassSig[0].used = 1
         S.ClassSig[0].used = 1
         S.ClassSig[0].classnum = 2
         S.ClassSig[0].classnum = 2
-        S.ClassSig[0].title = String("1st class")
+        S.ClassSig[0].title = ReturnString("1st class")
         S.ClassSig[0].type = 1
         S.ClassSig[0].type = 1
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].means[0] = 42.42
         S.ClassSig[0].SubSig[0].means[0] = 42.42
@@ -299,11 +299,11 @@ class SortSigSetByBandrefTest(TestCase):
         self.assertEqual(S.nclasses, 1)
         self.assertEqual(S.nclasses, 1)
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
-        S.title = String("Signature title")
+        S.title = ReturnString("Signature title")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Troggs")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Troggs")
         S.ClassSig[0].used = 1
         S.ClassSig[0].used = 1
         S.ClassSig[0].classnum = 2
         S.ClassSig[0].classnum = 2
-        S.ClassSig[0].title = String("1st class")
+        S.ClassSig[0].title = ReturnString("1st class")
         S.ClassSig[0].type = 1
         S.ClassSig[0].type = 1
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].means[0] = 42.42
         S.ClassSig[0].SubSig[0].means[0] = 42.42
@@ -345,11 +345,11 @@ class SortSigSetByBandrefTest(TestCase):
         self.assertEqual(S.nclasses, 1)
         self.assertEqual(S.nclasses, 1)
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
-        S.title = String("Signature title")
+        S.title = ReturnString("Signature title")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Who")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Who")
         S.ClassSig[0].used = 1
         S.ClassSig[0].used = 1
         S.ClassSig[0].classnum = 2
         S.ClassSig[0].classnum = 2
-        S.ClassSig[0].title = String("1st class")
+        S.ClassSig[0].title = ReturnString("1st class")
         S.ClassSig[0].type = 1
         S.ClassSig[0].type = 1
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].means[0] = 42.42
         S.ClassSig[0].SubSig[0].means[0] = 42.42
@@ -394,11 +394,11 @@ class SortSigSetByBandrefTest(TestCase):
         self.assertEqual(S.nclasses, 1)
         self.assertEqual(S.nclasses, 1)
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
-        S.title = String("Signature title")
+        S.title = ReturnString("Signature title")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Doors")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Doors")
         S.ClassSig[0].used = 1
         S.ClassSig[0].used = 1
         S.ClassSig[0].classnum = 2
         S.ClassSig[0].classnum = 2
-        S.ClassSig[0].title = String("1st class")
+        S.ClassSig[0].title = ReturnString("1st class")
         S.ClassSig[0].type = 1
         S.ClassSig[0].type = 1
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].means[0] = 42.42
         S.ClassSig[0].SubSig[0].means[0] = 42.42
@@ -439,12 +439,12 @@ class SortSigSetByBandrefTest(TestCase):
         self.assertEqual(S.nclasses, 1)
         self.assertEqual(S.nclasses, 1)
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
-        S.title = String("Signature title")
+        S.title = ReturnString("Signature title")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Who")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Who")
         S.bandrefs[1] = ctypes.create_string_buffer(b"The_Doors")
         S.bandrefs[1] = ctypes.create_string_buffer(b"The_Doors")
         S.ClassSig[0].used = 1
         S.ClassSig[0].used = 1
         S.ClassSig[0].classnum = 2
         S.ClassSig[0].classnum = 2
-        S.ClassSig[0].title = String("1st class")
+        S.ClassSig[0].title = ReturnString("1st class")
         S.ClassSig[0].type = 1
         S.ClassSig[0].type = 1
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].means[0] = 42.42
         S.ClassSig[0].SubSig[0].means[0] = 42.42
@@ -498,12 +498,12 @@ class SortSigSetByBandrefTest(TestCase):
         self.assertEqual(S.nclasses, 1)
         self.assertEqual(S.nclasses, 1)
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         I_NewSubSig(ctypes.byref(S), ctypes.byref(S.ClassSig[0]))
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
         self.assertEqual(S.ClassSig[0].nsubclasses, 1)
-        S.title = String("Signature title")
+        S.title = ReturnString("Signature title")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Who")
         S.bandrefs[0] = ctypes.create_string_buffer(b"The_Who")
         S.bandrefs[1] = ctypes.create_string_buffer(b"The_Doors")
         S.bandrefs[1] = ctypes.create_string_buffer(b"The_Doors")
         S.ClassSig[0].used = 1
         S.ClassSig[0].used = 1
         S.ClassSig[0].classnum = 2
         S.ClassSig[0].classnum = 2
-        S.ClassSig[0].title = String("1st class")
+        S.ClassSig[0].title = ReturnString("1st class")
         S.ClassSig[0].type = 1
         S.ClassSig[0].type = 1
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].pi = 3.14
         S.ClassSig[0].SubSig[0].means[0] = 42.42
         S.ClassSig[0].SubSig[0].means[0] = 42.42

+ 11 - 10
python/grass/ctypes/Makefile

@@ -61,8 +61,7 @@ ifneq ($(findstring darwin,$(ARCH)),)
 MAC_FLAGS  = "-D_Nullable="
 MAC_FLAGS  = "-D_Nullable="
 endif
 endif
 
 
-SED = sed
-CTYPESGEN = ./ctypesgen.py
+CTYPESGEN = ./run.py
 CTYPESFLAGS = --cpp "$(CC) -E $(CPPFLAGS) $(LFS_CFLAGS) $(MAC_FLAGS) $(EXTRA_CFLAGS) $(NLS_CFLAGS) $(DEFS) $(EXTRA_INC) $(INC) -D__GLIBC_HAVE_LONG_LONG"
 CTYPESFLAGS = --cpp "$(CC) -E $(CPPFLAGS) $(LFS_CFLAGS) $(MAC_FLAGS) $(EXTRA_CFLAGS) $(NLS_CFLAGS) $(DEFS) $(EXTRA_INC) $(INC) -D__GLIBC_HAVE_LONG_LONG"
 EXTRA_CLEAN_FILES := $(wildcard ctypesgencore/*.pyc) $(wildcard ctypesgencore/*/*.pyc)
 EXTRA_CLEAN_FILES := $(wildcard ctypesgencore/*.pyc) $(wildcard ctypesgencore/*/*.pyc)
 
 
@@ -76,12 +75,14 @@ PYDIR = $(ETC)/python
 GDIR = $(PYDIR)/grass
 GDIR = $(PYDIR)/grass
 DSTDIR = $(GDIR)/lib
 DSTDIR = $(GDIR)/lib
 
 
-PYFILES  := $(patsubst %,$(DSTDIR)/%.py,$(MODULES) __init__ ctypes_preamble ctypes_loader)
-PYCFILES  := $(patsubst %,$(DSTDIR)/%.pyc,$(MODULES) __init__ ctypes_preamble ctypes_loader)
+PYFILES  := $(patsubst %,$(DSTDIR)/%.py,$(MODULES))
+PYCFILES  := $(patsubst %,$(DSTDIR)/%.pyc,$(MODULES))
 LPYFILES := $(patsubst %,$(OBJDIR)/%.py,$(MODULES))
 LPYFILES := $(patsubst %,$(OBJDIR)/%.py,$(MODULES))
 
 
+COPY_FILES = $(DSTDIR)/ctypes_loader.py $(DSTDIR)/ctypes_preamble.py
+
 ifeq ($(strip $(GRASS_LIBRARY_TYPE)),shlib)
 ifeq ($(strip $(GRASS_LIBRARY_TYPE)),shlib)
-default:
+default: $(COPY_FILES)
 	$(MAKE) $(DSTDIR)
 	$(MAKE) $(DSTDIR)
 	$(MAKE) $(LPYFILES) $(PYFILES) $(PYCFILES)
 	$(MAKE) $(LPYFILES) $(PYFILES) $(PYCFILES)
 else
 else
@@ -90,13 +91,13 @@ default:
 	exit 1
 	exit 1
 endif
 endif
 
 
-$(DSTDIR)/__init__.py: __init__.py | $(DSTDIR)
-	$(INSTALL_DATA) $< $@
+$(COPY_FILES): | $(DSTDIR)
+$(DSTDIR)/ctypes_loader.py: ctypesgen/libraryloader.py
+	cp -f $< $@
+$(DSTDIR)/ctypes_preamble.py: ctypesgen/printer_python/preamble/3_2.py
+	cp -f $< $@
 
 
 $(DSTDIR)/%.py: $(OBJDIR)/%.py | $(DSTDIR)
 $(DSTDIR)/%.py: $(OBJDIR)/%.py | $(DSTDIR)
-	$(SED) -f fix.sed $< > $@
-
-$(DSTDIR)/ctypes_%.py: %.py | $(DSTDIR)
 	$(INSTALL_DATA) $< $@
 	$(INSTALL_DATA) $< $@
 
 
 define module_rule
 define module_rule

+ 233 - 0
python/grass/ctypes/README.md

@@ -0,0 +1,233 @@
+## Notes on ctypesgen
+
+Currently installed version:
+https://github.com/ctypesgen/ctypesgen/commit/0681f8ef1742206c171d44b7872c700f34ffe044 (3 March 2020)
+
+
+### How to update ctypesgen version
+
+1. Replace the GRASS directory `python/grass/ctypes/ctypesgen` with the `ctypesgen`
+   directory from ctypesgen source directory.
+2. Replace `python/grass/ctypes/run.py` with `run.py` from ctypesgen source directory.
+3. Apply the patches below.
+4. Update this document with info on installed ctypesgen version.
+5. If a patch has been addressed upstreams, also remove its section from this document.
+
+### Patches
+
+It is highly encouraged to report [upstreams](https://github.com/ctypesgen/ctypesgen) necessary patches for GRASS.
+
+#### POINTER patch
+
+https://trac.osgeo.org/grass/ticket/2748
+https://trac.osgeo.org/grass/ticket/3641
+
+Every generated GRASS library bridge part (gis.py, raster.py etc.) is a standalone
+product. E.g. parts of libgis (include/grass/gis.h) used in libraster
+(etc/python/grass/lib/raster.py) are also defined in raster.py. This way there
+is a definition of `struct_Cell_head` in both gis.py and raster.py -- a situation
+ctypes doesn't approve of. This patch seems to fix related errors in GRASS.
+Manually remove e.g. the gis.py parts in raster.py and make an "import" also did
+the work, but that would be more difficult to implement as part of ctypesgen
+file generation.
+
+```diff
+--- ctypesgen/printer_python/preamble/3_2.py.orig
++++ ctypesgen/printer_python/preamble/3_2.py
+@@ -14,6 +14,24 @@
+ del _int_types
+ 
+ 
++def POINTER(obj):
++    p = ctypes.POINTER(obj)
++
++    # Convert None to a real NULL pointer to work around bugs
++    # in how ctypes handles None on 64-bit platforms
++    if not isinstance(p.from_param, classmethod):
++
++        def from_param(cls, x):
++            if x is None:
++                return cls()
++            else:
++                return x
++
++        p.from_param = classmethod(from_param)
++
++    return p
++
++
+ class UserString:
+     def __init__(self, seq):
+         if isinstance(seq, bytes):
+
+```
+
+#### Loader and preamble patch
+
+Replaces sed introduced with:
+"Move ctypesgen boilerplate to common module"
+
+https://github.com/OSGeo/grass/commit/59eeff479cd39fd503e276d164977648938cc85b
+
+
+```diff
+--- ctypesgen/printer_python/printer.py.orig
++++ ctypesgen/printer_python/printer.py
+@@ -156,19 +156,22 @@
+         path, v = get_preamble(**m.groupdict())
+ 
+         self.file.write("# Begin preamble for Python v{}\n\n".format(v))
+-        preamble_file = open(path, "r")
+-        self.file.write(preamble_file.read())
+-        preamble_file.close()
++        self.file.write("from .ctypes_preamble import *\n")
++        self.file.write("from .ctypes_preamble import _variadic_function\n")
++        # preamble_file = open(path, "r")
++        # self.file.write(preamble_file.read())
++        # preamble_file.close()
+         self.file.write("\n# End preamble\n")
+ 
+     def print_loader(self):
+         self.file.write("_libs = {}\n")
+         self.file.write("_libdirs = %s\n\n" % self.options.compile_libdirs)
+         self.file.write("# Begin loader\n\n")
+-        path = path_to_local_file("libraryloader.py", libraryloader)
+-        loader_file = open(path, "r")
+-        self.file.write(loader_file.read())
+-        loader_file.close()
++        self.file.write("from .ctypes_loader import *\n")        
++        # path = path_to_local_file("libraryloader.py", libraryloader)
++        # loader_file = open(path, "r")
++        # self.file.write(loader_file.read())
++        # loader_file.close()
+         self.file.write("\n# End loader\n\n")
+         self.file.write(
+             "add_library_search_dirs([%s])"
+
+```
+
+#### Mac specific patches
+
+Enable Ctypesgen parsing of non-utf8 files on macOS
+https://github.com/OSGeo/grass/pull/385
+
+```diff
+--- ctypesgen/parser/preprocessor.py.orig
++++ ctypesgen/parser/preprocessor.py
+@@ -160,9 +160,32 @@
+         self.cparser.handle_status(cmd)
+ 
+         pp = subprocess.Popen(
+-            cmd, shell=True, universal_newlines=True, stdout=subprocess.PIPE, stderr=subprocess.PIPE
++            cmd,
++            shell=True,
++            universal_newlines=True,
++            stdout=subprocess.PIPE,
++            stderr=subprocess.PIPE,
+         )
+-        ppout, pperr = pp.communicate()
++        try:
++            ppout, pperr = pp.communicate()
++        except UnicodeError:
++            # Fix for https://trac.osgeo.org/grass/ticket/3883,
++            # handling file(s) encoded with mac_roman
++            if sys.platform == "darwin":
++                pp = subprocess.Popen(
++                    cmd,
++                    shell=True,
++                    universal_newlines=False,  # read as binary
++                    stdout=subprocess.PIPE,
++                    stderr=subprocess.PIPE,
++                )
++                ppout, pperr = pp.communicate()
++
++                data = ppout.decode("utf8", errors="replace")
++                ppout = data.replace("\r\n", "\n").replace("\r", "\n")
++                pperr = pperr.decode("utf8", errors="replace")
++            else:
++                raise UnicodeError
+ 
+         for line in pperr.split("\n"):
+             if line:
+
+```
+
+
+macOS: use `@rpath` as dynamic linker
+https://github.com/OSGeo/grass/pull/981
+
+```diff
+--- ctypesgen/libraryloader.py.orig
++++ ctypesgen/libraryloader.py
+@@ -168,6 +168,7 @@
+         dyld_fallback_library_path = _environ_path("DYLD_FALLBACK_LIBRARY_PATH")
+         if not dyld_fallback_library_path:
+             dyld_fallback_library_path = [os.path.expanduser("~/lib"), "/usr/local/lib", "/usr/lib"]
++        dyld_fallback_library_path.extend(_environ_path('LD_RUN_PATH'))
+ 
+         dirs = []
+
+```
+
+
+#### Windows specific patches
+
+The type `__int64` isn't defined in ctypesgen
+https://trac.osgeo.org/grass/ticket/3506
+
+```diff
+--- ctypesgen/ctypedescs.py.orig
++++ ctypesgen/ctypedescs.py
+@@ -41,6 +41,7 @@ ctypes_type_map = {
+     ("int16_t", True, 0): "c_int16",
+     ("int32_t", True, 0): "c_int32",
+     ("int64_t", True, 0): "c_int64",
++    ("__int64", True, 0): "c_int64",
+     ("uint8_t", True, 0): "c_uint8",
+     ("uint16_t", True, 0): "c_uint16",
+     ("uint32_t", True, 0): "c_uint32",
+
+```
+
+Patch for OSGeo4W packaging, adapted from
+https://github.com/jef-n/OSGeo4W/blob/master/src/grass/osgeo4w/patch
+
+```diff
+--- ctypesgen/libraryloader.py.orig
++++ ctypesgen/libraryloader.py
+@@ -321,6 +321,12 @@
+ class WindowsLibraryLoader(LibraryLoader):
+     name_formats = ["%s.dll", "lib%s.dll", "%slib.dll", "%s"]
+ 
++    def __init__(self):
++        super().__init__()
++        for p in os.getenv("PATH").split(";"):
++            if os.path.exists(p) and hasattr(os, "add_dll_directory"):
++                os.add_dll_directory(p)
++
+     class Lookup(LibraryLoader.Lookup):
+         def __init__(self, path):
+             super(WindowsLibraryLoader.Lookup, self).__init__(path)
+
+```
+
+Invoke preprocessor via `sh.exe`, workaround to get the -I switches to be recognized.
+https://trac.osgeo.org/grass/ticket/1125#comment:21
+
+https://github.com/OSGeo/grass/commit/65eef4767aa416ca55f7e36f62dce7ce083fe450
+
+```diff
+--- ctypesgen/parser/preprocessor.py.orig
++++ ctypesgen/parser/preprocessor.py
+@@ -159,6 +159,9 @@
+ 
+         self.cparser.handle_status(cmd)
+ 
++        if sys.platform == "win32":
++            cmd = ["sh.exe", "-c", cmd]
++
+         pp = subprocess.Popen(
+             cmd, shell=True, universal_newlines=True, stdout=subprocess.PIPE, stderr=subprocess.PIPE
+         )
+
+```

+ 0 - 178
python/grass/ctypes/ctypesgen.py

@@ -1,178 +0,0 @@
-#!/usr/bin/env python3
-
-
-def find_names_in_modules(modules):
-    names = set()
-    for module in modules:
-        try:
-            mod = __import__(module)
-        except:
-            pass
-        else:
-            names.union(dir(module))
-    return names
-
-import optparse
-import sys
-
-import ctypesgencore
-from ctypesgencore import messages as msgs
-
-
-def option_callback_W(option, opt, value, parser):
-    # Options preceded by a "-Wl," are simply treated as though the "-Wl,"
-    # is not there? I don't understand the purpose of this code...
-    if len(value) < 4 or value[0:3] != 'l,-':
-        raise optparse.BadOptionError("not in '-Wl,<opt>' form: %s%s"
-                                      % (opt, value))
-    opt = value[2:]
-    if opt not in ['-L', '-R', '--rpath']:
-        raise optparse.BadOptionError("-Wl option must be -L, -R"
-                                      " or --rpath, not " + value[2:])
-    # Push the linker option onto the list for further parsing.
-    parser.rargs.insert(0, value)
-
-
-def option_callback_libdir(option, opt, value, parser):
-    # There are two sets of linker search paths: those for use at compile time
-    # and those for use at runtime. Search paths specified with -L, -R, or
-    # --rpath are added to both sets.
-    parser.values.compile_libdirs.append(value)
-    parser.values.runtime_libdirs.append(value)
-
-
-if __name__ == "__main__":
-    usage = 'usage: %prog [options] /path/to/header.h ...'
-    op = optparse.OptionParser(usage=usage)
-
-    # Parameters
-    op.add_option('-o', '--output', dest='output', metavar='FILE',
-                  help='write wrapper to FILE')
-    op.add_option('-l', '--library', dest='libraries', action='append',
-                  default=[], metavar='LIBRARY', help='link to LIBRARY')
-    op.add_option('', '--include', dest='other_headers', action='append',
-                  default=[], metavar='HEADER',
-                  help='include system header HEADER (e.g. stdio.h or stdlib.h)')
-    op.add_option('-m', '--module', '--link-module', action='append',
-                  dest='modules', metavar='MODULE', default=[],
-                  help='use symbols from Python module MODULE')
-    op.add_option('-I', '--includedir', dest='include_search_paths',
-                  action='append', default=[], metavar='INCLUDEDIR',
-                  help='add INCLUDEDIR as a directory to search for headers')
-    op.add_option('-W', action="callback", callback=option_callback_W,
-                  metavar="l,OPTION", type="str",
-                  help="where OPTION is -L, -R, or --rpath")
-    op.add_option("-L", "-R", "--rpath", "--libdir", action="callback",
-                  callback=option_callback_libdir, metavar="LIBDIR", type="str",
-                  help="Add LIBDIR to the search path (both compile-time and run-time)")
-    op.add_option('', "--compile-libdir", action="append",
-                  dest="compile_libdirs", metavar="LIBDIR", default=[],
-                  help="Add LIBDIR to the compile-time library search path.")
-    op.add_option('', "--runtime-libdir", action="append",
-                  dest="runtime_libdirs", metavar="LIBDIR", default=[],
-                  help="Add LIBDIR to the run-time library search path.")
-
-    # Parser options
-    op.add_option('', '--cpp', dest='cpp', default='gcc -E',
-                  help='The command to invoke the c preprocessor, including any '
-                  'necessary options (default: gcc -E)')
-    op.add_option('', '--save-preprocessed-headers', metavar='FILENAME',
-                  dest='save_preprocessed_headers', default=None,
-                  help='Save the preprocessed headers to the specified FILENAME')
-
-    # Processor options
-    op.add_option('-a', '--all-headers', action='store_true',
-                  dest='all_headers', default=False,
-                  help='include symbols from all headers, including system headers')
-    op.add_option('', '--builtin-symbols', action='store_true',
-                  dest='builtin_symbols', default=False,
-                  help='include symbols automatically generated by the preprocessor')
-    op.add_option('', '--no-macros', action='store_false', dest='include_macros',
-                  default=True, help="Don't output macros.")
-    op.add_option('-i', '--include-symbols', dest='include_symbols',
-                  default=None, help='regular expression for symbols to always include')
-    op.add_option('-x', '--exclude-symbols', dest='exclude_symbols',
-                  default=None, help='regular expression for symbols to exclude')
-    op.add_option('', '--no-stddef-types', action='store_true',
-                  dest='no_stddef_types', default=False,
-                  help='Do not support extra C types from stddef.h')
-    op.add_option('', '--no-gnu-types', action='store_true',
-                  dest='no_gnu_types', default=False,
-                  help='Do not support extra GNU C types')
-    op.add_option('', '--no-python-types', action='store_true',
-                  dest='no_python_types', default=False,
-                  help='Do not support extra C types built in to Python')
-
-    # Printer options
-    op.add_option('', '--header-template', dest='header_template', default=None,
-                  metavar='TEMPLATE',
-                  help='Use TEMPLATE as the header template in the output file.')
-    op.add_option('', '--strip-build-path', dest='strip_build_path',
-                  default=None, metavar='BUILD_PATH',
-                  help='Strip build path from header paths in the wrapper file.')
-    op.add_option('', '--insert-file', dest='inserted_files', default=[],
-                  action='append', metavar='FILENAME',
-                  help='Add the contents of FILENAME to the end of the wrapper file.')
-    op.add_option('', '--output-language', dest='output_language', metavar='LANGUAGE',
-                  default='python',
-                  help="Choose output language (`json' or `python' [default])")
-
-    # Error options
-    op.add_option('', "--all-errors", action="store_true", default=False,
-                  dest="show_all_errors", help="Display all warnings and errors even "
-                  "if they would not affect output.")
-    op.add_option('', "--show-long-errors", action="store_true", default=False,
-                  dest="show_long_errors", help="Display long error messages "
-                  "instead of abbreviating error messages.")
-    op.add_option('', "--no-macro-warnings", action="store_false", default=True,
-                  dest="show_macro_warnings", help="Do not print macro warnings.")
-
-    op.set_defaults(**ctypesgencore.options.default_values)
-
-    (options, args) = op.parse_args(list(sys.argv[1:]))
-    options.headers = args
-
-    # Figure out what names will be defined by imported Python modules
-    options.other_known_names = find_names_in_modules(options.modules)
-
-    # Required parameters
-    if len(args) < 1:
-        msgs.error_message('No header files specified', cls='usage')
-        sys.exit(1)
-
-    if options.output is None:
-        msgs.error_message('No output file specified', cls='usage')
-        sys.exit(1)
-
-    if len(options.libraries) == 0:
-        msgs.warning_message('No libraries specified', cls='usage')
-
-    # Check output language
-    printer = None
-    if options.output_language == "python":
-        printer = ctypesgencore.printer.WrapperPrinter
-    elif options.output_language == "json":
-        printer = ctypesgencore.printer_json.WrapperPrinter
-    else:
-        msgs.error_message("No such output language `" +
-                           options.output_language + "'", cls='usage')
-        sys.exit(1)
-
-    # Step 1: Parse
-    descriptions = ctypesgencore.parser.parse(options.headers, options)
-
-    # Step 2: Process
-    ctypesgencore.processor.process(descriptions, options)
-
-    # Step 3: Print
-    ctypesgencore.printer.WrapperPrinter(options.output, options, descriptions)
-
-    msgs.status_message("Wrapping complete.")
-
-    # Correct what may be a common mistake
-    if descriptions.all == []:
-        if not options.all_headers:
-            msgs.warning_message("There wasn't anything of use in the "
-                                 "specified header file(s). Perhaps you meant to run with "
-                                 "--all-headers to include objects from included sub-headers? ",
-                                 cls='usage')

python/grass/ctypes/ctypesgencore/LICENSE → python/grass/ctypes/ctypesgen/LICENSE


+ 28 - 7
python/grass/ctypes/ctypesgencore/__init__.py

@@ -1,4 +1,6 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
+# -*- coding: us-ascii -*-
+# vim:ts=4:sw=4:softtabstop=4:smarttab:expandtab
 
 
 """
 """
 Ctypesgencore is the module that contains the main body of ctypesgen - in fact,
 Ctypesgencore is the module that contains the main body of ctypesgen - in fact,
@@ -31,7 +33,7 @@ Ctypesgen writes the descriptions to the output file, along with a header.
 
 
 The package ctypesgen.printer is responsible for the printing stage.
 The package ctypesgen.printer is responsible for the printing stage.
 
 
-There are three modules in ctypesgencore that describe the format that the
+There are three modules in ctypesgen that describe the format that the
 parser, processor, and printer modules use to pass information. They are:
 parser, processor, and printer modules use to pass information. They are:
 
 
 * descriptions: Classes to represent the descriptions.
 * descriptions: Classes to represent the descriptions.
@@ -42,15 +44,32 @@ parser, processor, and printer modules use to pass information. They are:
 format.
 format.
 """
 """
 
 
-
-__all__ = ["parser", "processor", "printer",
-           "descriptions", "ctypedescs", "expressions",
-           "messages", "options"]
+__all__ = [
+    "parser",
+    "processor",
+    "printer",
+    "descriptions",
+    "ctypedescs",
+    "expressions",
+    "messages",
+    "options",
+    "version",
+]
 
 
 # Workhorse modules
 # Workhorse modules
 from . import parser
 from . import parser
 from . import processor
 from . import processor
-from . import printer
+from . import printer_python
+from . import version
+
+try:
+    from . import printer_json
+except ImportError:
+    pass
+
+__version__ = version.VERSION.partition("-")[-1]
+VERSION = __version__
+
 
 
 # Modules describing internal format
 # Modules describing internal format
 from . import descriptions
 from . import descriptions
@@ -60,3 +79,5 @@ from . import expressions
 # Helper modules
 # Helper modules
 from . import messages
 from . import messages
 from . import options
 from . import options
+
+printer = printer_python  # Default the printer to generating Python

+ 118 - 124
python/grass/ctypes/ctypesgencore/ctypedescs.py

@@ -1,7 +1,7 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
-'''
-ctypesgencore.ctypedescs contains classes to represent a C type. All of them
+"""
+ctypesgen.ctypedescs contains classes to represent a C type. All of them
 classes are subclasses of CtypesType.
 classes are subclasses of CtypesType.
 
 
 Unlike in previous versions of ctypesgen, CtypesType and its subclasses are
 Unlike in previous versions of ctypesgen, CtypesType and its subclasses are
@@ -17,64 +17,53 @@ representing an array of four integers could be created using:
 >>> ctype = CtypesArray(CtypesSimple("int",True,0),4)
 >>> ctype = CtypesArray(CtypesSimple("int",True,0),4)
 
 
 str(ctype) would evaluate to "c_int * 4".
 str(ctype) would evaluate to "c_int * 4".
-'''
+"""
 
 
 import warnings
 import warnings
 
 
-__docformat__ = 'restructuredtext'
+__docformat__ = "restructuredtext"
 
 
 ctypes_type_map = {
 ctypes_type_map = {
     # typename   signed  longs
     # typename   signed  longs
-    ('void', True, 0): 'None',
-    ('int', True, 0): 'c_int',
-    ('int', False, 0): 'c_uint',
-    ('int', True, 1): 'c_long',
-    ('int', False, 1): 'c_ulong',
-    ('int', True, 2): 'c_longlong',
-    ('int', False, 2): 'c_ulonglong',
-    ('char', True, 0): 'c_char',
-    ('char', False, 0): 'c_ubyte',
-    ('short', True, 0): 'c_short',
-    ('short', False, 0): 'c_ushort',
-    ('float', True, 0): 'c_float',
-    ('double', True, 0): 'c_double',
-    ('size_t', True, 0): 'c_size_t',
-    ('int8_t', True, 0): 'c_int8',
-    ('int16_t', True, 0): 'c_int16',
-    ('int32_t', True, 0): 'c_int32',
-    ('int64_t', True, 0): 'c_int64',
-    ('apr_int64_t', True, 0): 'c_int64',
-    ('__int64', True, 0): 'c_int64',
-    ('off64_t', True, 0): 'c_int64',
-    ('uint8_t', True, 0): 'c_uint8',
-    ('uint16_t', True, 0): 'c_uint16',
-    ('uint32_t', True, 0): 'c_uint32',
-    ('uint64_t', True, 0): 'c_uint64',
-    ('apr_uint64_t', True, 0): 'c_uint64',
-    ('wchar_t', True, 0): 'c_wchar',
-    ('ptrdiff_t', True, 0): 'c_ptrdiff_t',  # Requires definition in preamble
-    ('ssize_t', True, 0): 'c_ptrdiff_t',  # Requires definition in preamble
-    ('va_list', True, 0): 'c_void_p',
+    ("void", True, 0): "None",
+    ("int", True, 0): "c_int",
+    ("int", False, 0): "c_uint",
+    ("int", True, 1): "c_long",
+    ("int", False, 1): "c_ulong",
+    ("char", True, 0): "c_char",
+    ("char", False, 0): "c_ubyte",
+    ("short", True, 0): "c_short",
+    ("short", False, 0): "c_ushort",
+    ("float", True, 0): "c_float",
+    ("double", True, 0): "c_double",
+    ("double", True, 1): "c_longdouble",
+    ("int8_t", True, 0): "c_int8",
+    ("int16_t", True, 0): "c_int16",
+    ("int32_t", True, 0): "c_int32",
+    ("int64_t", True, 0): "c_int64",
+    ("__int64", True, 0): "c_int64",
+    ("uint8_t", True, 0): "c_uint8",
+    ("uint16_t", True, 0): "c_uint16",
+    ("uint32_t", True, 0): "c_uint32",
+    ("uint64_t", True, 0): "c_uint64",
+    ("_Bool", True, 0): "c_bool",
 }
 }
 
 
 ctypes_type_map_python_builtin = {
 ctypes_type_map_python_builtin = {
-    ('int', True, 2): 'c_longlong',
-    ('int', False, 2): 'c_ulonglong',
-    ('size_t', True, 0): 'c_size_t',
-    ('apr_int64_t', True, 0): 'c_int64',
-    ('off64_t', True, 0): 'c_int64',
-    ('apr_uint64_t', True, 0): 'c_uint64',
-    ('wchar_t', True, 0): 'c_wchar',
-    ('ptrdiff_t', True, 0): 'c_ptrdiff_t',  # Requires definition in preamble
-    ('ssize_t', True, 0): 'c_ptrdiff_t',  # Requires definition in preamble
-    ('va_list', True, 0): 'c_void_p',
+    ("int", True, 2): "c_longlong",
+    ("int", False, 2): "c_ulonglong",
+    ("size_t", True, 0): "c_size_t",
+    ("apr_int64_t", True, 0): "c_int64",
+    ("off64_t", True, 0): "c_int64",
+    ("apr_uint64_t", True, 0): "c_uint64",
+    ("wchar_t", True, 0): "c_wchar",
+    ("ptrdiff_t", True, 0): "c_ptrdiff_t",  # Requires definition in preamble
+    ("ssize_t", True, 0): "c_ptrdiff_t",  # Requires definition in preamble
+    ("va_list", True, 0): "c_void_p",
 }
 }
 
 
 # This protocol is used for walking type trees.
 # This protocol is used for walking type trees.
-
-
 class CtypesTypeVisitor(object):
 class CtypesTypeVisitor(object):
-
     def visit_struct(self, struct):
     def visit_struct(self, struct):
         pass
         pass
 
 
@@ -95,7 +84,6 @@ class CtypesTypeVisitor(object):
 
 
 def visit_type_and_collect_info(ctype):
 def visit_type_and_collect_info(ctype):
     class Visitor(CtypesTypeVisitor):
     class Visitor(CtypesTypeVisitor):
-
         def visit_struct(self, struct):
         def visit_struct(self, struct):
             structs.append(struct)
             structs.append(struct)
 
 
@@ -110,6 +98,7 @@ def visit_type_and_collect_info(ctype):
 
 
         def visit_identifier(self, identifier):
         def visit_identifier(self, identifier):
             identifiers.append(identifier)
             identifiers.append(identifier)
+
     structs = []
     structs = []
     enums = []
     enums = []
     typedefs = []
     typedefs = []
@@ -119,14 +108,13 @@ def visit_type_and_collect_info(ctype):
     ctype.visit(v)
     ctype.visit(v)
     return structs, enums, typedefs, errors, identifiers
     return structs, enums, typedefs, errors, identifiers
 
 
-# Remove one level of indirection from function pointer; needed for typedefs
-# and function parameters.
-
 
 
+# Remove one level of indirection from funtion pointer; needed for typedefs
+# and function parameters.
 def remove_function_pointer(t):
 def remove_function_pointer(t):
-    if isinstance(t, CtypesPointer) and isinstance(t.destination, CtypesFunction):
+    if type(t) == CtypesPointer and type(t.destination) == CtypesFunction:
         return t.destination
         return t.destination
-    elif isinstance(t, CtypesPointer):
+    elif type(t) == CtypesPointer:
         t.destination = remove_function_pointer(t.destination)
         t.destination = remove_function_pointer(t.destination)
         return t
         return t
     else:
     else:
@@ -134,12 +122,12 @@ def remove_function_pointer(t):
 
 
 
 
 class CtypesType(object):
 class CtypesType(object):
-
     def __init__(self):
     def __init__(self):
+        super(CtypesType, self).__init__()
         self.errors = []
         self.errors = []
 
 
     def __repr__(self):
     def __repr__(self):
-        return "<Ctype \"%s\">" % self.py_string()
+        return '<Ctype (%s) "%s">' % (type(self).__name__, self.py_string())
 
 
     def error(self, message, cls=None):
     def error(self, message, cls=None):
         self.errors.append((message, cls))
         self.errors.append((message, cls))
@@ -153,22 +141,21 @@ class CtypesSimple(CtypesType):
     """Represents a builtin type, like "char" or "int"."""
     """Represents a builtin type, like "char" or "int"."""
 
 
     def __init__(self, name, signed, longs):
     def __init__(self, name, signed, longs):
-        CtypesType.__init__(self)
+        super(CtypesSimple, self).__init__()
         self.name = name
         self.name = name
         self.signed = signed
         self.signed = signed
         self.longs = longs
         self.longs = longs
 
 
-    def py_string(self):
+    def py_string(self, ignore_can_be_ctype=None):
         return ctypes_type_map[(self.name, self.signed, self.longs)]
         return ctypes_type_map[(self.name, self.signed, self.longs)]
 
 
 
 
 class CtypesSpecial(CtypesType):
 class CtypesSpecial(CtypesType):
-
     def __init__(self, name):
     def __init__(self, name):
-        CtypesType.__init__(self)
+        super(CtypesSpecial, self).__init__()
         self.name = name
         self.name = name
 
 
-    def py_string(self):
+    def py_string(self, ignore_can_be_ctype=None):
         return self.name
         return self.name
 
 
 
 
@@ -176,53 +163,50 @@ class CtypesTypedef(CtypesType):
     """Represents a type defined by a typedef."""
     """Represents a type defined by a typedef."""
 
 
     def __init__(self, name):
     def __init__(self, name):
-        CtypesType.__init__(self)
+        super(CtypesTypedef, self).__init__()
         self.name = name
         self.name = name
 
 
     def visit(self, visitor):
     def visit(self, visitor):
         if not self.errors:
         if not self.errors:
             visitor.visit_typedef(self.name)
             visitor.visit_typedef(self.name)
-        CtypesType.visit(self, visitor)
+        super(CtypesTypedef, self).visit(visitor)
 
 
-    def py_string(self):
+    def py_string(self, ignore_can_be_ctype=None):
         return self.name
         return self.name
 
 
 
 
 class CtypesBitfield(CtypesType):
 class CtypesBitfield(CtypesType):
-
     def __init__(self, base, bitfield):
     def __init__(self, base, bitfield):
-        CtypesType.__init__(self)
+        super(CtypesBitfield, self).__init__()
         self.base = base
         self.base = base
         self.bitfield = bitfield
         self.bitfield = bitfield
 
 
     def visit(self, visitor):
     def visit(self, visitor):
         self.base.visit(visitor)
         self.base.visit(visitor)
-        CtypesType.visit(self, visitor)
+        super(CtypesBitfield, self).visit(visitor)
 
 
-    def py_string(self):
+    def py_string(self, ignore_can_be_ctype=None):
         return self.base.py_string()
         return self.base.py_string()
 
 
 
 
 class CtypesPointer(CtypesType):
 class CtypesPointer(CtypesType):
-
     def __init__(self, destination, qualifiers):
     def __init__(self, destination, qualifiers):
-        CtypesType.__init__(self)
+        super(CtypesPointer, self).__init__()
         self.destination = destination
         self.destination = destination
         self.qualifiers = qualifiers
         self.qualifiers = qualifiers
 
 
     def visit(self, visitor):
     def visit(self, visitor):
         if self.destination:
         if self.destination:
             self.destination.visit(visitor)
             self.destination.visit(visitor)
-        CtypesType.visit(self, visitor)
+        super(CtypesPointer, self).visit(visitor)
 
 
-    def py_string(self):
-        return 'POINTER(%s)' % self.destination.py_string()
+    def py_string(self, ignore_can_be_ctype=None):
+        return "POINTER(%s)" % self.destination.py_string()
 
 
 
 
 class CtypesArray(CtypesType):
 class CtypesArray(CtypesType):
-
     def __init__(self, base, count):
     def __init__(self, base, count):
-        CtypesType.__init__(self)
+        super(CtypesArray, self).__init__()
         self.base = base
         self.base = base
         self.count = count
         self.count = count
 
 
@@ -230,42 +214,38 @@ class CtypesArray(CtypesType):
         self.base.visit(visitor)
         self.base.visit(visitor)
         if self.count:
         if self.count:
             self.count.visit(visitor)
             self.count.visit(visitor)
-        CtypesType.visit(self, visitor)
+        super(CtypesArray, self).visit(visitor)
 
 
-    def py_string(self):
+    def py_string(self, ignore_can_be_ctype=None):
         if self.count is None:
         if self.count is None:
-            return 'POINTER(%s)' % self.base.py_string()
-        if isinstance(self.base, CtypesArray):
-            return '(%s) * %s' % (self.base.py_string(),
-                                  self.count.py_string(False))
+            return "POINTER(%s)" % self.base.py_string()
+        if type(self.base) == CtypesArray:
+            return "(%s) * int(%s)" % (self.base.py_string(), self.count.py_string(False))
         else:
         else:
-            return '%s * %s' % (self.base.py_string(),
-                                self.count.py_string(False))
+            return "%s * int(%s)" % (self.base.py_string(), self.count.py_string(False))
 
 
 
 
 class CtypesNoErrorCheck(object):
 class CtypesNoErrorCheck(object):
-
-    def py_string(self):
-        return 'None'
+    def py_string(self, ignore_can_be_ctype=None):
+        return "None"
 
 
     def __bool__(self):
     def __bool__(self):
         return False
         return False
+
     __nonzero__ = __bool__
     __nonzero__ = __bool__
 
 
 
 
 class CtypesPointerCast(object):
 class CtypesPointerCast(object):
-
     def __init__(self, target):
     def __init__(self, target):
         self.target = target
         self.target = target
 
 
-    def py_string(self):
-        return 'lambda v,*a : cast(v, {})'.format(self.target.py_string())
+    def py_string(self, ignore_can_be_ctype=None):
+        return "lambda v,*a : cast(v, {})".format(self.target.py_string())
 
 
 
 
 class CtypesFunction(CtypesType):
 class CtypesFunction(CtypesType):
-
-    def __init__(self, restype, parameters, variadic=False):
-        CtypesType.__init__(self)
+    def __init__(self, restype, parameters, variadic, attrib=dict()):
+        super(CtypesFunction, self).__init__()
         self.restype = restype
         self.restype = restype
         self.errcheck = CtypesNoErrorCheck()
         self.errcheck = CtypesNoErrorCheck()
 
 
@@ -273,58 +253,72 @@ class CtypesFunction(CtypesType):
         # when ctypes automagically returns it as an int.
         # when ctypes automagically returns it as an int.
         # Instead, convert to POINTER(c_void).  c_void is not a ctypes type,
         # Instead, convert to POINTER(c_void).  c_void is not a ctypes type,
         # you can make it any arbitrary type.
         # you can make it any arbitrary type.
-        if isinstance(self.restype, CtypesPointer) and \
-           isinstance(self.restype.destination, CtypesSimple) and \
-           self.restype.destination.name == 'void':
+        if (
+            type(self.restype) == CtypesPointer
+            and type(self.restype.destination) == CtypesSimple
+            and self.restype.destination.name == "void"
+        ):
             # we will provide a means of converting this to a c_void_p
             # we will provide a means of converting this to a c_void_p
-            self.restype = CtypesPointer(CtypesSpecial('c_ubyte'), ())
-            self.errcheck = CtypesPointerCast(CtypesSpecial('c_void_p'))
+            self.restype = CtypesPointer(CtypesSpecial("c_ubyte"), ())
+            self.errcheck = CtypesPointerCast(CtypesSpecial("c_void_p"))
 
 
         # Return "String" instead of "POINTER(c_char)"
         # Return "String" instead of "POINTER(c_char)"
-        if self.restype.py_string() == 'POINTER(c_char)':
-            if 'const' in self.restype.qualifiers:
-                self.restype = CtypesSpecial('c_char_p')
+        if self.restype.py_string() == "POINTER(c_char)":
+            if "const" in self.restype.qualifiers:
+                self.restype = CtypesSpecial("c_char_p")
             else:
             else:
-                self.restype = CtypesSpecial('String')
+                self.restype = CtypesSpecial("String")
 
 
         self.argtypes = [remove_function_pointer(p) for p in parameters]
         self.argtypes = [remove_function_pointer(p) for p in parameters]
         self.variadic = variadic
         self.variadic = variadic
+        self.attrib = attrib
 
 
     def visit(self, visitor):
     def visit(self, visitor):
         self.restype.visit(visitor)
         self.restype.visit(visitor)
         for a in self.argtypes:
         for a in self.argtypes:
             a.visit(visitor)
             a.visit(visitor)
-        CtypesType.visit(self, visitor)
+        super(CtypesFunction, self).visit(visitor)
+
+    def py_string(self, ignore_can_be_ctype=None):
+        return "CFUNCTYPE(UNCHECKED(%s), %s)" % (
+            self.restype.py_string(),
+            ", ".join([a.py_string() for a in self.argtypes]),
+        )
 
 
-    def py_string(self):
-        return 'CFUNCTYPE(UNCHECKED(%s), %s)' % (self.restype.py_string(),
-                                                 ', '.join([a.py_string() for a in self.argtypes]))
 
 
 last_tagnum = 0
 last_tagnum = 0
 
 
 
 
-def anonymous_struct_tag():
+def anonymous_struct_tagnum():
     global last_tagnum
     global last_tagnum
     last_tagnum += 1
     last_tagnum += 1
-    return 'anon_%d' % last_tagnum
+    return last_tagnum
 
 
+def fmt_anonymous_struct_tag(num):
+    return "anon_%d" % num
 
 
-class CtypesStruct(CtypesType):
+def anonymous_struct_tag():
+    return fmt_anonymous_struct_tag(anonymous_struct_tagnum())
 
 
-    def __init__(self, tag, packed, variety, members, src=None):
-        CtypesType.__init__(self)
+
+class CtypesStruct(CtypesType):
+    def __init__(self, tag, attrib, variety, members, src=None):
+        super(CtypesStruct, self).__init__()
         self.tag = tag
         self.tag = tag
-        self.packed = packed
+        self.attrib = attrib
         self.variety = variety  # "struct" or "union"
         self.variety = variety  # "struct" or "union"
         self.members = members
         self.members = members
 
 
-        if not self.tag:
-            self.tag = anonymous_struct_tag()
+        if type(self.tag) == int or not self.tag:
+            if type(self.tag) == int:
+              self.tag = fmt_anonymous_struct_tag(self.tag)
+            else:
+              self.tag = anonymous_struct_tag()
             self.anonymous = True
             self.anonymous = True
         else:
         else:
             self.anonymous = False
             self.anonymous = False
 
 
-        if self.members is None:
+        if self.members == None:
             self.opaque = True
             self.opaque = True
         else:
         else:
             self.opaque = False
             self.opaque = False
@@ -332,7 +326,7 @@ class CtypesStruct(CtypesType):
         self.src = src
         self.src = src
 
 
     def get_required_types(self):
     def get_required_types(self):
-        types = CtypesType.get_required_types(self)
+        types = super(CtypesStruct, self).get_required_types()
         types.add((self.variety, self.tag))
         types.add((self.variety, self.tag))
         return types
         return types
 
 
@@ -341,7 +335,7 @@ class CtypesStruct(CtypesType):
         if not self.opaque:
         if not self.opaque:
             for name, ctype in self.members:
             for name, ctype in self.members:
                 ctype.visit(visitor)
                 ctype.visit(visitor)
-        CtypesType.visit(self, visitor)
+        super(CtypesStruct, self).visit(visitor)
 
 
     def get_subtypes(self):
     def get_subtypes(self):
         if self.opaque:
         if self.opaque:
@@ -349,22 +343,22 @@ class CtypesStruct(CtypesType):
         else:
         else:
             return set([m[1] for m in self.members])
             return set([m[1] for m in self.members])
 
 
-    def py_string(self):
+    def py_string(self, ignore_can_be_ctype=None):
         return "%s_%s" % (self.variety, self.tag)
         return "%s_%s" % (self.variety, self.tag)
 
 
+
 last_tagnum = 0
 last_tagnum = 0
 
 
 
 
 def anonymous_enum_tag():
 def anonymous_enum_tag():
     global last_tagnum
     global last_tagnum
     last_tagnum += 1
     last_tagnum += 1
-    return 'anon_%d' % last_tagnum
+    return "anon_%d" % last_tagnum
 
 
 
 
 class CtypesEnum(CtypesType):
 class CtypesEnum(CtypesType):
-
     def __init__(self, tag, enumerators, src=None):
     def __init__(self, tag, enumerators, src=None):
-        CtypesType.__init__(self)
+        super(CtypesEnum, self).__init__()
         self.tag = tag
         self.tag = tag
         self.enumerators = enumerators
         self.enumerators = enumerators
 
 
@@ -374,7 +368,7 @@ class CtypesEnum(CtypesType):
         else:
         else:
             self.anonymous = False
             self.anonymous = False
 
 
-        if self.enumerators is None:
+        if self.enumerators == None:
             self.opaque = True
             self.opaque = True
         else:
         else:
             self.opaque = False
             self.opaque = False
@@ -383,7 +377,7 @@ class CtypesEnum(CtypesType):
 
 
     def visit(self, visitor):
     def visit(self, visitor):
         visitor.visit_enum(self)
         visitor.visit_enum(self)
-        CtypesType.visit(self, visitor)
+        super(CtypesEnum, self).visit(visitor)
 
 
-    def py_string(self):
-        return 'enum_%s' % self.tag
+    def py_string(self, ignore_can_be_ctype=None):
+        return "enum_%s" % self.tag

+ 44 - 21
python/grass/ctypes/ctypesgencore/descriptions.py

@@ -1,7 +1,7 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
-ctypesgencore.descriptions contains classes to represent a description of a
+ctypesgen.descriptions contains classes to represent a description of a
 struct, union, enum, function, constant, variable, or macro. All the
 struct, union, enum, function, constant, variable, or macro. All the
 description classes are subclassed from an abstract base class, Description.
 description classes are subclassed from an abstract base class, Description.
 The descriptions module also contains a class, DescriptionCollection, to hold
 The descriptions module also contains a class, DescriptionCollection, to hold
@@ -12,8 +12,9 @@ lists of Description objects.
 class DescriptionCollection(object):
 class DescriptionCollection(object):
     """Represents a collection of Descriptions."""
     """Represents a collection of Descriptions."""
 
 
-    def __init__(self, constants, typedefs, structs, enums, functions, variables,
-                 macros, all, output_order):
+    def __init__(
+        self, constants, typedefs, structs, enums, functions, variables, macros, all, output_order
+    ):
         self.constants = constants
         self.constants = constants
         self.typedefs = typedefs
         self.typedefs = typedefs
         self.structs = structs
         self.structs = structs
@@ -30,6 +31,7 @@ class Description(object):
     or macro description. Description is an abstract base class."""
     or macro description. Description is an abstract base class."""
 
 
     def __init__(self, src=None):
     def __init__(self, src=None):
+        super(Description, self).__init__()
         self.src = src  # A tuple of (filename, lineno)
         self.src = src  # A tuple of (filename, lineno)
 
 
         # If object will be included in output file. Values are "yes", "never",
         # If object will be included in output file. Values are "yes", "never",
@@ -82,14 +84,14 @@ class ConstantDescription(Description):
     """Simple class to contain information about a constant."""
     """Simple class to contain information about a constant."""
 
 
     def __init__(self, name, value, src=None):
     def __init__(self, name, value, src=None):
-        Description.__init__(self, src)
+        super(ConstantDescription, self).__init__(src)
         # Name of constant, a string
         # Name of constant, a string
         self.name = name
         self.name = name
         # Value of constant, as an ExpressionNode object
         # Value of constant, as an ExpressionNode object
         self.value = value
         self.value = value
 
 
     def casual_name(self):
     def casual_name(self):
-        return "Constant \"%s\"" % self.name
+        return 'Constant "%s"' % self.name
 
 
     def py_name(self):
     def py_name(self):
         return self.name
         return self.name
@@ -102,12 +104,12 @@ class TypedefDescription(Description):
     """Simple container class for a type definition."""
     """Simple container class for a type definition."""
 
 
     def __init__(self, name, ctype, src=None):
     def __init__(self, name, ctype, src=None):
-        Description.__init__(self, src)
+        super(TypedefDescription, self).__init__(src)
         self.name = name  # Name, a string
         self.name = name  # Name, a string
         self.ctype = ctype  # The base type as a ctypedescs.CtypeType object
         self.ctype = ctype  # The base type as a ctypedescs.CtypeType object
 
 
     def casual_name(self):
     def casual_name(self):
-        return "Typedef \"%s\"" % self.name
+        return 'Typedef "%s"' % self.name
 
 
     def py_name(self):
     def py_name(self):
         return self.name
         return self.name
@@ -119,11 +121,11 @@ class TypedefDescription(Description):
 class StructDescription(Description):
 class StructDescription(Description):
     """Simple container class for a structure or union definition."""
     """Simple container class for a structure or union definition."""
 
 
-    def __init__(self, tag, packed, variety, members, opaque, ctype, src=None):
-        Description.__init__(self, src)
+    def __init__(self, tag, attrib, variety, members, opaque, ctype, src=None):
+        super(StructDescription, self).__init__(src)
         # The name of the structure minus the "struct" or "union"
         # The name of the structure minus the "struct" or "union"
         self.tag = tag
         self.tag = tag
-        self.packed = packed
+        self.attrib = attrib
         # A string "struct" or "union"
         # A string "struct" or "union"
         self.variety = variety
         self.variety = variety
         # A list of pairs of (name,ctype)
         # A list of pairs of (name,ctype)
@@ -134,7 +136,7 @@ class StructDescription(Description):
         self.ctype = ctype
         self.ctype = ctype
 
 
     def casual_name(self):
     def casual_name(self):
-        return "%s \"%s\"" % (self.variety.capitalize(), self.tag)
+        return '%s "%s"' % (self.variety.capitalize(), self.tag)
 
 
     def py_name(self):
     def py_name(self):
         return "%s_%s" % (self.variety, self.tag)
         return "%s_%s" % (self.variety, self.tag)
@@ -147,7 +149,7 @@ class EnumDescription(Description):
     """Simple container class for an enum definition."""
     """Simple container class for an enum definition."""
 
 
     def __init__(self, tag, members, ctype, src=None):
     def __init__(self, tag, members, ctype, src=None):
-        Description.__init__(self, src)
+        super(EnumDescription, self).__init__(src)
         # The name of the enum, minus the "enum"
         # The name of the enum, minus the "enum"
         self.tag = tag
         self.tag = tag
         # A list of (name,value) pairs where value is a number
         # A list of (name,value) pairs where value is a number
@@ -156,7 +158,7 @@ class EnumDescription(Description):
         self.ctype = ctype
         self.ctype = ctype
 
 
     def casual_name(self):
     def casual_name(self):
-        return "Enum \"%s\"" % self.tag
+        return 'Enum "%s"' % self.tag
 
 
     def py_name(self):
     def py_name(self):
         return "enum_%s" % self.tag
         return "enum_%s" % self.tag
@@ -168,8 +170,8 @@ class EnumDescription(Description):
 class FunctionDescription(Description):
 class FunctionDescription(Description):
     """Simple container class for a C function."""
     """Simple container class for a C function."""
 
 
-    def __init__(self, name, restype, argtypes, errcheck, variadic=False, src=None):
-        Description.__init__(self, src)
+    def __init__(self, name, restype, argtypes, errcheck, variadic, attrib, src):
+        super(FunctionDescription, self).__init__(src)
         # Name, a string
         # Name, a string
         self.name = name
         self.name = name
         # Name according to C - stored in case description is renamed
         # Name according to C - stored in case description is renamed
@@ -182,9 +184,11 @@ class FunctionDescription(Description):
         self.errcheck = errcheck
         self.errcheck = errcheck
         # Does this function accept a variable number of arguments?
         # Does this function accept a variable number of arguments?
         self.variadic = variadic
         self.variadic = variadic
+        # The set of attributes applied to the function (e.g. stdcall)
+        self.attrib = attrib
 
 
     def casual_name(self):
     def casual_name(self):
-        return "Function \"%s\"" % self.name
+        return 'Function "%s"' % self.name
 
 
     def py_name(self):
     def py_name(self):
         return self.name
         return self.name
@@ -197,7 +201,7 @@ class VariableDescription(Description):
     """Simple container class for a C variable declaration."""
     """Simple container class for a C variable declaration."""
 
 
     def __init__(self, name, ctype, src=None):
     def __init__(self, name, ctype, src=None):
-        Description.__init__(self, src)
+        super(VariableDescription, self).__init__(src)
         # Name, a string
         # Name, a string
         self.name = name
         self.name = name
         # Name according to C - stored in case description is renamed
         # Name according to C - stored in case description is renamed
@@ -206,7 +210,7 @@ class VariableDescription(Description):
         self.ctype = ctype
         self.ctype = ctype
 
 
     def casual_name(self):
     def casual_name(self):
-        return "Variable \"%s\"" % self.name
+        return 'Variable "%s"' % self.name
 
 
     def py_name(self):
     def py_name(self):
         return self.name
         return self.name
@@ -219,16 +223,35 @@ class MacroDescription(Description):
     """Simple container class for a C macro."""
     """Simple container class for a C macro."""
 
 
     def __init__(self, name, params, expr, src=None):
     def __init__(self, name, params, expr, src=None):
-        Description.__init__(self, src)
+        super(MacroDescription, self).__init__(src)
         self.name = name
         self.name = name
         self.params = params
         self.params = params
         self.expr = expr  # ExpressionNode for the macro's body
         self.expr = expr  # ExpressionNode for the macro's body
 
 
     def casual_name(self):
     def casual_name(self):
-        return "Macro \"%s\"" % self.name
+        return 'Macro "%s"' % self.name
 
 
     def py_name(self):
     def py_name(self):
         return self.name
         return self.name
 
 
     def c_name(self):
     def c_name(self):
         return self.name
         return self.name
+
+
+class UndefDescription(Description):
+    """Simple container class for a preprocessor #undef directive."""
+
+    def __init__(self, macro, src=None):
+        super(UndefDescription, self).__init__(src)
+        self.include_rule = "if_needed"
+
+        self.macro = macro
+
+    def casual_name(self):
+        return 'Undef "%s"' % self.macro.name
+
+    def py_name(self):
+        return "#undef:%s" % self.macro.name
+
+    def c_name(self):
+        return "#undef %s" % self.macro.name

+ 72 - 75
python/grass/ctypes/ctypesgencore/expressions.py

@@ -1,15 +1,15 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
-'''
+"""
 The expressions module contains classes to represent an expression. The main
 The expressions module contains classes to represent an expression. The main
 class is ExpressionNode. ExpressionNode's most useful method is py_string(),
 class is ExpressionNode. ExpressionNode's most useful method is py_string(),
 which returns a Python string representing that expression.
 which returns a Python string representing that expression.
-'''
+"""
 
 
-import keyword
 import sys
 import sys
-from .ctypedescs import *
 
 
+from .ctypedescs import *
+import keyword
 
 
 # Right now, the objects in this module are all oriented toward evaluation.
 # Right now, the objects in this module are all oriented toward evaluation.
 # However, they don't have to be, since ctypes objects are mutable. For example,
 # However, they don't have to be, since ctypes objects are mutable. For example,
@@ -27,8 +27,8 @@ from .ctypedescs import *
 
 
 
 
 class EvaluationContext(object):
 class EvaluationContext(object):
-    '''Interface for evaluating expression nodes.
-    '''
+    """Interface for evaluating expression nodes.
+    """
 
 
     def evaluate_identifier(self, name):
     def evaluate_identifier(self, name):
         warnings.warn('Attempt to evaluate identifier "%s" failed' % name)
         warnings.warn('Attempt to evaluate identifier "%s" failed' % name)
@@ -48,7 +48,6 @@ class EvaluationContext(object):
 
 
 
 
 class ExpressionNode(object):
 class ExpressionNode(object):
-
     def __init__(self):
     def __init__(self):
         self.errors = []
         self.errors = []
 
 
@@ -60,7 +59,7 @@ class ExpressionNode(object):
             string = repr(self.py_string(True))
             string = repr(self.py_string(True))
         except ValueError:
         except ValueError:
             string = "<error in expression node>"
             string = "<error in expression node>"
-        return "<ExpressionNode: %s>" % string
+        return "<%s: %s>" % (type(self).__name__, string)
 
 
     def visit(self, visitor):
     def visit(self, visitor):
         for error, cls in self.errors:
         for error, cls in self.errors:
@@ -68,7 +67,6 @@ class ExpressionNode(object):
 
 
 
 
 class ConstantExpressionNode(ExpressionNode):
 class ConstantExpressionNode(ExpressionNode):
-
     def __init__(self, value):
     def __init__(self, value):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.value = value
         self.value = value
@@ -76,26 +74,17 @@ class ConstantExpressionNode(ExpressionNode):
     def evaluate(self, context):
     def evaluate(self, context):
         return self.value
         return self.value
 
 
-    try:
-        pos_inf = float('inf')
-        neg_inf = float('-inf')
-    except ValueError:
-        pos_inf = ()
-        neg_inf = ()
-
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
-        if (sys.platform != 'win32' or (sys.platform == 'win32' and
-                                        sys.version_info >= (2, 6))):
+        if sys.platform != "win32" or (sys.platform == "win32" and sys.version_info >= (2, 6)):
             # Windows python did not get infinity support until 2.6
             # Windows python did not get infinity support until 2.6
-            if self.value == ConstantExpressionNode.pos_inf:
+            if self.value == float("inf"):
                 return "float('inf')"
                 return "float('inf')"
-            elif self.value == ConstantExpressionNode.neg_inf:
+            elif self.value == float("-inf"):
                 return "float('-inf')"
                 return "float('-inf')"
         return repr(self.value)
         return repr(self.value)
 
 
 
 
 class IdentifierExpressionNode(ExpressionNode):
 class IdentifierExpressionNode(ExpressionNode):
-
     def __init__(self, name):
     def __init__(self, name):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.name = name
         self.name = name
@@ -114,7 +103,6 @@ class IdentifierExpressionNode(ExpressionNode):
 
 
 
 
 class ParameterExpressionNode(ExpressionNode):
 class ParameterExpressionNode(ExpressionNode):
-
     def __init__(self, name):
     def __init__(self, name):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.name = name
         self.name = name
@@ -132,7 +120,6 @@ class ParameterExpressionNode(ExpressionNode):
 
 
 
 
 class UnaryExpressionNode(ExpressionNode):
 class UnaryExpressionNode(ExpressionNode):
-
     def __init__(self, name, op, format, child_can_be_ctype, child):
     def __init__(self, name, op, format, child_can_be_ctype, child):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.name = name
         self.name = name
@@ -149,16 +136,13 @@ class UnaryExpressionNode(ExpressionNode):
         if self.op:
         if self.op:
             return self.op(self.child.evaluate(context))
             return self.op(self.child.evaluate(context))
         else:
         else:
-            raise ValueError("The C operator \"%s\" can't be evaluated right "
-                             "now" % self.name)
+            raise ValueError('The C operator "%s" can\'t be evaluated right ' "now" % self.name)
 
 
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
-        return self.format % \
-            self.child.py_string(self.child_can_be_ctype and can_be_ctype)
+        return self.format % self.child.py_string(self.child_can_be_ctype and can_be_ctype)
 
 
 
 
 class SizeOfExpressionNode(ExpressionNode):
 class SizeOfExpressionNode(ExpressionNode):
-
     def __init__(self, child):
     def __init__(self, child):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.child = child
         self.child = child
@@ -175,13 +159,12 @@ class SizeOfExpressionNode(ExpressionNode):
 
 
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
         if isinstance(self.child, CtypesType):
         if isinstance(self.child, CtypesType):
-            return 'sizeof(%s)' % self.child.py_string()
+            return "sizeof(%s)" % self.child.py_string()
         else:
         else:
-            return 'sizeof(%s)' % self.child.py_string(True)
+            return "sizeof(%s)" % self.child.py_string(True)
 
 
 
 
 class BinaryExpressionNode(ExpressionNode):
 class BinaryExpressionNode(ExpressionNode):
-
     def __init__(self, name, op, format, can_be_ctype, left, right):
     def __init__(self, name, op, format, can_be_ctype, left, right):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.name = name
         self.name = name
@@ -198,20 +181,18 @@ class BinaryExpressionNode(ExpressionNode):
 
 
     def evaluate(self, context):
     def evaluate(self, context):
         if self.op:
         if self.op:
-            return self.op(self.left.evaluate(context),
-                           self.right.evaluate(context))
+            return self.op(self.left.evaluate(context), self.right.evaluate(context))
         else:
         else:
-            raise ValueError("The C operator \"%s\" can't be evaluated right "
-                             "now" % self.name)
+            raise ValueError('The C operator "%s" can\'t be evaluated right ' "now" % self.name)
 
 
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
-        return self.format % \
-            (self.left.py_string(self.can_be_ctype[0] and can_be_ctype),
-             self.right.py_string(self.can_be_ctype[0] and can_be_ctype))
+        return self.format % (
+            self.left.py_string(self.can_be_ctype[0] and can_be_ctype),
+            self.right.py_string(self.can_be_ctype[0] and can_be_ctype),
+        )
 
 
 
 
 class ConditionalExpressionNode(ExpressionNode):
 class ConditionalExpressionNode(ExpressionNode):
-
     def __init__(self, cond, yes, no):
     def __init__(self, cond, yes, no):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.cond = cond
         self.cond = cond
@@ -231,14 +212,14 @@ class ConditionalExpressionNode(ExpressionNode):
             return self.no.evaluate(context)
             return self.no.evaluate(context)
 
 
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
-        return "(%s if %s else %s)" % \
-            (self.yes.py_string(can_be_ctype),
-             self.cond.py_string(True),
-             self.no.py_string(can_be_ctype))
+        return "%s and %s or %s" % (
+            self.cond.py_string(True),
+            self.yes.py_string(can_be_ctype),
+            self.no.py_string(can_be_ctype),
+        )
 
 
 
 
 class AttributeExpressionNode(ExpressionNode):
 class AttributeExpressionNode(ExpressionNode):
-
     def __init__(self, op, format, base, attribute):
     def __init__(self, op, format, base, attribute):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.op = op
         self.op = op
@@ -257,19 +238,18 @@ class AttributeExpressionNode(ExpressionNode):
         ExpressionNode.visit(self, visitor)
         ExpressionNode.visit(self, visitor)
 
 
     def evaluate(self, context):
     def evaluate(self, context):
-        return self.op(self.base.evaluate(context), self.attribute)
+        return self.op(self.base.evalute(context), self.attribute)
 
 
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
         if can_be_ctype:
         if can_be_ctype:
-            return self.format % (self.base.py_string(can_be_ctype),
-                                  self.attribute)
+            return self.format % (self.base.py_string(can_be_ctype), self.attribute)
         else:
         else:
-            return "(%s.value)" % (self.format %
-                                   (self.base.py_string(can_be_ctype), self.attribute))
+            return "(%s.value)" % (
+                self.format % (self.base.py_string(can_be_ctype), self.attribute)
+            )
 
 
 
 
 class CallExpressionNode(ExpressionNode):
 class CallExpressionNode(ExpressionNode):
-
     def __init__(self, function, arguments):
     def __init__(self, function, arguments):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.function = function
         self.function = function
@@ -288,57 +268,74 @@ class CallExpressionNode(ExpressionNode):
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
         function = self.function.py_string(can_be_ctype)
         function = self.function.py_string(can_be_ctype)
         arguments = [x.py_string(can_be_ctype) for x in self.arguments]
         arguments = [x.py_string(can_be_ctype) for x in self.arguments]
-        if can_be_ctype:
-            return '(%s (%s))' % (function, ", ".join(arguments))
-        else:
-            return '((%s (%s)).value)' % (function, ", ".join(arguments))
-
-# There seems not to be any reasonable way to translate C typecasts
-# into Python. Ctypesgen doesn't try, except for the special case of NULL.
+        return "(%s (%s))" % (function, ", ".join(arguments))
 
 
 
 
 class TypeCastExpressionNode(ExpressionNode):
 class TypeCastExpressionNode(ExpressionNode):
+    """
+    Type cast expressions as handled by ctypesgen.  There is a strong
+    possibility that this does not support all types of casts.
+    """
 
 
     def __init__(self, base, ctype):
     def __init__(self, base, ctype):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.base = base
         self.base = base
         self.ctype = ctype
         self.ctype = ctype
-        self.isnull = isinstance(ctype, CtypesPointer) and \
-            isinstance(base, ConstantExpressionNode) and \
-            base.value == 0
 
 
     def visit(self, visitor):
     def visit(self, visitor):
-        # No need to visit ctype because it isn't actually used
         self.base.visit(visitor)
         self.base.visit(visitor)
+        self.ctype.visit(visitor)
         ExpressionNode.visit(self, visitor)
         ExpressionNode.visit(self, visitor)
 
 
     def evaluate(self, context):
     def evaluate(self, context):
-        if self.isnull:
-            return None
-        else:
-            return self.base.evaluate(context)
+        return self.base.evaluate(context)
 
 
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
-        if self.isnull:
-            return "None"
+        if isinstance(self.ctype, CtypesPointer):
+            return "cast({}, {})".format(self.base.py_string(True), self.ctype.py_string())
+        elif isinstance(self.ctype, CtypesStruct):
+            raise TypeError(
+                "conversion to non-scalar type ({}) requested from {}".format(
+                    self.ctype, self.base.py_string(False)
+                )
+            )
         else:
         else:
-            return self.base.py_string(can_be_ctype)
+            # In reality, this conversion should only really work if the types
+            # are scalar types.  We won't work really hard to test if the types
+            # are  indeed scalar.
+            # To be backwards compatible, we always return literals for builtin types.
+            # We use a function to convert to integer for c_char types since
+            # c_char can take integer or byte types, but the others can *only*
+            # take non-char arguments.
+            # ord_if_char must be provided by preambles
+            if isinstance(self.ctype, CtypesSimple) and (self.ctype.name, self.ctype.signed) == (
+                "char",
+                True,
+            ):
+                ord_if_char = ""
+            elif isinstance(self.ctype, CtypesSimple) and self.ctype.name == "void":
+                # This is a very simple type cast:  cast everything to (void)
+                # At least one macro from mingw does this
+                return "None"
+            else:
+                ord_if_char = "ord_if_char"
+
+            return "({to} ({ord_if_char}({frm}))).value".format(
+                to=self.ctype.py_string(), ord_if_char=ord_if_char, frm=self.base.py_string(False)
+            )
 
 
 
 
 class UnsupportedExpressionNode(ExpressionNode):
 class UnsupportedExpressionNode(ExpressionNode):
-
     def __init__(self, message):
     def __init__(self, message):
         ExpressionNode.__init__(self)
         ExpressionNode.__init__(self)
         self.message = message
         self.message = message
-        self.error(message, 'unsupported-type')
+        self.error(message, "unsupported-type")
 
 
     def evaluate(self, context):
     def evaluate(self, context):
-        raise ValueError("Tried to evaluate an unsupported expression "
-                         "node: %s" % self.message)
+        raise ValueError("Tried to evaluate an unsupported expression " "node: %s" % self.message)
 
 
     def __repr__(self):
     def __repr__(self):
         return "<UnsupportedExpressionNode>"
         return "<UnsupportedExpressionNode>"
 
 
     def py_string(self, can_be_ctype):
     def py_string(self, can_be_ctype):
-        raise ValueError("Called py_string() an unsupported expression "
-                         "node: %s" % self.message)
+        raise ValueError("Called py_string() an unsupported expression " "node: %s" % self.message)

+ 364 - 0
python/grass/ctypes/ctypesgen/libraryloader.py

@@ -0,0 +1,364 @@
+# ----------------------------------------------------------------------------
+# Copyright (c) 2008 David James
+# Copyright (c) 2006-2008 Alex Holkner
+# All rights reserved.
+#
+# Redistribution and use in source and binary forms, with or without
+# modification, are permitted provided that the following conditions
+# are met:
+#
+#  * Redistributions of source code must retain the above copyright
+#    notice, this list of conditions and the following disclaimer.
+#  * Redistributions in binary form must reproduce the above copyright
+#    notice, this list of conditions and the following disclaimer in
+#    the documentation and/or other materials provided with the
+#    distribution.
+#  * Neither the name of pyglet nor the names of its
+#    contributors may be used to endorse or promote products
+#    derived from this software without specific prior written
+#    permission.
+#
+# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
+# FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+# COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
+# INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
+# BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+# CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
+# LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN
+# ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+# POSSIBILITY OF SUCH DAMAGE.
+# ----------------------------------------------------------------------------
+
+import os.path, re, sys, glob
+import platform
+import ctypes
+import ctypes.util
+
+
+def _environ_path(name):
+    if name in os.environ:
+        return os.environ[name].split(":")
+    else:
+        return []
+
+
+class LibraryLoader(object):
+    # library names formatted specifically for platforms
+    name_formats = ["%s"]
+
+    class Lookup(object):
+        mode = ctypes.DEFAULT_MODE
+
+        def __init__(self, path):
+            super(LibraryLoader.Lookup, self).__init__()
+            self.access = dict(cdecl=ctypes.CDLL(path, self.mode))
+
+        def get(self, name, calling_convention="cdecl"):
+            if calling_convention not in self.access:
+                raise LookupError(
+                    "Unknown calling convention '{}' for function '{}'".format(
+                        calling_convention, name
+                    )
+                )
+            return getattr(self.access[calling_convention], name)
+
+        def has(self, name, calling_convention="cdecl"):
+            if calling_convention not in self.access:
+                return False
+            return hasattr(self.access[calling_convention], name)
+
+        def __getattr__(self, name):
+            return getattr(self.access["cdecl"], name)
+
+    def __init__(self):
+        self.other_dirs = []
+
+    def __call__(self, libname):
+        """Given the name of a library, load it."""
+        paths = self.getpaths(libname)
+
+        for path in paths:
+            try:
+                return self.Lookup(path)
+            except:
+                pass
+
+        raise ImportError("Could not load %s." % libname)
+
+    def getpaths(self, libname):
+        """Return a list of paths where the library might be found."""
+        if os.path.isabs(libname):
+            yield libname
+        else:
+            # search through a prioritized series of locations for the library
+
+            # we first search any specific directories identified by user
+            for dir_i in self.other_dirs:
+                for fmt in self.name_formats:
+                    # dir_i should be absolute already
+                    yield os.path.join(dir_i, fmt % libname)
+
+            # then we search the directory where the generated python interface is stored
+            for fmt in self.name_formats:
+                yield os.path.abspath(os.path.join(os.path.dirname(__file__), fmt % libname))
+
+            # now, use the ctypes tools to try to find the library
+            for fmt in self.name_formats:
+                path = ctypes.util.find_library(fmt % libname)
+                if path:
+                    yield path
+
+            # then we search all paths identified as platform-specific lib paths
+            for path in self.getplatformpaths(libname):
+                yield path
+
+            # Finally, we'll try the users current working directory
+            for fmt in self.name_formats:
+                yield os.path.abspath(os.path.join(os.path.curdir, fmt % libname))
+
+    def getplatformpaths(self, libname):
+        return []
+
+
+# Darwin (Mac OS X)
+
+
+class DarwinLibraryLoader(LibraryLoader):
+    name_formats = [
+        "lib%s.dylib",
+        "lib%s.so",
+        "lib%s.bundle",
+        "%s.dylib",
+        "%s.so",
+        "%s.bundle",
+        "%s",
+    ]
+
+    class Lookup(LibraryLoader.Lookup):
+        # Darwin requires dlopen to be called with mode RTLD_GLOBAL instead
+        # of the default RTLD_LOCAL.  Without this, you end up with
+        # libraries not being loadable, resulting in "Symbol not found"
+        # errors
+        mode = ctypes.RTLD_GLOBAL
+
+    def getplatformpaths(self, libname):
+        if os.path.pathsep in libname:
+            names = [libname]
+        else:
+            names = [format % libname for format in self.name_formats]
+
+        for dir in self.getdirs(libname):
+            for name in names:
+                yield os.path.join(dir, name)
+
+    def getdirs(self, libname):
+        """Implements the dylib search as specified in Apple documentation:
+
+        http://developer.apple.com/documentation/DeveloperTools/Conceptual/
+            DynamicLibraries/Articles/DynamicLibraryUsageGuidelines.html
+
+        Before commencing the standard search, the method first checks
+        the bundle's ``Frameworks`` directory if the application is running
+        within a bundle (OS X .app).
+        """
+
+        dyld_fallback_library_path = _environ_path("DYLD_FALLBACK_LIBRARY_PATH")
+        if not dyld_fallback_library_path:
+            dyld_fallback_library_path = [os.path.expanduser("~/lib"), "/usr/local/lib", "/usr/lib"]
+        dyld_fallback_library_path.extend(_environ_path('LD_RUN_PATH'))
+
+        dirs = []
+
+        if "/" in libname:
+            dirs.extend(_environ_path("DYLD_LIBRARY_PATH"))
+        else:
+            dirs.extend(_environ_path("LD_LIBRARY_PATH"))
+            dirs.extend(_environ_path("DYLD_LIBRARY_PATH"))
+
+        if hasattr(sys, "frozen") and sys.frozen == "macosx_app":
+            dirs.append(os.path.join(os.environ["RESOURCEPATH"], "..", "Frameworks"))
+
+        dirs.extend(dyld_fallback_library_path)
+
+        return dirs
+
+
+# Posix
+
+
+class PosixLibraryLoader(LibraryLoader):
+    _ld_so_cache = None
+
+    _include = re.compile(r"^\s*include\s+(?P<pattern>.*)")
+
+    class _Directories(dict):
+        def __init__(self):
+            self.order = 0
+
+        def add(self, directory):
+            if len(directory) > 1:
+                directory = directory.rstrip(os.path.sep)
+            # only adds and updates order if exists and not already in set
+            if not os.path.exists(directory):
+                return
+            o = self.setdefault(directory, self.order)
+            if o == self.order:
+                self.order += 1
+
+        def extend(self, directories):
+            for d in directories:
+                self.add(d)
+
+        def ordered(self):
+            return (i[0] for i in sorted(self.items(), key=lambda D: D[1]))
+
+    def _get_ld_so_conf_dirs(self, conf, dirs):
+        """
+        Recursive funtion to help parse all ld.so.conf files, including proper
+        handling of the `include` directive.
+        """
+
+        try:
+            with open(conf) as f:
+                for D in f:
+                    D = D.strip()
+                    if not D:
+                        continue
+
+                    m = self._include.match(D)
+                    if not m:
+                        dirs.add(D)
+                    else:
+                        for D2 in glob.glob(m.group("pattern")):
+                            self._get_ld_so_conf_dirs(D2, dirs)
+        except IOError:
+            pass
+
+    def _create_ld_so_cache(self):
+        # Recreate search path followed by ld.so.  This is going to be
+        # slow to build, and incorrect (ld.so uses ld.so.cache, which may
+        # not be up-to-date).  Used only as fallback for distros without
+        # /sbin/ldconfig.
+        #
+        # We assume the DT_RPATH and DT_RUNPATH binary sections are omitted.
+
+        directories = self._Directories()
+        for name in (
+            "LD_LIBRARY_PATH",
+            "SHLIB_PATH",  # HPUX
+            "LIBPATH",  # OS/2, AIX
+            "LIBRARY_PATH",  # BE/OS
+        ):
+            if name in os.environ:
+                directories.extend(os.environ[name].split(os.pathsep))
+
+        self._get_ld_so_conf_dirs("/etc/ld.so.conf", directories)
+
+        bitage = platform.architecture()[0]
+
+        unix_lib_dirs_list = []
+        if bitage.startswith("64"):
+            # prefer 64 bit if that is our arch
+            unix_lib_dirs_list += ["/lib64", "/usr/lib64"]
+
+        # must include standard libs, since those paths are also used by 64 bit
+        # installs
+        unix_lib_dirs_list += ["/lib", "/usr/lib"]
+        if sys.platform.startswith("linux"):
+            # Try and support multiarch work in Ubuntu
+            # https://wiki.ubuntu.com/MultiarchSpec
+            if bitage.startswith("32"):
+                # Assume Intel/AMD x86 compat
+                unix_lib_dirs_list += ["/lib/i386-linux-gnu", "/usr/lib/i386-linux-gnu"]
+            elif bitage.startswith("64"):
+                # Assume Intel/AMD x86 compat
+                unix_lib_dirs_list += ["/lib/x86_64-linux-gnu", "/usr/lib/x86_64-linux-gnu"]
+            else:
+                # guess...
+                unix_lib_dirs_list += glob.glob("/lib/*linux-gnu")
+        directories.extend(unix_lib_dirs_list)
+
+        cache = {}
+        lib_re = re.compile(r"lib(.*)\.s[ol]")
+        ext_re = re.compile(r"\.s[ol]$")
+        for dir in directories.ordered():
+            try:
+                for path in glob.glob("%s/*.s[ol]*" % dir):
+                    file = os.path.basename(path)
+
+                    # Index by filename
+                    cache_i = cache.setdefault(file, set())
+                    cache_i.add(path)
+
+                    # Index by library name
+                    match = lib_re.match(file)
+                    if match:
+                        library = match.group(1)
+                        cache_i = cache.setdefault(library, set())
+                        cache_i.add(path)
+            except OSError:
+                pass
+
+        self._ld_so_cache = cache
+
+    def getplatformpaths(self, libname):
+        if self._ld_so_cache is None:
+            self._create_ld_so_cache()
+
+        result = self._ld_so_cache.get(libname, set())
+        for i in result:
+            # we iterate through all found paths for library, since we may have
+            # actually found multiple architectures or other library types that
+            # may not load
+            yield i
+
+
+# Windows
+
+
+class WindowsLibraryLoader(LibraryLoader):
+    name_formats = ["%s.dll", "lib%s.dll", "%slib.dll", "%s"]
+
+    def __init__(self):
+        super().__init__()
+        for p in os.getenv("PATH").split(";"):
+            if os.path.exists(p) and hasattr(os, "add_dll_directory"):
+                os.add_dll_directory(p)
+
+    class Lookup(LibraryLoader.Lookup):
+        def __init__(self, path):
+            super(WindowsLibraryLoader.Lookup, self).__init__(path)
+            self.access["stdcall"] = ctypes.windll.LoadLibrary(path)
+
+
+# Platform switching
+
+# If your value of sys.platform does not appear in this dict, please contact
+# the Ctypesgen maintainers.
+
+loaderclass = {
+    "darwin": DarwinLibraryLoader,
+    "cygwin": WindowsLibraryLoader,
+    "win32": WindowsLibraryLoader,
+    "msys": WindowsLibraryLoader,
+}
+
+load_library = loaderclass.get(sys.platform, PosixLibraryLoader)()
+
+
+def add_library_search_dirs(other_dirs):
+    """
+    Add libraries to search paths.
+    If library paths are relative, convert them to absolute with respect to this
+    file's directory
+    """
+    for F in other_dirs:
+        if not os.path.isabs(F):
+            F = os.path.abspath(F)
+        load_library.other_dirs.append(F)
+
+
+del loaderclass

+ 391 - 0
python/grass/ctypes/ctypesgen/main.py

@@ -0,0 +1,391 @@
+# -*- coding: us-ascii -*-
+# vim:ts=4:sw=4:softtabstop=4:smarttab:expandtab
+"""
+Main loop for ctypesgen.
+"""
+
+import optparse, sys
+
+from . import options as core_options
+from . import parser as core_parser
+from . import printer_python, printer_json, processor
+from . import messages as msgs
+from . import version
+
+
+def find_names_in_modules(modules):
+    names = set()
+    for module in modules:
+        try:
+            mod = __import__(module)
+        except:
+            pass
+        else:
+            names.update(dir(mod))
+    return names
+
+
+def option_callback_W(option, opt, value, parser):
+    # Options preceded by a "-Wl," are simply treated as though the "-Wl,"
+    # is not there? I don't understand the purpose of this code...
+    if len(value) < 4 or value[0:3] != "l,-":
+        raise optparse.BadOptionError("not in '-Wl,<opt>' form: %s%s" % (opt, value))
+    opt = value[2:]
+    if opt not in ["-L", "-R", "--rpath"]:
+        raise optparse.BadOptionError("-Wl option must be -L, -R" " or --rpath, not " + value[2:])
+    # Push the linker option onto the list for further parsing.
+    parser.rargs.insert(0, value)
+
+
+def option_callback_libdir(option, opt, value, parser):
+    # There are two sets of linker search paths: those for use at compile time
+    # and those for use at runtime. Search paths specified with -L, -R, or
+    # --rpath are added to both sets.
+    parser.values.compile_libdirs.append(value)
+    parser.values.runtime_libdirs.append(value)
+
+
+def main(givenargs=None):
+    usage = "usage: %prog [options] /path/to/header.h ..."
+    op = optparse.OptionParser(usage=usage, version=version.VERSION_NUMBER)
+
+    # Parameters
+    op.add_option(
+        "-o",
+        "--output",
+        dest="output",
+        metavar="FILE",
+        help="write wrapper to FILE [default stdout]",
+    )
+    op.add_option(
+        "-l",
+        "--library",
+        dest="libraries",
+        action="append",
+        default=[],
+        metavar="LIBRARY",
+        help="link to LIBRARY",
+    )
+    op.add_option(
+        "",
+        "--include",
+        dest="other_headers",
+        action="append",
+        default=[],
+        metavar="HEADER",
+        help="include system header HEADER (e.g. stdio.h or stdlib.h)",
+    )
+    op.add_option(
+        "-m",
+        "--module",
+        "--link-module",
+        action="append",
+        dest="modules",
+        metavar="MODULE",
+        default=[],
+        help="use symbols from Python module MODULE",
+    )
+    op.add_option(
+        "-I",
+        "--includedir",
+        dest="include_search_paths",
+        action="append",
+        default=[],
+        metavar="INCLUDEDIR",
+        help="add INCLUDEDIR as a directory to search for headers",
+    )
+    op.add_option(
+        "-W",
+        action="callback",
+        callback=option_callback_W,
+        metavar="l,OPTION",
+        type="str",
+        help="where OPTION is -L, -R, or --rpath",
+    )
+    op.add_option(
+        "-L",
+        "-R",
+        "--rpath",
+        "--libdir",
+        action="callback",
+        callback=option_callback_libdir,
+        metavar="LIBDIR",
+        type="str",
+        help="Add LIBDIR to the search path (both compile-time and run-time)",
+    )
+    op.add_option(
+        "",
+        "--compile-libdir",
+        action="append",
+        dest="compile_libdirs",
+        metavar="LIBDIR",
+        default=[],
+        help="Add LIBDIR to the compile-time library search path.",
+    )
+    op.add_option(
+        "",
+        "--runtime-libdir",
+        action="append",
+        dest="runtime_libdirs",
+        metavar="LIBDIR",
+        default=[],
+        help="Add LIBDIR to the run-time library search path.",
+    )
+
+    # Parser options
+    op.add_option(
+        "",
+        "--cpp",
+        dest="cpp",
+        default="gcc -E",
+        help="The command to invoke the c preprocessor, including any "
+        "necessary options (default: gcc -E)",
+    )
+    op.add_option(
+        "-D",
+        "--define",
+        action="append",
+        dest="cpp_defines",
+        metavar="MACRO",
+        default=[],
+        help="Add a definition to the preprocessor via commandline",
+    )
+    op.add_option(
+        "-U",
+        "--undefine",
+        action="append",
+        dest="cpp_undefines",
+        metavar="NAME",
+        default=[],
+        help="Instruct the preprocessor to undefine the specified macro via commandline",
+    )
+    op.add_option(
+        "",
+        "--save-preprocessed-headers",
+        metavar="FILENAME",
+        dest="save_preprocessed_headers",
+        default=None,
+        help="Save the preprocessed headers to the specified FILENAME",
+    )
+    op.add_option(
+        "",
+        "--optimize-lexer",
+        dest="optimize_lexer",
+        action="store_true",
+        default=False,
+        help="Run the lexer in optimized mode.  This mode requires write "
+        "access to lextab.py file stored within the ctypesgen package.",
+    )
+
+    # Processor options
+    op.add_option(
+        "-a",
+        "--all-headers",
+        action="store_true",
+        dest="all_headers",
+        default=False,
+        help="include symbols from all headers, including system headers",
+    )
+    op.add_option(
+        "",
+        "--builtin-symbols",
+        action="store_true",
+        dest="builtin_symbols",
+        default=False,
+        help="include symbols automatically generated by the preprocessor",
+    )
+    op.add_option(
+        "",
+        "--no-macros",
+        action="store_false",
+        dest="include_macros",
+        default=True,
+        help="Don't output macros.",
+    )
+    op.add_option(
+        "",
+        "--no-undefs",
+        action="store_false",
+        dest="include_undefs",
+        default=True,
+        help="Do not remove macro definitions as per #undef directives",
+    )
+    op.add_option(
+        "-i",
+        "--include-symbols",
+        action="append",
+        dest="include_symbols",
+        metavar="REGEXPR",
+        default=[],
+        help="Regular expression for symbols to always include.  Multiple "
+        "instances of this option will be combined into a single expression "
+        "doing something like '(expr1|expr2|expr3)'.",
+    )
+    op.add_option(
+        "-x",
+        "--exclude-symbols",
+        action="append",
+        dest="exclude_symbols",
+        metavar="REGEXPR",
+        default=[],
+        help="Regular expression for symbols to exclude.  Multiple instances "
+        "of this option will be combined into a single expression doing "
+        "something like '(expr1|expr2|expr3)'.",
+    )
+    op.add_option(
+        "",
+        "--no-stddef-types",
+        action="store_true",
+        dest="no_stddef_types",
+        default=False,
+        help="Do not support extra C types from stddef.h",
+    )
+    op.add_option(
+        "",
+        "--no-gnu-types",
+        action="store_true",
+        dest="no_gnu_types",
+        default=False,
+        help="Do not support extra GNU C types",
+    )
+    op.add_option(
+        "",
+        "--no-python-types",
+        action="store_true",
+        dest="no_python_types",
+        default=False,
+        help="Do not support extra C types built in to Python",
+    )
+
+    # Printer options
+    op.add_option(
+        "",
+        "--header-template",
+        dest="header_template",
+        default=None,
+        metavar="TEMPLATE",
+        help="Use TEMPLATE as the header template in the output file.",
+    )
+    op.add_option(
+        "",
+        "--strip-build-path",
+        dest="strip_build_path",
+        default=None,
+        metavar="BUILD_PATH",
+        help="Strip build path from header paths in the wrapper file.",
+    )
+    op.add_option(
+        "",
+        "--insert-file",
+        dest="inserted_files",
+        default=[],
+        action="append",
+        metavar="FILENAME",
+        help="Add the contents of FILENAME to the end of the wrapper file.",
+    )
+    op.add_option(
+        "",
+        "--output-language",
+        dest="output_language",
+        metavar="LANGUAGE",
+        default="py",
+        choices=("py", "py32", "py27", "py25", "json"),
+        help="Choose output language (`py'[default], `py32', `py27', `py25', or "
+        "`json').  The implementation for py32 does appear to be "
+        "compatible down to at least Python2.7.15.  py25 and py27 are in "
+        "any case _not_ compatible with >= Python3.  The default choice "
+        "(py) attempts to select `py32', `py27', or `py25' based on the "
+        "version of Python that runs this script.",
+    )
+    op.add_option(
+        "-P",
+        "--strip-prefix",
+        dest="strip_prefixes",
+        default=[],
+        action="append",
+        metavar="REGEXPR",
+        help="Regular expression to match prefix to strip from all symbols.  "
+        "Multiple instances of this option will be combined into a single "
+        "expression doing something like '(expr1|expr2|expr3)'.",
+    )
+
+    # Error options
+    op.add_option(
+        "",
+        "--all-errors",
+        action="store_true",
+        default=False,
+        dest="show_all_errors",
+        help="Display all warnings and errors even " "if they would not affect output.",
+    )
+    op.add_option(
+        "",
+        "--show-long-errors",
+        action="store_true",
+        default=False,
+        dest="show_long_errors",
+        help="Display long error messages " "instead of abbreviating error messages.",
+    )
+    op.add_option(
+        "",
+        "--no-macro-warnings",
+        action="store_false",
+        default=True,
+        dest="show_macro_warnings",
+        help="Do not print macro warnings.",
+    )
+    op.add_option(
+        "",
+        "--debug-level",
+        dest="debug_level",
+        default=0,
+        type="int",
+        help="Run ctypesgen with specified debug level (also applies to yacc parser)",
+    )
+
+    op.set_defaults(**core_options.default_values)
+
+    (options, args) = op.parse_args(givenargs)
+    options.headers = args
+
+    # Figure out what names will be defined by imported Python modules
+    options.other_known_names = find_names_in_modules(options.modules)
+
+    # Required parameters
+    if len(args) < 1:
+        msgs.error_message("No header files specified", cls="usage")
+        sys.exit(1)
+
+    if len(options.libraries) == 0:
+        msgs.warning_message("No libraries specified", cls="usage")
+
+    # Check output language
+    printer = None
+    if options.output_language.startswith("py"):
+        printer = printer_python.WrapperPrinter
+    elif options.output_language == "json":
+        printer = printer_json.WrapperPrinter
+    else:
+        msgs.error_message("No such output language `" + options.output_language + "'", cls="usage")
+        sys.exit(1)
+
+    # Step 1: Parse
+    descriptions = core_parser.parse(options.headers, options)
+
+    # Step 2: Process
+    processor.process(descriptions, options)
+
+    # Step 3: Print
+    printer(options.output, options, descriptions)
+
+    msgs.status_message("Wrapping complete.")
+
+    # Correct what may be a common mistake
+    if descriptions.all == []:
+        if not options.all_headers:
+            msgs.warning_message(
+                "There wasn't anything of use in the "
+                "specified header file(s). Perhaps you meant to run with "
+                "--all-headers to include objects from included sub-headers? ",
+                cls="usage",
+            )

+ 7 - 9
python/grass/ctypes/ctypesgencore/messages.py

@@ -1,7 +1,7 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
-ctypesgencore.messages contains functions to display status, error, or warning
+ctypesgen.messages contains functions to display status, error, or warning
 messages to the user. Warning and error messages are also associated
 messages to the user. Warning and error messages are also associated
 with a "message class", which is a string, which currently has no effect.
 with a "message class", which is a string, which currently has no effect.
 
 
@@ -19,30 +19,28 @@ Warning classes are:
 'rename' - a description has been renamed to avoid a name conflict
 'rename' - a description has been renamed to avoid a name conflict
 'other' - catchall.
 'other' - catchall.
 """
 """
-from __future__ import print_function
 
 
 import sys
 import sys
 import logging
 import logging
 
 
 __all__ = ["error_message", "warning_message", "status_message"]
 __all__ = ["error_message", "warning_message", "status_message"]
 
 
-log = logging.getLogger('ctypesgen')
+log = logging.getLogger("ctypesgen")
 ch = logging.StreamHandler()  # use stdio
 ch = logging.StreamHandler()  # use stdio
 logging_fmt_str = "%(levelname)s: %(message)s"
 logging_fmt_str = "%(levelname)s: %(message)s"
 formatter = logging.Formatter(logging_fmt_str)
 formatter = logging.Formatter(logging_fmt_str)
 ch.setFormatter(formatter)
 ch.setFormatter(formatter)
 log.addHandler(ch)
 log.addHandler(ch)
-# default level that ctypesgen was using with original version
-log.setLevel(logging.INFO)
+log.setLevel(logging.INFO)  # default level that ctypesgen was using with original version
 
 
 
 
 def error_message(msg, cls=None):
 def error_message(msg, cls=None):
-    print("Error: %s" % msg)
+    log.error("%s", msg)
 
 
 
 
 def warning_message(msg, cls=None):
 def warning_message(msg, cls=None):
-    print("Warning: %s" % msg)
+    log.warning("%s", msg)
 
 
 
 
 def status_message(msg):
 def status_message(msg):
-    print("Status: %s" % msg)
+    log.info("Status: %s", msg)

+ 11 - 8
python/grass/ctypes/ctypesgencore/options.py

@@ -1,16 +1,14 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
 All of the components of ctypegencore require an argument called "options".
 All of the components of ctypegencore require an argument called "options".
 In command-line usage, this would be an optparser.Values object. However, if
 In command-line usage, this would be an optparser.Values object. However, if
-ctypesgencore is used as a standard Python module, constructing this object
+ctypesgen is used as a standard Python module, constructing this object
 would be a pain. So this module exists to provide a "default" options object
 would be a pain. So this module exists to provide a "default" options object
 for convenience.
 for convenience.
 """
 """
 
 
-import copy
-import optparse
-
+import optparse, copy
 
 
 default_values = {
 default_values = {
     "other_headers": [],
     "other_headers": [],
@@ -19,11 +17,13 @@ default_values = {
     "compile_libdirs": [],
     "compile_libdirs": [],
     "runtime_libdirs": [],
     "runtime_libdirs": [],
     "cpp": "gcc -E",
     "cpp": "gcc -E",
+    "cpp_defines": [],
+    "cpp_undefines": [],
     "save_preprocessed_headers": None,
     "save_preprocessed_headers": None,
     "all_headers": False,
     "all_headers": False,
     "builtin_symbols": False,
     "builtin_symbols": False,
-    "include_symbols": None,
-    "exclude_symbols": None,
+    "include_symbols": [],
+    "exclude_symbols": [],
     "show_all_errors": False,
     "show_all_errors": False,
     "show_long_errors": False,
     "show_long_errors": False,
     "show_macro_warnings": True,
     "show_macro_warnings": True,
@@ -31,12 +31,15 @@ default_values = {
     "inserted_files": [],
     "inserted_files": [],
     "other_known_names": [],
     "other_known_names": [],
     "include_macros": True,
     "include_macros": True,
+    "include_undefs": True,
     "libraries": [],
     "libraries": [],
     "strip_build_path": None,
     "strip_build_path": None,
-    "output_language": "python",
+    "output_language": "py",
     "no_stddef_types": False,
     "no_stddef_types": False,
     "no_gnu_types": False,
     "no_gnu_types": False,
     "no_python_types": False,
     "no_python_types": False,
+    "debug_level": 0,
+    "strip_prefixes": [],
 }
 }
 
 
 
 

+ 2 - 0
python/grass/ctypes/ctypesgen/parser/.gitignore

@@ -0,0 +1,2 @@
+new_parsetab.py
+parser.out

+ 3 - 2
python/grass/ctypes/ctypesgencore/parser/__init__.py

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
 This package parses C header files and generates lists of functions, typedefs,
 This package parses C header files and generates lists of functions, typedefs,
@@ -9,7 +9,7 @@ The public interface for this package is the function "parse". Use as follows:
 >>> descriptions = parse(["inputfile1.h","inputfile2.h"], options)
 >>> descriptions = parse(["inputfile1.h","inputfile2.h"], options)
 where "options" is an optparse.Values object.
 where "options" is an optparse.Values object.
 
 
-parse() returns a DescriptionCollection object. See ctypesgencore.descriptions
+parse() returns a DescriptionCollection object. See ctypesgen.descriptions
 for more information.
 for more information.
 
 
 """
 """
@@ -22,4 +22,5 @@ def parse(headers, options):
     parser.parse()
     parser.parse()
     return parser.data()
     return parser.data()
 
 
+
 __all__ = ["parse"]
 __all__ = ["parse"]

+ 290 - 0
python/grass/ctypes/ctypesgen/parser/cdeclarations.py

@@ -0,0 +1,290 @@
+#!/usr/bin/env python
+
+"""
+This file contains classes that represent C declarations. cparser produces
+declarations in this format, and ctypesparser reformats them into a format that
+is not C-specific. The other modules don't need to touch these.
+"""
+
+__docformat__ = "restructuredtext"
+
+# --------------------------------------------------------------------------
+# C Object Model
+# --------------------------------------------------------------------------
+
+
+class Declaration(object):
+    def __init__(self):
+        self.declarator = None
+        self.type = Type()
+        self.storage = None
+        self.attrib = Attrib()
+
+    def __repr__(self):
+        d = {"declarator": self.declarator, "type": self.type}
+        if self.storage:
+            d["storage"] = self.storage
+        l = ["%s=%r" % (k, v) for k, v in d.items()]
+        return "Declaration(%s)" % ", ".join(l)
+
+
+class Declarator(object):
+    pointer = None
+
+    def __init__(self):
+        self.identifier = None
+        self.initializer = None
+        self.array = None
+        self.parameters = None
+        self.bitfield = None
+        self.attrib = Attrib()
+
+    # make pointer read-only to catch mistakes early
+    pointer = property(lambda self: None)
+
+    def __repr__(self):
+        s = self.identifier or ""
+        if self.bitfield:
+            s += ":%d" % self.bitfield
+        if self.array:
+            s += repr(self.array)
+        if self.initializer:
+            s += " = %r" % self.initializer
+        if self.parameters is not None:
+            s += "(" + ", ".join([repr(p) for p in self.parameters]) + ")"
+        return s
+
+
+class Pointer(Declarator):
+    pointer = None
+
+    def __init__(self):
+        super(Pointer, self).__init__()
+        self.qualifiers = []
+
+    def __repr__(self):
+        q = ""
+        if self.qualifiers:
+            q = "<%s>" % " ".join(self.qualifiers)
+        return "POINTER%s(%r)" % (q, self.pointer) + super(Pointer, self).__repr__()
+
+
+class Array(object):
+    def __init__(self):
+        self.size = None
+        self.array = None
+
+    def __repr__(self):
+        if self.size:
+            a = "[%r]" % self.size
+        else:
+            a = "[]"
+        if self.array:
+            return repr(self.array) + a
+        else:
+            return a
+
+
+class Parameter(object):
+    def __init__(self):
+        self.type = Type()
+        self.storage = None
+        self.declarator = None
+        self.attrib = Attrib()
+
+    def __repr__(self):
+        d = {"type": self.type}
+        if self.declarator:
+            d["declarator"] = self.declarator
+        if self.storage:
+            d["storage"] = self.storage
+        l = ["%s=%r" % (k, v) for k, v in d.items()]
+        return "Parameter(%s)" % ", ".join(l)
+
+
+class Type(object):
+    def __init__(self):
+        self.qualifiers = []
+        self.specifiers = []
+
+    def __repr__(self):
+        return " ".join(self.qualifiers + [str(s) for s in self.specifiers])
+
+
+# These are used only internally.
+
+
+class StorageClassSpecifier(str):
+    def __repr__(self):
+        return "StorageClassSpecifier({})".format(str(self))
+
+
+class TypeSpecifier(str):
+    def __repr__(self):
+        return "TypeSpecifier({})".format(str(self))
+
+
+class StructTypeSpecifier(object):
+    def __init__(self, is_union, attrib, tag, declarations):
+        self.is_union = is_union
+        self.attrib = attrib
+        self.tag = tag
+        self.declarations = declarations
+        self.filename = None
+        self.lineno = -1
+
+    def __repr__(self):
+        if self.is_union:
+            s = "union"
+        else:
+            s = "struct"
+        if self.attrib:
+            attrs = list()
+            for attr, val in self.attrib.items():
+                if val and type(val) == str:
+                    attrs.append("{}({})".format(attr, val))
+                elif val:
+                    attrs.append(attr)
+
+            s += " __attribute__(({}))".format(",".join(attrs))
+        if self.tag and type(self.tag) != int:
+            s += " %s" % self.tag
+        if self.declarations:
+            s += " {%s}" % "; ".join([repr(d) for d in self.declarations])
+        return s
+
+
+class EnumSpecifier(object):
+    def __init__(self, tag, enumerators, src=None):
+        self.tag = tag
+        self.enumerators = enumerators
+        self.filename = None
+        self.lineno = -1
+
+    def __repr__(self):
+        s = "enum"
+        if self.tag:
+            s += " %s" % self.tag
+        if self.enumerators:
+            s += " {%s}" % ", ".join([repr(e) for e in self.enumerators])
+        return s
+
+
+class Enumerator(object):
+    def __init__(self, name, expression):
+        self.name = name
+        self.expression = expression
+
+    def __repr__(self):
+        s = self.name
+        if self.expression:
+            s += " = %r" % self.expression
+        return s
+
+
+class TypeQualifier(str):
+    def __repr__(self):
+        return "TypeQualifier({})".format(str(self))
+
+
+class PragmaPack(object):
+    DEFAULT = None
+
+    def __init__(self):
+        self.current = self.DEFAULT
+        self.stack = list()
+
+    def set_default(self):
+        self.current = self.DEFAULT
+
+    def push(self, id=None, value=None):
+        item = (id, self.current)
+        self.stack.append(item)
+
+        if value is not None:
+            self.current = value
+
+    def pop(self, id=None):
+        if not self.stack:
+            if id:
+                return (
+                    "#pragma pack(pop, {id}) encountered without matching "
+                    "#pragma pack(push, {id})".format(id=id),
+                )
+            else:
+                return "#pragma pack(pop) encountered without matching #pragma pack(push)"
+
+        item = None
+        err = None
+
+        if id is not None:
+            i = len(self.stack) - 1
+            while i >= 0 and self.stack[i][0] != id:
+                i -= 1
+
+            if i >= 0:
+                item = self.stack[i]
+                self.stack = self.stack[:i]
+            else:
+                err = (
+                    "#pragma pack(pop, {id}) encountered without matching "
+                    "#pragma pack(push, {id}); popped last".format(id=id)
+                )
+
+        if item is None:
+            item = self.stack.pop()
+
+        self.current = item[1]
+        return err
+
+
+pragma_pack = PragmaPack()
+
+
+class Attrib(dict):
+    def __init__(self, *a, **kw):
+        if pragma_pack.current:
+            super(Attrib, self).__init__(packed=True, aligned=[pragma_pack.current])
+            super(Attrib, self).update(*a, **kw)
+        else:
+            super(Attrib, self).__init__(*a, **kw)
+        self._unalias()
+
+    def __repr__(self):
+        return "Attrib({})".format(dict(self))
+
+    def update(self, *a, **kw):
+        super(Attrib, self).update(*a, **kw)
+        self._unalias()
+
+    def _unalias(self):
+        """
+        Check for any attribute aliases and remove leading/trailing '__'
+
+        According to https://gcc.gnu.org/onlinedocs/gcc/Attribute-Syntax.html,
+        an attribute can also be preceeded/followed by a double underscore
+        ('__').
+        """
+
+        self.pop(None, None)  # remove dummy empty attribute
+
+        fixes = [attr for attr in self if attr.startswith("__") and attr.endswith("__")]
+        for attr in fixes:
+            self[attr[2 : (len(attr) - 2)]] = self.pop(attr)
+
+
+def apply_specifiers(specifiers, declaration):
+    """Apply specifiers to the declaration (declaration may be
+    a Parameter instead)."""
+    for s in specifiers:
+        if type(s) == StorageClassSpecifier:
+            if declaration.storage:
+                # Multiple storage classes, technically an error... ignore it
+                pass
+            declaration.storage = s
+        elif type(s) in (TypeSpecifier, StructTypeSpecifier, EnumSpecifier):
+            declaration.type.specifiers.append(s)
+        elif type(s) == TypeQualifier:
+            declaration.type.qualifiers.append(s)
+        elif type(s) == Attrib:
+            declaration.attrib.update(s)

A diferenza do arquivo foi suprimida porque é demasiado grande
+ 647 - 422
python/grass/ctypes/ctypesgencore/parser/cgrammar.py


+ 89 - 72
python/grass/ctypes/ctypesgencore/parser/cparser.py

@@ -1,15 +1,13 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
-'''
+"""
 Parse a C source file.
 Parse a C source file.
 
 
 To use, subclass CParser and override its handle_* methods.  Then instantiate
 To use, subclass CParser and override its handle_* methods.  Then instantiate
 the class with a string to parse.
 the class with a string to parse.
-'''
-from __future__ import print_function
+"""
 
 
-
-__docformat__ = 'restructuredtext'
+__docformat__ = "restructuredtext"
 
 
 import operator
 import operator
 import os.path
 import os.path
@@ -18,11 +16,10 @@ import sys
 import time
 import time
 import warnings
 import warnings
 
 
-from . import cdeclarations
-from . import cgrammar
 from . import preprocessor
 from . import preprocessor
 from . import yacc
 from . import yacc
-
+from . import cgrammar
+from . import cdeclarations
 
 
 # --------------------------------------------------------------------------
 # --------------------------------------------------------------------------
 # Lexer
 # Lexer
@@ -30,7 +27,6 @@ from . import yacc
 
 
 
 
 class CLexer(object):
 class CLexer(object):
-
     def __init__(self, cparser):
     def __init__(self, cparser):
         self.cparser = cparser
         self.cparser = cparser
         self.type_names = set()
         self.type_names = set()
@@ -49,24 +45,36 @@ class CLexer(object):
             if not t:
             if not t:
                 break
                 break
 
 
-            if t.type == 'PP_DEFINE':
+            if t.type == "PP_DEFINE":
                 self.in_define = True
                 self.in_define = True
-            elif t.type == 'PP_END_DEFINE':
+            elif t.type == "PP_END_DEFINE":
                 self.in_define = False
                 self.in_define = False
 
 
             # Transform PP tokens into C tokens
             # Transform PP tokens into C tokens
-            elif t.type == 'LPAREN':
-                t.type = '('
-            elif t.type == 'PP_NUMBER':
-                t.type = 'CONSTANT'
-            elif t.type == 'IDENTIFIER' and t.value in cgrammar.keywords:
+            elif t.type == "LPAREN":
+                t.type = "("
+            elif t.type == "PP_NUMBER":
+                t.type = "CONSTANT"
+            elif t.type == "IDENTIFIER" and t.value in cgrammar.keywords:
                 t.type = t.value.upper()
                 t.type = t.value.upper()
-            elif t.type == 'IDENTIFIER' and t.value in self.type_names:
-                if (self.pos < 2 or self.tokens[self.pos - 2].type not in
-                        ('VOID', '_BOOL', 'CHAR', 'SHORT', 'INT', 'LONG',
-                         'FLOAT', 'DOUBLE', 'SIGNED', 'UNSIGNED', 'ENUM',
-                         'STRUCT', 'UNION', 'TYPE_NAME')):
-                    t.type = 'TYPE_NAME'
+            elif t.type == "IDENTIFIER" and t.value in self.type_names:
+                if self.pos < 2 or self.tokens[self.pos - 2].type not in (
+                    "VOID",
+                    "_BOOL",
+                    "CHAR",
+                    "SHORT",
+                    "INT",
+                    "LONG",
+                    "FLOAT",
+                    "DOUBLE",
+                    "SIGNED",
+                    "UNSIGNED",
+                    "ENUM",
+                    "STRUCT",
+                    "UNION",
+                    "TYPE_NAME",
+                ):
+                    t.type = "TYPE_NAME"
 
 
             t.lexer = self
             t.lexer = self
             t.clexpos = self.pos - 1
             t.clexpos = self.pos - 1
@@ -74,27 +82,31 @@ class CLexer(object):
             return t
             return t
         return None
         return None
 
 
+
 # --------------------------------------------------------------------------
 # --------------------------------------------------------------------------
 # Parser
 # Parser
 # --------------------------------------------------------------------------
 # --------------------------------------------------------------------------
 
 
 
 
 class CParser(object):
 class CParser(object):
-    '''Parse a C source file.
+    """Parse a C source file.
 
 
     Subclass and override the handle_* methods.  Call `parse` with a string
     Subclass and override the handle_* methods.  Call `parse` with a string
     to parse.
     to parse.
-    '''
+    """
 
 
-    def __init__(self, options, stddef_types=True, gnu_types=True):
+    def __init__(self, options):
+        super(CParser, self).__init__()
         self.preprocessor_parser = preprocessor.PreprocessorParser(options, self)
         self.preprocessor_parser = preprocessor.PreprocessorParser(options, self)
         self.parser = yacc.Parser()
         self.parser = yacc.Parser()
-        prototype = yacc.yacc(method='LALR',
-                              debug=False,
-                              module=cgrammar,
-                              write_tables=True,
-                              outputdir=os.path.dirname(__file__),
-                              optimize=True)
+        prototype = yacc.yacc(
+            method="LALR",
+            debug=False,
+            module=cgrammar,
+            write_tables=True,
+            outputdir=os.path.dirname(__file__),
+            optimize=True,
+        )
 
 
         # If yacc is reading tables from a file, then it won't find the error
         # If yacc is reading tables from a file, then it won't find the error
         # function... need to set it manually
         # function... need to set it manually
@@ -104,24 +116,24 @@ class CParser(object):
 
 
         self.lexer = CLexer(self)
         self.lexer = CLexer(self)
         if not options.no_stddef_types:
         if not options.no_stddef_types:
-            self.lexer.type_names.add('wchar_t')
-            self.lexer.type_names.add('ptrdiff_t')
-            self.lexer.type_names.add('size_t')
+            self.lexer.type_names.add("wchar_t")
+            self.lexer.type_names.add("ptrdiff_t")
+            self.lexer.type_names.add("size_t")
         if not options.no_gnu_types:
         if not options.no_gnu_types:
-            self.lexer.type_names.add('__builtin_va_list')
-        if sys.platform == 'win32' and not options.no_python_types:
-            self.lexer.type_names.add('__int64')
+            self.lexer.type_names.add("__builtin_va_list")
+        if sys.platform == "win32" and not options.no_python_types:
+            self.lexer.type_names.add("__int64")
 
 
     def parse(self, filename, debug=False):
     def parse(self, filename, debug=False):
-        '''Parse a file.
+        """Parse a file.
 
 
         If `debug` is True, parsing state is dumped to stdout.
         If `debug` is True, parsing state is dumped to stdout.
-        '''
+        """
 
 
-        self.handle_status('Preprocessing %s' % filename)
+        self.handle_status("Preprocessing %s" % filename)
         self.preprocessor_parser.parse(filename)
         self.preprocessor_parser.parse(filename)
         self.lexer.input(self.preprocessor_parser.output)
         self.lexer.input(self.preprocessor_parser.output)
-        self.handle_status('Parsing %s' % filename)
+        self.handle_status("Parsing %s" % filename)
         self.parser.parse(lexer=self.lexer, debug=debug)
         self.parser.parse(lexer=self.lexer, debug=debug)
 
 
     # ----------------------------------------------------------------------
     # ----------------------------------------------------------------------
@@ -129,59 +141,65 @@ class CParser(object):
     # ----------------------------------------------------------------------
     # ----------------------------------------------------------------------
 
 
     def handle_error(self, message, filename, lineno):
     def handle_error(self, message, filename, lineno):
-        '''A parse error occurred.
+        """A parse error occured.
 
 
         The default implementation prints `lineno` and `message` to stderr.
         The default implementation prints `lineno` and `message` to stderr.
         The parser will try to recover from errors by synchronising at the
         The parser will try to recover from errors by synchronising at the
         next semicolon.
         next semicolon.
-        '''
-        print('%s:%s %s' % (filename, lineno, message), file=sys.stderr)
+        """
+        sys.stderr.write("%s:%s %s\n" % (filename, lineno, message))
 
 
     def handle_pp_error(self, message):
     def handle_pp_error(self, message):
-        '''The C preprocessor emitted an error.
+        """The C preprocessor emitted an error.
 
 
-        The default implementation prints the error to stderr. If processing
+        The default implementatin prints the error to stderr. If processing
         can continue, it will.
         can continue, it will.
-        '''
-        print('Preprocessor:', message, file=sys.stderr)
+        """
+        sys.stderr.write("Preprocessor: {}\n".format(message))
 
 
     def handle_status(self, message):
     def handle_status(self, message):
-        '''Progress information.
+        """Progress information.
 
 
         The default implementationg prints message to stderr.
         The default implementationg prints message to stderr.
-        '''
-        print(message, file=sys.stderr)
+        """
+        sys.stderr.write("{}\n".format(message))
 
 
     def handle_define(self, name, params, value, filename, lineno):
     def handle_define(self, name, params, value, filename, lineno):
-        '''#define `name` `value`
+        """#define `name` `value`
         or #define `name`(`params`) `value`
         or #define `name`(`params`) `value`
 
 
         name is a string
         name is a string
         params is None or a list of strings
         params is None or a list of strings
         value is a ...?
         value is a ...?
-        '''
+        """
 
 
     def handle_define_constant(self, name, value, filename, lineno):
     def handle_define_constant(self, name, value, filename, lineno):
-        '''#define `name` `value`
+        """#define `name` `value`
 
 
         name is a string
         name is a string
         value is an ExpressionNode or None
         value is an ExpressionNode or None
-        '''
+        """
 
 
     def handle_define_macro(self, name, params, value, filename, lineno):
     def handle_define_macro(self, name, params, value, filename, lineno):
-        '''#define `name`(`params`) `value`
+        """#define `name`(`params`) `value`
 
 
         name is a string
         name is a string
         params is a list of strings
         params is a list of strings
         value is an ExpressionNode or None
         value is an ExpressionNode or None
-        '''
+        """
+
+    def handle_undefine(self, name, filename, lineno):
+        """#undef `name`
+
+        name is a string
+        """
 
 
     def impl_handle_declaration(self, declaration, filename, lineno):
     def impl_handle_declaration(self, declaration, filename, lineno):
-        '''Internal method that calls `handle_declaration`.  This method
+        """Internal method that calls `handle_declaration`.  This method
         also adds any new type definitions to the lexer's list of valid type
         also adds any new type definitions to the lexer's list of valid type
         names, which affects the parsing of subsequent declarations.
         names, which affects the parsing of subsequent declarations.
-        '''
-        if declaration.storage == 'typedef':
+        """
+        if declaration.storage == "typedef":
             declarator = declaration.declarator
             declarator = declaration.declarator
             if not declarator:
             if not declarator:
                 # XXX TEMPORARY while struct etc not filled
                 # XXX TEMPORARY while struct etc not filled
@@ -192,24 +210,24 @@ class CParser(object):
         self.handle_declaration(declaration, filename, lineno)
         self.handle_declaration(declaration, filename, lineno)
 
 
     def handle_declaration(self, declaration, filename, lineno):
     def handle_declaration(self, declaration, filename, lineno):
-        '''A declaration was encountered.
+        """A declaration was encountered.
 
 
         `declaration` is an instance of Declaration.  Where a declaration has
         `declaration` is an instance of Declaration.  Where a declaration has
         multiple initialisers, each is returned as a separate declaration.
         multiple initialisers, each is returned as a separate declaration.
-        '''
+        """
         pass
         pass
 
 
 
 
 class DebugCParser(CParser):
 class DebugCParser(CParser):
-    '''A convenience class that prints each invocation of a handle_* method to
+    """A convenience class that prints each invocation of a handle_* method to
     stdout.
     stdout.
-    '''
+    """
 
 
     def handle_define(self, name, value, filename, lineno):
     def handle_define(self, name, value, filename, lineno):
-        print('#define name=%r, value=%r' % (name, value))
+        print("#define name=%r, value=%r" % (name, value))
 
 
     def handle_define_constant(self, name, value, filename, lineno):
     def handle_define_constant(self, name, value, filename, lineno):
-        print('#define constant name=%r, value=%r' % (name, value))
+        print("#define constant name=%r, value=%r" % (name, value))
 
 
     def handle_declaration(self, declaration, filename, lineno):
     def handle_declaration(self, declaration, filename, lineno):
         print(declaration)
         print(declaration)
@@ -219,12 +237,11 @@ class DebugCParser(CParser):
 
 
     def handle_define_unparseable(self, name, params, value, filename, lineno):
     def handle_define_unparseable(self, name, params, value, filename, lineno):
         if params:
         if params:
-            original_string = "#define %s(%s) %s" % \
-                (name, ",".join(params), " ".join(value))
+            original_string = "#define %s(%s) %s" % (name, ",".join(params), " ".join(value))
         else:
         else:
-            original_string = "#define %s %s" % \
-                (name, " ".join(value))
+            original_string = "#define %s %s" % (name, " ".join(value))
         print(original_string)
         print(original_string)
 
 
-if __name__ == '__main__':
+
+if __name__ == "__main__":
     DebugCParser().parse(sys.argv[1], debug=True)
     DebugCParser().parse(sys.argv[1], debug=True)

+ 56 - 48
python/grass/ctypes/ctypesgencore/parser/ctypesparser.py

@@ -1,21 +1,20 @@
-#!/usr/bin/env python3
-
-'''
-ctypesgencore.parser.ctypesparser contains a class, CtypesParser, which is a
-subclass of ctypesgencore.parser.cparser.CParser. CtypesParser overrides the
+"""
+ctypesgen.parser.ctypesparser contains a class, CtypesParser, which is a
+subclass of ctypesgen.parser.cparser.CParser. CtypesParser overrides the
 handle_declaration() method of CParser. It turns the low-level type declarations
 handle_declaration() method of CParser. It turns the low-level type declarations
 produced by CParser into CtypesType instances and breaks the parser's general
 produced by CParser into CtypesType instances and breaks the parser's general
 declarations into function, variable, typedef, constant, and type descriptions.
 declarations into function, variable, typedef, constant, and type descriptions.
-'''
+"""
 
 
-__docformat__ = 'restructuredtext'
+__docformat__ = "restructuredtext"
 
 
 __all__ = ["CtypesParser"]
 __all__ = ["CtypesParser"]
 
 
-from .cdeclarations import *
+from ..ctypedescs import *
+from ..expressions import *
+
 from .cparser import *
 from .cparser import *
-from ctypesgencore.ctypedescs import *
-from ctypesgencore.expressions import *
+from .cdeclarations import *
 
 
 
 
 def make_enum_from_specifier(specifier):
 def make_enum_from_specifier(specifier):
@@ -28,19 +27,21 @@ def make_enum_from_specifier(specifier):
             value = e.expression
             value = e.expression
         else:
         else:
             if last_name:
             if last_name:
-                value = BinaryExpressionNode("addition", (lambda x, y: x + y),
-                                             "(%s + %s)", (False, False),
-                                             IdentifierExpressionNode(
-                                                 last_name),
-                                             ConstantExpressionNode(1))
+                value = BinaryExpressionNode(
+                    "addition",
+                    (lambda x, y: x + y),
+                    "(%s + %s)",
+                    (False, False),
+                    IdentifierExpressionNode(last_name),
+                    ConstantExpressionNode(1),
+                )
             else:
             else:
                 value = ConstantExpressionNode(0)
                 value = ConstantExpressionNode(0)
 
 
         enumerators.append((e.name, value))
         enumerators.append((e.name, value))
         last_name = e.name
         last_name = e.name
 
 
-    return CtypesEnum(tag, enumerators,
-                      src=(specifier.filename, specifier.lineno))
+    return CtypesEnum(tag, enumerators, src=(specifier.filename, specifier.lineno))
 
 
 
 
 def get_decl_id(decl):
 def get_decl_id(decl):
@@ -54,10 +55,10 @@ def get_decl_id(decl):
 
 
 
 
 class CtypesParser(CParser):
 class CtypesParser(CParser):
-    '''Parse a C file for declarations that can be used by ctypes.
+    """Parse a C file for declarations that can be used by ctypes.
 
 
     Subclass and override the handle_ctypes_* methods.
     Subclass and override the handle_ctypes_* methods.
-    '''
+    """
 
 
     def __init__(self, options):
     def __init__(self, options):
         super(CtypesParser, self).__init__(options)
         super(CtypesParser, self).__init__(options)
@@ -72,9 +73,9 @@ class CtypesParser(CParser):
         if specifier.declarations:
         if specifier.declarations:
             members = []
             members = []
             for declaration in specifier.declarations:
             for declaration in specifier.declarations:
-                t = self.get_ctypes_type(declaration.type,
-                                         declaration.declarator,
-                                         check_qualifiers=True)
+                t = self.get_ctypes_type(
+                    declaration.type, declaration.declarator, check_qualifiers=True
+                )
                 declarator = declaration.declarator
                 declarator = declaration.declarator
                 if declarator is None:
                 if declarator is None:
                     # Anonymous field in nested union/struct (C11/GCC).
                     # Anonymous field in nested union/struct (C11/GCC).
@@ -87,12 +88,13 @@ class CtypesParser(CParser):
         else:
         else:
             members = None
             members = None
 
 
-        return CtypesStruct(tag, specifier.is_packed, variety, members,
-                            src=(specifier.filename, specifier.lineno))
+        return CtypesStruct(
+            tag, specifier.attrib, variety, members, src=(specifier.filename, specifier.lineno)
+        )
 
 
     def get_ctypes_type(self, typ, declarator, check_qualifiers=False):
     def get_ctypes_type(self, typ, declarator, check_qualifiers=False):
         signed = True
         signed = True
-        typename = 'int'
+        typename = "int"
         longs = 0
         longs = 0
         t = None
         t = None
 
 
@@ -101,11 +103,11 @@ class CtypesParser(CParser):
                 t = self.make_struct_from_specifier(specifier)
                 t = self.make_struct_from_specifier(specifier)
             elif isinstance(specifier, EnumSpecifier):
             elif isinstance(specifier, EnumSpecifier):
                 t = make_enum_from_specifier(specifier)
                 t = make_enum_from_specifier(specifier)
-            elif specifier == 'signed':
+            elif specifier == "signed":
                 signed = True
                 signed = True
-            elif specifier == 'unsigned':
+            elif specifier == "unsigned":
                 signed = False
                 signed = False
-            elif specifier == 'long':
+            elif specifier == "long":
                 longs += 1
                 longs += 1
             else:
             else:
                 typename = str(specifier)
                 typename = str(specifier)
@@ -122,12 +124,14 @@ class CtypesParser(CParser):
                 name = " ".join(typ.specifiers)
                 name = " ".join(typ.specifiers)
                 if typename in [x[0] for x in self.type_map.keys()]:
                 if typename in [x[0] for x in self.type_map.keys()]:
                     # It's an unsupported variant of a builtin type
                     # It's an unsupported variant of a builtin type
-                    error = "Ctypes does not support the type \"%s\"." % name
+                    error = 'Ctypes does not support the type "%s".' % name
                 else:
                 else:
-                    error = "Ctypes does not support adding additional " \
-                        "specifiers to typedefs, such as \"%s\"" % name
+                    error = (
+                        "Ctypes does not support adding additional "
+                        'specifiers to typedefs, such as "%s"' % name
+                    )
                 t = CtypesTypedef(name)
                 t = CtypesTypedef(name)
-                t.error(error, cls='unsupported-type')
+                t.error(error, cls="unsupported-type")
 
 
             if declarator and declarator.bitfield:
             if declarator and declarator.bitfield:
                 t = CtypesBitfield(t, declarator.bitfield)
                 t = CtypesBitfield(t, declarator.bitfield)
@@ -155,8 +159,7 @@ class CtypesParser(CParser):
 
 
             qualifiers.extend(declarator.qualifiers)
             qualifiers.extend(declarator.qualifiers)
 
 
-            t = CtypesPointer(t, tuple(typ.qualifiers) +
-                              tuple(declarator.qualifiers))
+            t = CtypesPointer(t, tuple(typ.qualifiers) + tuple(declarator.qualifiers))
 
 
             declarator = declarator.pointer
             declarator = declarator.pointer
 
 
@@ -171,7 +174,7 @@ class CtypesParser(CParser):
                 ct = self.get_ctypes_type(param.type, param.declarator)
                 ct = self.get_ctypes_type(param.type, param.declarator)
                 ct.identifier = param_name
                 ct.identifier = param_name
                 params.append(ct)
                 params.append(ct)
-            t = CtypesFunction(t, params, variadic)
+            t = CtypesFunction(t, params, variadic, declarator.attrib)
 
 
         if declarator:
         if declarator:
             a = declarator.array
             a = declarator.array
@@ -179,10 +182,12 @@ class CtypesParser(CParser):
                 t = CtypesArray(t, a.size)
                 t = CtypesArray(t, a.size)
                 a = a.array
                 a = a.array
 
 
-        if (isinstance(t, CtypesPointer) and
-            isinstance(t.destination, CtypesSimple) and
-            t.destination.name == "char" and
-                t.destination.signed):
+        if (
+            isinstance(t, CtypesPointer)
+            and isinstance(t.destination, CtypesSimple)
+            and t.destination.name == "char"
+            and t.destination.signed
+        ):
             t = CtypesSpecial("String")
             t = CtypesSpecial("String")
 
 
         return t
         return t
@@ -191,8 +196,7 @@ class CtypesParser(CParser):
         t = self.get_ctypes_type(declaration.type, declaration.declarator)
         t = self.get_ctypes_type(declaration.type, declaration.declarator)
 
 
         if type(t) in (CtypesStruct, CtypesEnum):
         if type(t) in (CtypesStruct, CtypesEnum):
-            self.handle_ctypes_new_type(
-                remove_function_pointer(t), filename, lineno)
+            self.handle_ctypes_new_type(remove_function_pointer(t), filename, lineno)
 
 
         declarator = declaration.declarator
         declarator = declaration.declarator
         if declarator is None:
         if declarator is None:
@@ -201,13 +205,15 @@ class CtypesParser(CParser):
         while declarator.pointer:
         while declarator.pointer:
             declarator = declarator.pointer
             declarator = declarator.pointer
         name = declarator.identifier
         name = declarator.identifier
-        if declaration.storage == 'typedef':
-            self.handle_ctypes_typedef(
-                name, remove_function_pointer(t), filename, lineno)
-        elif isinstance(t, CtypesFunction):
+        if declaration.storage == "typedef":
+            self.handle_ctypes_typedef(name, remove_function_pointer(t), filename, lineno)
+        elif type(t) == CtypesFunction:
+            attrib = Attrib(t.attrib)
+            attrib.update(declaration.attrib)
             self.handle_ctypes_function(
             self.handle_ctypes_function(
-                name, t.restype, t.argtypes, t.errcheck, t.variadic, filename, lineno)
-        elif declaration.storage != 'static':
+                name, t.restype, t.argtypes, t.errcheck, t.variadic, attrib, filename, lineno
+            )
+        elif declaration.storage != "static":
             self.handle_ctypes_variable(name, t, filename, lineno)
             self.handle_ctypes_variable(name, t, filename, lineno)
 
 
     # ctypes parser interface.  Override these methods in your subclass.
     # ctypes parser interface.  Override these methods in your subclass.
@@ -218,7 +224,9 @@ class CtypesParser(CParser):
     def handle_ctypes_typedef(self, name, ctype, filename, lineno):
     def handle_ctypes_typedef(self, name, ctype, filename, lineno):
         pass
         pass
 
 
-    def handle_ctypes_function(self, name, restype, argtypes, errcheck, filename, lineno):
+    def handle_ctypes_function(
+        self, name, restype, argtypes, errcheck, variadic, attrib, filename, lineno
+    ):
         pass
         pass
 
 
     def handle_ctypes_variable(self, name, ctype, filename, lineno):
     def handle_ctypes_variable(self, name, ctype, filename, lineno):

+ 98 - 97
python/grass/ctypes/ctypesgencore/parser/datacollectingparser.py

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
 DataCollectingParser subclasses ctypesparser.CtypesParser and builds Description
 DataCollectingParser subclasses ctypesparser.CtypesParser and builds Description
@@ -6,21 +6,17 @@ objects from the CtypesType objects and other information from CtypesParser.
 After parsing is complete, a DescriptionCollection object can be retrieved by
 After parsing is complete, a DescriptionCollection object can be retrieved by
 calling DataCollectingParser.data().
 calling DataCollectingParser.data().
 """
 """
-from __future__ import print_function
-
-
-import os
-from tempfile import mkstemp
 
 
 from . import ctypesparser
 from . import ctypesparser
-from ctypesgencore.ctypedescs import *
-from ctypesgencore.descriptions import *
-from ctypesgencore.expressions import *
-from ctypesgencore.messages import *
+from ..descriptions import *
+from ..ctypedescs import *
+from ..expressions import *
+from ..messages import *
+from tempfile import mkstemp
+import os
 
 
 
 
-class DataCollectingParser(ctypesparser.CtypesParser,
-                           ctypesparser.CtypesTypeVisitor):
+class DataCollectingParser(ctypesparser.CtypesParser, ctypesparser.CtypesTypeVisitor):
     """Main class for the Parser component. Steps for use:
     """Main class for the Parser component. Steps for use:
     p=DataCollectingParser(names_of_header_files,options)
     p=DataCollectingParser(names_of_header_files,options)
     p.parse()
     p.parse()
@@ -28,7 +24,7 @@ class DataCollectingParser(ctypesparser.CtypesParser,
     """
     """
 
 
     def __init__(self, headers, options):
     def __init__(self, headers, options):
-        ctypesparser.CtypesParser.__init__(self, options)
+        super(DataCollectingParser, self).__init__(options)
         self.headers = headers
         self.headers = headers
         self.options = options
         self.options = options
 
 
@@ -64,15 +60,16 @@ class DataCollectingParser(ctypesparser.CtypesParser,
 
 
     def parse(self):
     def parse(self):
         fd, fname = mkstemp(suffix=".h")
         fd, fname = mkstemp(suffix=".h")
-        f = os.fdopen(fd, 'w')
-        for header in self.options.other_headers:
-            print('#include <%s>' % header, file=f)
-        for header in self.headers:
-            print('#include "%s"' % os.path.abspath(header), file=f)
-        f.flush()
-        f.close()
-        ctypesparser.CtypesParser.parse(self, fname, False)
-        os.remove(fname)
+        with os.fdopen(fd, "w") as f:
+            for header in self.options.other_headers:
+                f.write("#include <%s>\n" % header)
+            for header in self.headers:
+                f.write('#include "%s"\n' % os.path.abspath(header))
+            f.flush()
+        try:
+            super(DataCollectingParser, self).parse(fname, self.options.debug_level)
+        finally:
+            os.unlink(fname)
 
 
         for name, params, expr, (filename, lineno) in self.saved_macros:
         for name, params, expr, (filename, lineno) in self.saved_macros:
             self.handle_macro(name, params, expr, filename, lineno)
             self.handle_macro(name, params, expr, filename, lineno)
@@ -85,36 +82,34 @@ class DataCollectingParser(ctypesparser.CtypesParser,
     def handle_define_unparseable(self, name, params, value, filename, lineno):
     def handle_define_unparseable(self, name, params, value, filename, lineno):
         # Called by CParser
         # Called by CParser
         if params:
         if params:
-            original_string = "#define %s(%s) %s" % \
-                (name, ",".join(params), " ".join(value))
+            original_string = "#define %s(%s) %s" % (name, ",".join(params), " ".join(value))
         else:
         else:
-            original_string = "#define %s %s" % \
-                (name, " ".join(value))
-        macro = MacroDescription(name, params, None,
-                                 src=(filename, lineno))
-        macro.error("Could not parse macro \"%s\"" % original_string,
-                    cls='macro')
+            original_string = "#define %s %s" % (name, " ".join(value))
+        macro = MacroDescription(name, params, None, src=(filename, lineno))
+        macro.error('Could not parse macro "%s"' % original_string, cls="macro")
         macro.original_string = original_string
         macro.original_string = original_string
         self.macros.append(macro)
         self.macros.append(macro)
         self.all.append(macro)
         self.all.append(macro)
-        self.output_order.append(('macro', macro))
+        self.output_order.append(("macro", macro))
 
 
     def handle_define_macro(self, name, params, expr, filename, lineno):
     def handle_define_macro(self, name, params, expr, filename, lineno):
         # Called by CParser
         # Called by CParser
         # Save to handle later
         # Save to handle later
         self.saved_macros.append((name, params, expr, (filename, lineno)))
         self.saved_macros.append((name, params, expr, (filename, lineno)))
 
 
+    def handle_undefine(self, macro, filename, lineno):
+        # save to handle later to get order correct
+        self.saved_macros.append(("#undef", None, macro, (filename, lineno)))
+
     def handle_ctypes_typedef(self, name, ctype, filename, lineno):
     def handle_ctypes_typedef(self, name, ctype, filename, lineno):
         # Called by CtypesParser
         # Called by CtypesParser
         ctype.visit(self)
         ctype.visit(self)
 
 
-        typedef = TypedefDescription(name,
-                                     ctype,
-                                     src=(filename, repr(lineno)))
+        typedef = TypedefDescription(name, ctype, src=(filename, repr(lineno)))
 
 
         self.typedefs.append(typedef)
         self.typedefs.append(typedef)
         self.all.append(typedef)
         self.all.append(typedef)
-        self.output_order.append(('typedef', typedef))
+        self.output_order.append(("typedef", typedef))
 
 
     def handle_ctypes_new_type(self, ctype, filename, lineno):
     def handle_ctypes_new_type(self, ctype, filename, lineno):
         # Called by CtypesParser
         # Called by CtypesParser
@@ -123,35 +118,31 @@ class DataCollectingParser(ctypesparser.CtypesParser,
         else:
         else:
             self.handle_struct(ctype, filename, lineno)
             self.handle_struct(ctype, filename, lineno)
 
 
-    def handle_ctypes_function(self, name, restype, argtypes, errcheck,
-                               variadic, filename, lineno):
+    def handle_ctypes_function(
+        self, name, restype, argtypes, errcheck, variadic, attrib, filename, lineno
+    ):
         # Called by CtypesParser
         # Called by CtypesParser
         restype.visit(self)
         restype.visit(self)
         for argtype in argtypes:
         for argtype in argtypes:
             argtype.visit(self)
             argtype.visit(self)
 
 
-        function = FunctionDescription(name,
-                                       restype,
-                                       argtypes,
-                                       errcheck,
-                                       variadic=variadic,
-                                       src=(filename, repr(lineno)))
+        function = FunctionDescription(
+            name, restype, argtypes, errcheck, variadic, attrib, src=(filename, repr(lineno))
+        )
 
 
         self.functions.append(function)
         self.functions.append(function)
         self.all.append(function)
         self.all.append(function)
-        self.output_order.append(('function', function))
+        self.output_order.append(("function", function))
 
 
     def handle_ctypes_variable(self, name, ctype, filename, lineno):
     def handle_ctypes_variable(self, name, ctype, filename, lineno):
         # Called by CtypesParser
         # Called by CtypesParser
         ctype.visit(self)
         ctype.visit(self)
 
 
-        variable = VariableDescription(name,
-                                       ctype,
-                                       src=(filename, repr(lineno)))
+        variable = VariableDescription(name, ctype, src=(filename, repr(lineno)))
 
 
         self.variables.append(variable)
         self.variables.append(variable)
         self.all.append(variable)
         self.all.append(variable)
-        self.output_order.append(('variable', variable))
+        self.output_order.append(("variable", variable))
 
 
     def handle_struct(self, ctypestruct, filename, lineno):
     def handle_struct(self, ctypestruct, filename, lineno):
         # Called from within DataCollectingParser
         # Called from within DataCollectingParser
@@ -169,18 +160,20 @@ class DataCollectingParser(ctypesparser.CtypesParser,
 
 
         if ctypestruct.opaque:
         if ctypestruct.opaque:
             if name not in self.already_seen_opaque_structs:
             if name not in self.already_seen_opaque_structs:
-                struct = StructDescription(ctypestruct.tag,
-                                           ctypestruct.packed,
-                                           ctypestruct.variety,
-                                           None,  # No members
-                                           True,  # Opaque
-                                           ctypestruct,
-                                           src=(filename, str(lineno)))
+                struct = StructDescription(
+                    ctypestruct.tag,
+                    ctypestruct.attrib,
+                    ctypestruct.variety,
+                    None,  # No members
+                    True,  # Opaque
+                    ctypestruct,
+                    src=(filename, str(lineno)),
+                )
 
 
                 self.already_seen_opaque_structs[name] = struct
                 self.already_seen_opaque_structs[name] = struct
                 self.structs.append(struct)
                 self.structs.append(struct)
                 self.all.append(struct)
                 self.all.append(struct)
-                self.output_order.append(('struct', struct))
+                self.output_order.append(("struct", struct))
 
 
         else:
         else:
             for (membername, ctype) in ctypestruct.members:
             for (membername, ctype) in ctypestruct.members:
@@ -194,22 +187,24 @@ class DataCollectingParser(ctypesparser.CtypesParser,
                 struct.ctype = ctypestruct
                 struct.ctype = ctypestruct
                 struct.src = ctypestruct.src
                 struct.src = ctypestruct.src
 
 
-                self.output_order.append(('struct-body', struct))
+                self.output_order.append(("struct-body", struct))
 
 
                 del self.already_seen_opaque_structs[name]
                 del self.already_seen_opaque_structs[name]
 
 
             else:
             else:
-                struct = StructDescription(ctypestruct.tag,
-                                           ctypestruct.packed,
-                                           ctypestruct.variety,
-                                           ctypestruct.members,
-                                           False,  # Not opaque
-                                           src=(filename, str(lineno)),
-                                           ctype=ctypestruct)
+                struct = StructDescription(
+                    ctypestruct.tag,
+                    ctypestruct.attrib,
+                    ctypestruct.variety,
+                    ctypestruct.members,
+                    False,  # Not opaque
+                    src=(filename, str(lineno)),
+                    ctype=ctypestruct,
+                )
                 self.structs.append(struct)
                 self.structs.append(struct)
                 self.all.append(struct)
                 self.all.append(struct)
-                self.output_order.append(('struct', struct))
-                self.output_order.append(('struct-body', struct))
+                self.output_order.append(("struct", struct))
+                self.output_order.append(("struct-body", struct))
 
 
             self.already_seen_structs.add(name)
             self.already_seen_structs.add(name)
 
 
@@ -225,16 +220,13 @@ class DataCollectingParser(ctypesparser.CtypesParser,
 
 
         if ctypeenum.opaque:
         if ctypeenum.opaque:
             if tag not in self.already_seen_opaque_enums:
             if tag not in self.already_seen_opaque_enums:
-                enum = EnumDescription(ctypeenum.tag,
-                                       None,
-                                       ctypeenum,
-                                       src=(filename, str(lineno)))
+                enum = EnumDescription(ctypeenum.tag, None, ctypeenum, src=(filename, str(lineno)))
                 enum.opaque = True
                 enum.opaque = True
 
 
                 self.already_seen_opaque_enums[tag] = enum
                 self.already_seen_opaque_enums[tag] = enum
                 self.enums.append(enum)
                 self.enums.append(enum)
                 self.all.append(enum)
                 self.all.append(enum)
-                self.output_order.append(('enum', enum))
+                self.output_order.append(("enum", enum))
 
 
         else:
         else:
             if tag in self.already_seen_opaque_enums:
             if tag in self.already_seen_opaque_enums:
@@ -248,31 +240,32 @@ class DataCollectingParser(ctypesparser.CtypesParser,
                 del self.already_seen_opaque_enums[tag]
                 del self.already_seen_opaque_enums[tag]
 
 
             else:
             else:
-                enum = EnumDescription(ctypeenum.tag,
-                                       ctypeenum.enumerators,
-                                       src=(filename, str(lineno)),
-                                       ctype=ctypeenum)
+                enum = EnumDescription(
+                    ctypeenum.tag,
+                    ctypeenum.enumerators,
+                    src=(filename, str(lineno)),
+                    ctype=ctypeenum,
+                )
                 enum.opaque = False
                 enum.opaque = False
 
 
                 self.enums.append(enum)
                 self.enums.append(enum)
                 self.all.append(enum)
                 self.all.append(enum)
-                self.output_order.append(('enum', enum))
+                self.output_order.append(("enum", enum))
 
 
             self.already_seen_enums.add(tag)
             self.already_seen_enums.add(tag)
 
 
             for (enumname, expr) in ctypeenum.enumerators:
             for (enumname, expr) in ctypeenum.enumerators:
-                constant = ConstantDescription(enumname, expr,
-                                               src=(filename, lineno))
+                constant = ConstantDescription(enumname, expr, src=(filename, lineno))
 
 
                 self.constants.append(constant)
                 self.constants.append(constant)
                 self.all.append(constant)
                 self.all.append(constant)
-                self.output_order.append(('constant', constant))
+                self.output_order.append(("constant", constant))
 
 
     def handle_macro(self, name, params, expr, filename, lineno):
     def handle_macro(self, name, params, expr, filename, lineno):
         # Called from within DataCollectingParser
         # Called from within DataCollectingParser
         src = (filename, lineno)
         src = (filename, lineno)
 
 
-        if expr is None:
+        if expr == None:
             expr = ConstantExpressionNode(True)
             expr = ConstantExpressionNode(True)
             constant = ConstantDescription(name, expr, src)
             constant = ConstantDescription(name, expr, src)
             self.constants.append(constant)
             self.constants.append(constant)
@@ -284,24 +277,30 @@ class DataCollectingParser(ctypesparser.CtypesParser,
         if isinstance(expr, CtypesType):
         if isinstance(expr, CtypesType):
             if params:
             if params:
                 macro = MacroDescription(name, "", src)
                 macro = MacroDescription(name, "", src)
-                macro.error("%s has parameters but evaluates to a type. "
-                            "Ctypesgen does not support it." % macro.casual_name(),
-                            cls='macro')
+                macro.error(
+                    "%s has parameters but evaluates to a type. "
+                    "Ctypesgen does not support it." % macro.casual_name(),
+                    cls="macro",
+                )
                 self.macros.append(macro)
                 self.macros.append(macro)
                 self.all.append(macro)
                 self.all.append(macro)
-                self.output_order.append(('macro', macro))
+                self.output_order.append(("macro", macro))
 
 
             else:
             else:
                 typedef = TypedefDescription(name, expr, src)
                 typedef = TypedefDescription(name, expr, src)
                 self.typedefs.append(typedef)
                 self.typedefs.append(typedef)
                 self.all.append(typedef)
                 self.all.append(typedef)
-                self.output_order.append(('typedef', typedef))
+                self.output_order.append(("typedef", typedef))
 
 
+        elif name == "#undef":
+            undef = UndefDescription(expr, src)
+            self.all.append(undef)
+            self.output_order.append(("undef", undef))
         else:
         else:
             macro = MacroDescription(name, params, expr, src)
             macro = MacroDescription(name, params, expr, src)
             self.macros.append(macro)
             self.macros.append(macro)
             self.all.append(macro)
             self.all.append(macro)
-            self.output_order.append(('macro', macro))
+            self.output_order.append(("macro", macro))
 
 
         # Macros could possibly contain things like __FILE__, __LINE__, etc...
         # Macros could possibly contain things like __FILE__, __LINE__, etc...
         # This could be supported, but it would be a lot of work. It would
         # This could be supported, but it would be a lot of work. It would
@@ -309,11 +308,11 @@ class DataCollectingParser(ctypesparser.CtypesParser,
 
 
     def handle_error(self, message, filename, lineno):
     def handle_error(self, message, filename, lineno):
         # Called by CParser
         # Called by CParser
-        error_message("%s:%d: %s" % (filename, lineno, message), cls='cparser')
+        error_message("%s:%d: %s" % (filename, lineno, message), cls="cparser")
 
 
     def handle_pp_error(self, message):
     def handle_pp_error(self, message):
         # Called by PreprocessorParser
         # Called by PreprocessorParser
-        error_message("%s: %s" % (self.options.cpp, message), cls='cparser')
+        error_message("%s: %s" % (self.options.cpp, message), cls="cparser")
 
 
     def handle_status(self, message):
     def handle_status(self, message):
         # Called by CParser
         # Called by CParser
@@ -326,12 +325,14 @@ class DataCollectingParser(ctypesparser.CtypesParser,
         self.handle_enum(enum, enum.src[0], enum.src[1])
         self.handle_enum(enum, enum.src[0], enum.src[1])
 
 
     def data(self):
     def data(self):
-        return DescriptionCollection(self.constants,
-                                     self.typedefs,
-                                     self.structs,
-                                     self.enums,
-                                     self.functions,
-                                     self.variables,
-                                     self.macros,
-                                     self.all,
-                                     self.output_order)
+        return DescriptionCollection(
+            self.constants,
+            self.typedefs,
+            self.structs,
+            self.enums,
+            self.functions,
+            self.variables,
+            self.macros,
+            self.all,
+            self.output_order,
+        )

+ 149 - 176
python/grass/ctypes/ctypesgencore/parser/lex.py

@@ -1,4 +1,4 @@
-#-----------------------------------------------------------------------------
+# -----------------------------------------------------------------------------
 # ply: lex.py
 # ply: lex.py
 #
 #
 # Author: David M. Beazley (dave@dabeaz.com)
 # Author: David M. Beazley (dave@dabeaz.com)
@@ -19,83 +19,30 @@
 #
 #
 # You should have received a copy of the GNU Lesser General Public
 # You should have received a copy of the GNU Lesser General Public
 # License along with this library; if not, write to the Free Software
 # License along with this library; if not, write to the Free Software
-# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
 #
 #
 # See the file LICENSE for a complete copy of the LGPL.
 # See the file LICENSE for a complete copy of the LGPL.
-#-----------------------------------------------------------------------------
-from __future__ import print_function
+# -----------------------------------------------------------------------------
 
 
 __version__ = "2.2"
 __version__ = "2.2"
 
 
-
-try:
-    from builtins import bytes
-    PY3 = True
-except ImportError:
-    # python2
-    bytes = str
-    PY3 = False
-
-
-import operator
-import os.path
-import re
-import sys
-import types
-import collections
-import functools
-
-if PY3:
-    _meth_func = "__func__"
-    _meth_self = "__self__"
-
-    _func_closure = "__closure__"
-    _func_code = "__code__"
-    _func_defaults = "__defaults__"
-    _func_globals = "__globals__"
-else:
-    _meth_func = "im_func"
-    _meth_self = "im_self"
-
-    _func_closure = "func_closure"
-    _func_code = "func_code"
-    _func_defaults = "func_defaults"
-    _func_globals = "func_globals"
-
-# define compatible function to support PY2 & PY3
-get_mth_func = operator.attrgetter(_meth_func)
-get_mth_self = operator.attrgetter(_meth_self)
-get_func_closure = operator.attrgetter(_func_closure)
-get_func_code = operator.attrgetter(_func_code)
-get_func_defaults = operator.attrgetter(_func_defaults)
-get_func_globals = operator.attrgetter(_func_globals)
-
+import re, sys, types, os.path
 
 
 # Regular expression used to match valid token names
 # Regular expression used to match valid token names
-_is_identifier = re.compile(r'^[a-zA-Z0-9_]+$')
-
-# Available instance types.  This is used when lexers are defined by a class.
-# It's a little funky because I want to preserve backwards compatibility
-# with Python 2.0 where types.ObjectType is undefined.
-
-_INSTANCETYPE = getattr(types, 'InstanceType', object)
+_is_identifier = re.compile(r"^[a-zA-Z0-9_]+$")
 
 
+_INSTANCETYPE = object
 
 
 # Exception thrown when invalid token encountered and no default error
 # Exception thrown when invalid token encountered and no default error
 # handler is defined.
 # handler is defined.
-
-
 class LexError(Exception):
 class LexError(Exception):
-
     def __init__(self, message, s):
     def __init__(self, message, s):
         self.args = (message,)
         self.args = (message,)
         self.text = s
         self.text = s
 
 
-# Token class
-
 
 
+# Token class
 class LexToken(object):
 class LexToken(object):
-
     def __str__(self):
     def __str__(self):
         return "LexToken(%s,%r,%d,%d)" % (self.type, self.value, self.lineno, self.lexpos)
         return "LexToken(%s,%r,%d,%d)" % (self.type, self.value, self.lineno, self.lexpos)
 
 
@@ -105,6 +52,7 @@ class LexToken(object):
     def skip(self, n):
     def skip(self, n):
         self.lexer.skip(n)
         self.lexer.skip(n)
 
 
+
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # Lexer class
 # Lexer class
 #
 #
@@ -116,32 +64,31 @@ class LexToken(object):
 
 
 
 
 class Lexer:
 class Lexer:
-
     def __init__(self):
     def __init__(self):
-        self.lexre = None             # Master regular expression. This is a list of
+        self.lexre = None  # Master regular expression. This is a list of
         # tuples (re,findex) where re is a compiled
         # tuples (re,findex) where re is a compiled
         # regular expression and findex is a list
         # regular expression and findex is a list
         # mapping regex group numbers to rules
         # mapping regex group numbers to rules
-        self.lexretext = None         # Current regular expression strings
-        self.lexstatere = {}          # Dictionary mapping lexer states to master regexs
-        self.lexstateretext = {}      # Dictionary mapping lexer states to regex strings
-        self.lexstate = "INITIAL"     # Current lexer state
-        self.lexstatestack = []       # Stack of lexer states
-        self.lexstateinfo = None      # State information
-        self.lexstateignore = {}      # Dictionary of ignored characters for each state
-        self.lexstateerrorf = {}      # Dictionary of error functions for each state
-        self.lexreflags = 0           # Optional re compile flags
-        self.lexdata = None           # Actual input data (as a string)
-        self.lexpos = 0               # Current position in input text
-        self.lexlen = 0               # Length of the input text
-        self.lexerrorf = None         # Error rule (if any)
-        self.lextokens = None         # List of valid tokens
-        self.lexignore = ""           # Ignored characters
-        self.lexliterals = ""         # Literal characters that can be passed through
-        self.lexmodule = None         # Module
-        self.lineno = 1               # Current line number
-        self.lexdebug = 0             # Debugging mode
-        self.lexoptimize = 0          # Optimized mode
+        self.lexretext = None  # Current regular expression strings
+        self.lexstatere = {}  # Dictionary mapping lexer states to master regexs
+        self.lexstateretext = {}  # Dictionary mapping lexer states to regex strings
+        self.lexstate = "INITIAL"  # Current lexer state
+        self.lexstatestack = []  # Stack of lexer states
+        self.lexstateinfo = None  # State information
+        self.lexstateignore = {}  # Dictionary of ignored characters for each state
+        self.lexstateerrorf = {}  # Dictionary of error functions for each state
+        self.lexreflags = 0  # Optional re compile flags
+        self.lexdata = None  # Actual input data (as a string)
+        self.lexpos = 0  # Current position in input text
+        self.lexlen = 0  # Length of the input text
+        self.lexerrorf = None  # Error rule (if any)
+        self.lextokens = None  # List of valid tokens
+        self.lexignore = ""  # Ignored characters
+        self.lexliterals = ""  # Literal characters that can be passed through
+        self.lexmodule = None  # Module
+        self.lineno = 1  # Current line number
+        self.lexdebug = 0  # Debugging mode
+        self.lexoptimize = 0  # Optimized mode
 
 
     def clone(self, object=None):
     def clone(self, object=None):
         c = Lexer()
         c = Lexer()
@@ -194,11 +141,12 @@ class Lexer:
     # writetab() - Write lexer information to a table file
     # writetab() - Write lexer information to a table file
     # ------------------------------------------------------------
     # ------------------------------------------------------------
     # <tm> 25 June 2008 added 'outputdir'
     # <tm> 25 June 2008 added 'outputdir'
-    def writetab(self, tabfile, outputdir=''):
+    def writetab(self, tabfile, outputdir=""):
         tf = open(os.path.join(outputdir, tabfile) + ".py", "w")
         tf = open(os.path.join(outputdir, tabfile) + ".py", "w")
         tf.write(
         tf.write(
-            "# %s.py. This file automatically created by PLY (version %s). Don't edit!\n" %
-            (tabfile, __version__))
+            "# %s.py. This file automatically created by PLY (version %s). Don't edit!\n"
+            % (tabfile, __version__)
+        )
         tf.write("_lextokens    = %s\n" % repr(self.lextokens))
         tf.write("_lextokens    = %s\n" % repr(self.lextokens))
         tf.write("_lexreflags   = %s\n" % repr(self.lexreflags))
         tf.write("_lexreflags   = %s\n" % repr(self.lexreflags))
         tf.write("_lexliterals  = %s\n" % repr(self.lexliterals))
         tf.write("_lexliterals  = %s\n" % repr(self.lexliterals))
@@ -240,16 +188,15 @@ class Lexer:
             txtitem = []
             txtitem = []
             for i in range(len(lre)):
             for i in range(len(lre)):
                 titem.append(
                 titem.append(
-                    (re.compile(
-                        lre[i][0], lextab._lexreflags), _names_to_funcs(
-                        lre[i][1], fdict)))
+                    (re.compile(lre[i][0], lextab._lexreflags), _names_to_funcs(lre[i][1], fdict))
+                )
                 txtitem.append(lre[i][0])
                 txtitem.append(lre[i][0])
             self.lexstatere[key] = titem
             self.lexstatere[key] = titem
             self.lexstateretext[key] = txtitem
             self.lexstateretext[key] = txtitem
         self.lexstateerrorf = {}
         self.lexstateerrorf = {}
         for key, ef in lextab._lexstateerrorf.items():
         for key, ef in lextab._lexstateerrorf.items():
             self.lexstateerrorf[key] = fdict[ef]
             self.lexstateerrorf[key] = fdict[ef]
-        self.begin('INITIAL')
+        self.begin("INITIAL")
 
 
     # ------------------------------------------------------------
     # ------------------------------------------------------------
     # input() - Push a new string into the lexer
     # input() - Push a new string into the lexer
@@ -313,8 +260,7 @@ class Lexer:
         lexdata = self.lexdata
         lexdata = self.lexdata
 
 
         while lexpos < lexlen:
         while lexpos < lexlen:
-            # This code provides some short-circuit code for whitespace, tabs, and
-            # other ignored characters
+            # This code provides some short-circuit code for whitespace, tabs, and other ignored characters
             if lexdata[lexpos] in lexignore:
             if lexdata[lexpos] in lexignore:
                 lexpos += 1
                 lexpos += 1
                 continue
                 continue
@@ -348,7 +294,7 @@ class Lexer:
                     break
                     break
 
 
                 # if func not callable, it means it's an ignored token
                 # if func not callable, it means it's an ignored token
-                if not isinstance(func, collections.abc.Callable):
+                if not hasattr(func, "__call__"):
                     break
                     break
 
 
                 # If token is processed by a function, call it
                 # If token is processed by a function, call it
@@ -356,7 +302,7 @@ class Lexer:
 
 
                 # Every function must return a token, if nothing, we just move to next token
                 # Every function must return a token, if nothing, we just move to next token
                 if not newtok:
                 if not newtok:
-                    lexpos = self.lexpos        # This is here in case user has updated lexpos.
+                    lexpos = self.lexpos  # This is here in case user has updated lexpos.
 
 
                     # Added for pyglet/tools/wrapper/cparser.py by Alex
                     # Added for pyglet/tools/wrapper/cparser.py by Alex
                     # Holkner on 20/Jan/2007
                     # Holkner on 20/Jan/2007
@@ -369,9 +315,16 @@ class Lexer:
                     # pyglet/tools/wrapper/cparser.py by Alex Holkner on
                     # pyglet/tools/wrapper/cparser.py by Alex Holkner on
                     # 20/Jan/2007
                     # 20/Jan/2007
                     if newtok.type not in self.lextokens and len(newtok.type) > 1:
                     if newtok.type not in self.lextokens and len(newtok.type) > 1:
-                        raise LexError("%s:%d: Rule '%s' returned an unknown token type '%s'" % (
-                            get_func_code(func).co_filename, get_func_code(func).co_firstlineno,
-                            func.__name__, newtok.type), lexdata[lexpos:])
+                        raise LexError(
+                            "%s:%d: Rule '%s' returned an unknown token type '%s'"
+                            % (
+                                func.__code__.co_filename,
+                                func.__code__.co_firstlineno,
+                                func.__name__,
+                                newtok.type,
+                            ),
+                            lexdata[lexpos:],
+                        )
 
 
                 return newtok
                 return newtok
             else:
             else:
@@ -399,9 +352,9 @@ class Lexer:
                     if lexpos == self.lexpos:
                     if lexpos == self.lexpos:
                         # Error method didn't change text position at all. This is an error.
                         # Error method didn't change text position at all. This is an error.
                         raise LexError(
                         raise LexError(
-                            "Scanning error. Illegal character '%s'" %
-                            (lexdata[lexpos]), lexdata[
-                                lexpos:])
+                            "Scanning error. Illegal character '%s'" % (lexdata[lexpos]),
+                            lexdata[lexpos:],
+                        )
                     lexpos = self.lexpos
                     lexpos = self.lexpos
                     if not newtok:
                     if not newtok:
                         continue
                         continue
@@ -409,15 +362,16 @@ class Lexer:
 
 
                 self.lexpos = lexpos
                 self.lexpos = lexpos
                 raise LexError(
                 raise LexError(
-                    "Illegal character '%s' at index %d" %
-                    (lexdata[lexpos], lexpos), lexdata[
-                        lexpos:])
+                    "Illegal character '%s' at index %d" % (lexdata[lexpos], lexpos),
+                    lexdata[lexpos:],
+                )
 
 
         self.lexpos = lexpos + 1
         self.lexpos = lexpos + 1
         if self.lexdata is None:
         if self.lexdata is None:
             raise RuntimeError("No input string given with input()")
             raise RuntimeError("No input string given with input()")
         return None
         return None
 
 
+
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # _validate_file()
 # _validate_file()
 #
 #
@@ -429,19 +383,20 @@ class Lexer:
 
 
 def _validate_file(filename):
 def _validate_file(filename):
     import os.path
     import os.path
+
     base, ext = os.path.splitext(filename)
     base, ext = os.path.splitext(filename)
-    if ext != '.py':
-        return 1        # No idea what the file is. Return OK
+    if ext != ".py":
+        return 1  # No idea what the file is. Return OK
 
 
     try:
     try:
         f = open(filename)
         f = open(filename)
         lines = f.readlines()
         lines = f.readlines()
         f.close()
         f.close()
     except IOError:
     except IOError:
-        return 1                       # Oh well
+        return 1  # Oh well
 
 
-    fre = re.compile(r'\s*def\s+(t_[a-zA-Z_0-9]*)\(')
-    sre = re.compile(r'\s*(t_[a-zA-Z_0-9]*)\s*=')
+    fre = re.compile(r"\s*def\s+(t_[a-zA-Z_0-9]*)\(")
+    sre = re.compile(r"\s*(t_[a-zA-Z_0-9]*)\s*=")
     counthash = {}
     counthash = {}
     linen = 1
     linen = 1
     noerror = 1
     noerror = 1
@@ -455,11 +410,15 @@ def _validate_file(filename):
             if not prev:
             if not prev:
                 counthash[name] = linen
                 counthash[name] = linen
             else:
             else:
-                print("%s:%d: Rule %s redefined. Previously defined on line %d" % (filename, linen, name, prev))
+                print(
+                    "%s:%d: Rule %s redefined. Previously defined on line %d"
+                    % (filename, linen, name, prev)
+                )
                 noerror = 0
                 noerror = 0
         linen += 1
         linen += 1
     return noerror
     return noerror
 
 
+
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # _funcs_to_names()
 # _funcs_to_names()
 #
 #
@@ -477,6 +436,7 @@ def _funcs_to_names(funclist):
             result.append(f)
             result.append(f)
     return result
     return result
 
 
+
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # _names_to_funcs()
 # _names_to_funcs()
 #
 #
@@ -494,6 +454,7 @@ def _names_to_funcs(namelist, fdict):
             result.append(n)
             result.append(n)
     return result
     return result
 
 
+
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # _form_master_re()
 # _form_master_re()
 #
 #
@@ -534,6 +495,7 @@ def _form_master_re(relist, reflags, ldict):
         rlist, rre = _form_master_re(relist[m:], reflags, ldict)
         rlist, rre = _form_master_re(relist[m:], reflags, ldict)
         return llist + rlist, lre + rre
         return llist + rlist, lre + rre
 
 
+
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # def _statetoken(s,names)
 # def _statetoken(s,names)
 #
 #
@@ -548,19 +510,20 @@ def _statetoken(s, names):
     nonstate = 1
     nonstate = 1
     parts = s.split("_")
     parts = s.split("_")
     for i in range(1, len(parts)):
     for i in range(1, len(parts)):
-        if parts[i] not in names and parts[i] != 'ANY':
+        if parts[i] not in names and parts[i] != "ANY":
             break
             break
     if i > 1:
     if i > 1:
         states = tuple(parts[1:i])
         states = tuple(parts[1:i])
     else:
     else:
-        states = ('INITIAL',)
+        states = ("INITIAL",)
 
 
-    if 'ANY' in states:
+    if "ANY" in states:
         states = tuple(names.keys())
         states = tuple(names.keys())
 
 
     tokenname = "_".join(parts[i:])
     tokenname = "_".join(parts[i:])
     return (states, tokenname)
     return (states, tokenname)
 
 
+
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # lex(module)
 # lex(module)
 #
 #
@@ -568,13 +531,20 @@ def _statetoken(s, names):
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # cls added for pyglet/tools/wrapper/cparser.py by Alex Holkner on 22/Jan/2007
 # cls added for pyglet/tools/wrapper/cparser.py by Alex Holkner on 22/Jan/2007
 # <tm> 25 June 2008 added 'outputdir'
 # <tm> 25 June 2008 added 'outputdir'
-
-
-def lex(module=None, object=None, debug=0, optimize=0,
-        lextab="lextab", reflags=0, nowarn=0, outputdir='', cls=Lexer):
+def lex(
+    module=None,
+    object=None,
+    debug=0,
+    optimize=0,
+    lextab="lextab",
+    reflags=0,
+    nowarn=0,
+    outputdir="",
+    cls=Lexer,
+):
     global lexer
     global lexer
     ldict = None
     ldict = None
-    stateinfo = {'INITIAL': 'inclusive'}
+    stateinfo = {"INITIAL": "inclusive"}
     error = 0
     error = 0
     files = {}
     files = {}
     lexobj = cls()
     lexobj = cls()
@@ -610,8 +580,8 @@ def lex(module=None, object=None, debug=0, optimize=0,
         except RuntimeError:
         except RuntimeError:
             e, b, t = sys.exc_info()
             e, b, t = sys.exc_info()
             f = t.tb_frame
             f = t.tb_frame
-            f = f.f_back           # Walk out to our calling function
-            ldict = f.f_globals    # Grab its globals dictionary
+            f = f.f_back  # Walk out to our calling function
+            ldict = f.f_globals  # Grab its globals dictionary
 
 
     if optimize and lextab:
     if optimize and lextab:
         try:
         try:
@@ -625,7 +595,7 @@ def lex(module=None, object=None, debug=0, optimize=0,
             pass
             pass
 
 
     # Get the tokens, states, and literals variables (if any)
     # Get the tokens, states, and literals variables (if any)
-    if (module and isinstance(module, _INSTANCETYPE)):
+    if module and isinstance(module, _INSTANCETYPE):
         tokens = getattr(module, "tokens", None)
         tokens = getattr(module, "tokens", None)
         states = getattr(module, "states", None)
         states = getattr(module, "states", None)
         literals = getattr(module, "literals", "")
         literals = getattr(module, "literals", "")
@@ -658,8 +628,7 @@ def lex(module=None, object=None, debug=0, optimize=0,
 
 
     try:
     try:
         for c in literals:
         for c in literals:
-            if not (isinstance(c, bytes) or isinstance(
-                    c, str)) or len(c) > 1:
+            if not (isinstance(c, bytes) or isinstance(c, str)) or len(c) > 1:
                 print("lex: Invalid literal %s. Must be a single character" % repr(c))
                 print("lex: Invalid literal %s. Must be a single character" % repr(c))
                 error = 1
                 error = 1
                 continue
                 continue
@@ -678,7 +647,10 @@ def lex(module=None, object=None, debug=0, optimize=0,
         else:
         else:
             for s in states:
             for s in states:
                 if not isinstance(s, tuple) or len(s) != 2:
                 if not isinstance(s, tuple) or len(s) != 2:
-                    print("lex: invalid state specifier %s. Must be a tuple (statename,'exclusive|inclusive')" % repr(s))
+                    print(
+                        "lex: invalid state specifier %s. Must be a tuple (statename,'exclusive|inclusive')"
+                        % repr(s)
+                    )
                     error = 1
                     error = 1
                     continue
                     continue
                 name, statetype = s
                 name, statetype = s
@@ -686,7 +658,7 @@ def lex(module=None, object=None, debug=0, optimize=0,
                     print("lex: state name %s must be a string" % repr(name))
                     print("lex: state name %s must be a string" % repr(name))
                     error = 1
                     error = 1
                     continue
                     continue
-                if not (statetype == 'inclusive' or statetype == 'exclusive'):
+                if not (statetype == "inclusive" or statetype == "exclusive"):
                     print("lex: state type for state %s must be 'inclusive' or 'exclusive'" % name)
                     print("lex: state type for state %s must be 'inclusive' or 'exclusive'" % name)
                     error = 1
                     error = 1
                     continue
                     continue
@@ -697,20 +669,20 @@ def lex(module=None, object=None, debug=0, optimize=0,
                 stateinfo[name] = statetype
                 stateinfo[name] = statetype
 
 
     # Get a list of symbols with the t_ or s_ prefix
     # Get a list of symbols with the t_ or s_ prefix
-    tsymbols = [f for f in ldict.keys() if f[:2] == 't_']
+    tsymbols = [f for f in ldict.keys() if f[:2] == "t_"]
 
 
     # Now build up a list of functions and a list of strings
     # Now build up a list of functions and a list of strings
 
 
-    funcsym = {}        # Symbols defined as functions
-    strsym = {}        # Symbols defined as strings
-    toknames = {}        # Mapping of symbols to token names
+    funcsym = {}  # Symbols defined as functions
+    strsym = {}  # Symbols defined as strings
+    toknames = {}  # Mapping of symbols to token names
 
 
     for s in stateinfo.keys():
     for s in stateinfo.keys():
         funcsym[s] = []
         funcsym[s] = []
         strsym[s] = []
         strsym[s] = []
 
 
-    ignore = {}        # Ignore strings by state
-    errorf = {}        # Error functions by state
+    ignore = {}  # Ignore strings by state
+    errorf = {}  # Error functions by state
 
 
     if len(tsymbols) == 0:
     if len(tsymbols) == 0:
         raise SyntaxError("lex: no rules of the form t_rulename are defined.")
         raise SyntaxError("lex: no rules of the form t_rulename are defined.")
@@ -720,10 +692,10 @@ def lex(module=None, object=None, debug=0, optimize=0,
         states, tokname = _statetoken(f, stateinfo)
         states, tokname = _statetoken(f, stateinfo)
         toknames[f] = tokname
         toknames[f] = tokname
 
 
-        if isinstance(t, collections.abc.Callable):
+        if hasattr(t, "__call__"):
             for s in states:
             for s in states:
                 funcsym[s].append((f, t))
                 funcsym[s].append((f, t))
-        elif (isinstance(t, bytes) or isinstance(t, str)):
+        elif isinstance(t, bytes) or isinstance(t, str):
             for s in states:
             for s in states:
                 strsym[s].append((f, t))
                 strsym[s].append((f, t))
         else:
         else:
@@ -732,21 +704,11 @@ def lex(module=None, object=None, debug=0, optimize=0,
 
 
     # Sort the functions by line number
     # Sort the functions by line number
     for f in funcsym.values():
     for f in funcsym.values():
-        if os.sys.version_info.major >= 3:
-            f.sort(key=lambda x: get_func_code(x[1]).co_firstlineno)
-        else:
-            f.sort(key=lambda x, y: cmp(get_func_code(x[1]).co_firstlineno,
-                                        get_func_code(y[1]).co_firstlineno))
+        f.sort(key=lambda x: x[1].__code__.co_firstlineno)
 
 
     # Sort the strings by regular expression length
     # Sort the strings by regular expression length
     for s in strsym.values():
     for s in strsym.values():
-        if os.sys.version_info.major >= 3:
-            s.sort(key=functools.cmp_to_key(lambda x, y:
-                                            (len(x[1]) < len(y[1])) -
-                                            (len(x[1]) > len(y[1]))))
-        else:
-            s.sort(key=lambda x, y: (len(x[1]) < len(y[1])) -
-                                    (len(x[1]) > len(y[1])))
+        s.sort(key=lambda x: len(x[1]))
 
 
     regexs = {}
     regexs = {}
 
 
@@ -756,38 +718,37 @@ def lex(module=None, object=None, debug=0, optimize=0,
 
 
         # Add rules defined by functions first
         # Add rules defined by functions first
         for fname, f in funcsym[state]:
         for fname, f in funcsym[state]:
-            line = get_func_code(f).co_firstlineno
-            file_ = get_func_code(f).co_filename
-            files[file_] = None
+            line = f.__code__.co_firstlineno
+            file = f.__code__.co_filename
+            files[file] = None
             tokname = toknames[fname]
             tokname = toknames[fname]
 
 
             ismethod = isinstance(f, types.MethodType)
             ismethod = isinstance(f, types.MethodType)
 
 
             if not optimize:
             if not optimize:
-                nargs = get_func_code(f).co_argcount
+                nargs = f.__code__.co_argcount
                 if ismethod:
                 if ismethod:
                     reqargs = 2
                     reqargs = 2
                 else:
                 else:
                     reqargs = 1
                     reqargs = 1
                 if nargs > reqargs:
                 if nargs > reqargs:
-                    print("%s:%d: Rule '%s' has too many arguments."
-                          % (file_, line, f.__name__))
+                    print("%s:%d: Rule '%s' has too many arguments." % (file, line, f.__name__))
                     error = 1
                     error = 1
                     continue
                     continue
 
 
                 if nargs < reqargs:
                 if nargs < reqargs:
-                    print("%s:%d: Rule '%s' requires an argument."
-                          % (file_, line, f.__name__))
+                    print("%s:%d: Rule '%s' requires an argument." % (file, line, f.__name__))
                     error = 1
                     error = 1
                     continue
                     continue
 
 
-                if tokname == 'ignore':
-                    print("%s:%d: Rule '%s' must be defined as a string."
-                          % (file_, line, f.__name__))
+                if tokname == "ignore":
+                    print(
+                        "%s:%d: Rule '%s' must be defined as a string." % (file, line, f.__name__)
+                    )
                     error = 1
                     error = 1
                     continue
                     continue
 
 
-            if tokname == 'error':
+            if tokname == "error":
                 errorf[state] = f
                 errorf[state] = f
                 continue
                 continue
 
 
@@ -796,42 +757,50 @@ def lex(module=None, object=None, debug=0, optimize=0,
                     try:
                     try:
                         c = re.compile("(?P<%s>%s)" % (f.__name__, f.__doc__), re.VERBOSE | reflags)
                         c = re.compile("(?P<%s>%s)" % (f.__name__, f.__doc__), re.VERBOSE | reflags)
                         if c.match(""):
                         if c.match(""):
-                            print("%s:%d: Regular expression for rule '%s' "
-                                  "matches empty string."
-                                  % (file_, line, f.__name__))
+                            print(
+                                "%s:%d: Regular expression for rule '%s' matches empty string."
+                                % (file, line, f.__name__)
+                            )
                             error = 1
                             error = 1
                             continue
                             continue
                     except re.error as e:
                     except re.error as e:
-                        print("%s:%d: Invalid regular expression for rule '%s'. %s"
-                              % (file_, line, f.__name__, e))
-                        if '#' in f.__doc__:
-                            print("%s:%d. Make sure '#' in rule '%s' is escaped with '\\#'."
-                                  % (file_, line, f.__name__))
+                        print(
+                            "%s:%d: Invalid regular expression for rule '%s'. %s"
+                            % (file, line, f.__name__, e)
+                        )
+                        if "#" in f.__doc__:
+                            print(
+                                "%s:%d. Make sure '#' in rule '%s' is escaped with '\\#'."
+                                % (file, line, f.__name__)
+                            )
                         error = 1
                         error = 1
                         continue
                         continue
 
 
                     if debug:
                     if debug:
-                        print("lex: Adding rule %s -> '%s' (state '%s')"
-                              % (f.__name__, f.__doc__, state))
+                        print(
+                            "lex: Adding rule %s -> '%s' (state '%s')"
+                            % (f.__name__, f.__doc__, state)
+                        )
 
 
                 # Okay. The regular expression seemed okay.  Let's append it to the master regular
                 # Okay. The regular expression seemed okay.  Let's append it to the master regular
                 # expression we're building
                 # expression we're building
 
 
                 regex_list.append("(?P<%s>%s)" % (f.__name__, f.__doc__))
                 regex_list.append("(?P<%s>%s)" % (f.__name__, f.__doc__))
             else:
             else:
-                print("%s:%d: No regular expression defined for rule '%s'"
-                      % (file_, line, f.__name__))
+                print(
+                    "%s:%d: No regular expression defined for rule '%s'" % (file, line, f.__name__)
+                )
 
 
         # Now add all of the simple rules
         # Now add all of the simple rules
         for name, r in strsym[state]:
         for name, r in strsym[state]:
             tokname = toknames[name]
             tokname = toknames[name]
 
 
-            if tokname == 'ignore':
+            if tokname == "ignore":
                 ignore[state] = r
                 ignore[state] = r
                 continue
                 continue
 
 
             if not optimize:
             if not optimize:
-                if tokname == 'error':
+                if tokname == "error":
                     raise SyntaxError("lex: Rule '%s' must be defined as a function" % name)
                     raise SyntaxError("lex: Rule '%s' must be defined as a function" % name)
                     error = 1
                     error = 1
                     continue
                     continue
@@ -842,13 +811,13 @@ def lex(module=None, object=None, debug=0, optimize=0,
                     continue
                     continue
                 try:
                 try:
                     c = re.compile("(?P<%s>%s)" % (name, r), re.VERBOSE | reflags)
                     c = re.compile("(?P<%s>%s)" % (name, r), re.VERBOSE | reflags)
-                    if (c.match("")):
+                    if c.match(""):
                         print("lex: Regular expression for rule '%s' matches empty string." % name)
                         print("lex: Regular expression for rule '%s' matches empty string." % name)
                         error = 1
                         error = 1
                         continue
                         continue
                 except re.error as e:
                 except re.error as e:
                     print("lex: Invalid regular expression for rule '%s'. %s" % (name, e))
                     print("lex: Invalid regular expression for rule '%s'. %s" % (name, e))
-                    if '#' in r:
+                    if "#" in r:
                         print("lex: Make sure '#' in rule '%s' is escaped with '\\#'." % name)
                         print("lex: Make sure '#' in rule '%s' is escaped with '\\#'." % name)
 
 
                     error = 1
                     error = 1
@@ -887,9 +856,9 @@ def lex(module=None, object=None, debug=0, optimize=0,
 
 
     # For inclusive states, we need to add the INITIAL state
     # For inclusive states, we need to add the INITIAL state
     for state, type in stateinfo.items():
     for state, type in stateinfo.items():
-        if state != "INITIAL" and type == 'inclusive':
-            lexobj.lexstatere[state].extend(lexobj.lexstatere['INITIAL'])
-            lexobj.lexstateretext[state].extend(lexobj.lexstateretext['INITIAL'])
+        if state != "INITIAL" and type == "inclusive":
+            lexobj.lexstatere[state].extend(lexobj.lexstatere["INITIAL"])
+            lexobj.lexstateretext[state].extend(lexobj.lexstateretext["INITIAL"])
 
 
     lexobj.lexstateinfo = stateinfo
     lexobj.lexstateinfo = stateinfo
     lexobj.lexre = lexobj.lexstatere["INITIAL"]
     lexobj.lexre = lexobj.lexstatere["INITIAL"]
@@ -907,12 +876,12 @@ def lex(module=None, object=None, debug=0, optimize=0,
 
 
     # Check state information for ignore and error rules
     # Check state information for ignore and error rules
     for s, stype in stateinfo.items():
     for s, stype in stateinfo.items():
-        if stype == 'exclusive':
+        if stype == "exclusive":
             if warn and s not in errorf:
             if warn and s not in errorf:
                 print("lex: Warning. no error rule is defined for exclusive state '%s'" % s)
                 print("lex: Warning. no error rule is defined for exclusive state '%s'" % s)
             if warn and s not in ignore and lexobj.lexignore:
             if warn and s not in ignore and lexobj.lexignore:
                 print("lex: Warning. no ignore rule is defined for exclusive state '%s'" % s)
                 print("lex: Warning. no ignore rule is defined for exclusive state '%s'" % s)
-        elif stype == 'inclusive':
+        elif stype == "inclusive":
             if s not in errorf:
             if s not in errorf:
                 errorf[s] = errorf.get("INITIAL", None)
                 errorf[s] = errorf.get("INITIAL", None)
             if s not in ignore:
             if s not in ignore:
@@ -929,6 +898,7 @@ def lex(module=None, object=None, debug=0, optimize=0,
 
 
     return lexobj
     return lexobj
 
 
+
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 # runmain()
 # runmain()
 #
 #
@@ -971,11 +941,14 @@ def runmain(lexer=None, data=None):
 # when its docstring might need to be set in an alternative way
 # when its docstring might need to be set in an alternative way
 # -----------------------------------------------------------------------------
 # -----------------------------------------------------------------------------
 
 
+
 def TOKEN(r):
 def TOKEN(r):
     def set_doc(f):
     def set_doc(f):
         f.__doc__ = r
         f.__doc__ = r
         return f
         return f
+
     return set_doc
     return set_doc
 
 
+
 # Alternative spelling of the TOKEN decorator
 # Alternative spelling of the TOKEN decorator
 Token = TOKEN
 Token = TOKEN

A diferenza do arquivo foi suprimida porque é demasiado grande
+ 8 - 0
python/grass/ctypes/ctypesgen/parser/lextab.py


A diferenza do arquivo foi suprimida porque é demasiado grande
+ 307 - 0
python/grass/ctypes/ctypesgen/parser/parsetab.py


+ 402 - 0
python/grass/ctypes/ctypesgen/parser/pplexer.py

@@ -0,0 +1,402 @@
+#!/usr/bin/env python
+
+"""Preprocess a C source file using gcc and convert the result into
+   a token stream
+
+Reference is C99:
+  * http://www.open-std.org/JTC1/SC22/WG14/www/docs/n1124.pdf
+
+"""
+
+__docformat__ = "restructuredtext"
+
+import os, re, shlex, sys, tokenize, traceback
+import ctypes
+from .lex import TOKEN
+
+tokens = (
+    "HEADER_NAME",
+    "IDENTIFIER",
+    "PP_NUMBER",
+    "CHARACTER_CONSTANT",
+    "STRING_LITERAL",
+    "OTHER",
+    "PTR_OP",
+    "INC_OP",
+    "DEC_OP",
+    "LEFT_OP",
+    "RIGHT_OP",
+    "LE_OP",
+    "GE_OP",
+    "EQ_OP",
+    "NE_OP",
+    "AND_OP",
+    "OR_OP",
+    "MUL_ASSIGN",
+    "DIV_ASSIGN",
+    "MOD_ASSIGN",
+    "ADD_ASSIGN",
+    "SUB_ASSIGN",
+    "LEFT_ASSIGN",
+    "RIGHT_ASSIGN",
+    "AND_ASSIGN",
+    "XOR_ASSIGN",
+    "OR_ASSIGN",
+    "PERIOD",
+    "ELLIPSIS",
+    "LPAREN",
+    "NEWLINE",
+    "PP_DEFINE",
+    "PP_DEFINE_NAME",
+    "PP_DEFINE_MACRO_NAME",
+    "PP_UNDEFINE",
+    "PP_MACRO_PARAM",
+    "PP_STRINGIFY",
+    "PP_IDENTIFIER_PASTE",
+    "PP_END_DEFINE",
+    "PRAGMA",
+    "PRAGMA_PACK",
+    "PRAGMA_END",
+)
+
+states = [("DEFINE", "exclusive"), ("PRAGMA", "exclusive")]
+
+subs = {
+    "D": "[0-9]",
+    "L": "[a-zA-Z_]",
+    "H": "[a-fA-F0-9]",
+    "E": "[Ee][+-]?\s*{D}+",
+    # new float suffixes supported in gcc 7
+    "FS": "([FflL]|D[FDL]|[fF]\d+x?)",
+    "IS": "[uUlL]*",
+}
+# Helper: substitute {foo} with subs[foo] in string (makes regexes more lexy)
+sub_pattern = re.compile("{([^}]*)}")
+
+
+def sub_repl_match(m):
+    return subs[m.groups()[0]]
+
+
+def sub(s):
+    return sub_pattern.sub(sub_repl_match, s)
+
+
+# --------------------------------------------------------------------------
+# Token value types
+# --------------------------------------------------------------------------
+
+# Numbers represented as int and float types.
+# For all other tokens, type is just str representation.
+
+
+class StringLiteral(str):
+    def __new__(cls, value):
+        assert value[0] == '"' and value[-1] == '"'
+        # Unescaping probably not perfect but close enough.
+        value = value[1:-1]  # .decode('string_escape')
+        return str.__new__(cls, value)
+
+
+# --------------------------------------------------------------------------
+# Token declarations
+# --------------------------------------------------------------------------
+
+punctuators = {
+    # value: (regex, type)
+    r"...": (r"\.\.\.", "ELLIPSIS"),
+    r">>=": (r">>=", "RIGHT_ASSIGN"),
+    r"<<=": (r"<<=", "LEFT_ASSIGN"),
+    r"+=": (r"\+=", "ADD_ASSIGN"),
+    r"-=": (r"-=", "SUB_ASSIGN"),
+    r"*=": (r"\*=", "MUL_ASSIGN"),
+    r"/=": (r"/=", "DIV_ASSIGN"),
+    r"%=": (r"%=", "MOD_ASSIGN"),
+    r"&=": (r"&=", "AND_ASSIGN"),
+    r"^=": (r"\^=", "XOR_ASSIGN"),
+    r"|=": (r"\|=", "OR_ASSIGN"),
+    r">>": (r">>", "RIGHT_OP"),
+    r"<<": (r"<<", "LEFT_OP"),
+    r"++": (r"\+\+", "INC_OP"),
+    r"--": (r"--", "DEC_OP"),
+    r"->": (r"->", "PTR_OP"),
+    r"&&": (r"&&", "AND_OP"),
+    r"||": (r"\|\|", "OR_OP"),
+    r"<=": (r"<=", "LE_OP"),
+    r">=": (r">=", "GE_OP"),
+    r"==": (r"==", "EQ_OP"),
+    r"!=": (r"!=", "NE_OP"),
+    r"<:": (r"<:", "["),
+    r":>": (r":>", "]"),
+    r"<%": (r"<%", "{"),
+    r"%>": (r"%>", "}"),
+    r";": (r";", ";"),
+    r"{": (r"{", "{"),
+    r"}": (r"}", "}"),
+    r",": (r",", ","),
+    r":": (r":", ":"),
+    r"=": (r"=", "="),
+    r")": (r"\)", ")"),
+    r"[": (r"\[", "["),
+    r"]": (r"]", "]"),
+    r".": (r"\.", "PERIOD"),
+    r"&": (r"&", "&"),
+    r"!": (r"!", "!"),
+    r"~": (r"~", "~"),
+    r"-": (r"-", "-"),
+    r"+": (r"\+", "+"),
+    r"*": (r"\*", "*"),
+    r"/": (r"/", "/"),
+    r"%": (r"%", "%"),
+    r"<": (r"<", "<"),
+    r">": (r">", ">"),
+    r"^": (r"\^", "^"),
+    r"|": (r"\|", "|"),
+    r"?": (r"\?", "?"),
+}
+
+
+def punctuator_regex(punctuators):
+    punctuator_regexes = [v[0] for v in punctuators.values()]
+    punctuator_regexes.sort(key=len, reverse=True)
+    return "(%s)" % "|".join(punctuator_regexes)
+
+
+# Process line-number directives from the preprocessor
+# See http://docs.freebsd.org/info/cpp/cpp.info.Output.html
+DIRECTIVE = r'\#\s+(\d+)\s+"([^"]+)"[ \d]*\n'
+
+
+@TOKEN(DIRECTIVE)
+def t_ANY_directive(t):
+    t.lexer.filename = t.groups[2]
+    t.lexer.lineno = int(t.groups[1])
+    return None
+
+
+@TOKEN(punctuator_regex(punctuators))
+def t_ANY_punctuator(t):
+    t.type = punctuators[t.value][1]
+    return t
+
+
+IDENTIFIER = sub("{L}({L}|{D})*")
+
+
+@TOKEN(IDENTIFIER)
+def t_INITIAL_identifier(t):
+    t.type = "IDENTIFIER"
+    return t
+
+
+@TOKEN(IDENTIFIER)
+def t_DEFINE_identifier(t):
+    if t.lexer.next_is_define_name:
+        # This identifier is the name of a macro
+        # We need to look ahead and see if this macro takes parameters or not.
+        if (
+            t.lexpos + len(t.value) < t.lexer.lexlen
+            and t.lexer.lexdata[t.lexpos + len(t.value)] == "("
+        ):
+
+            t.type = "PP_DEFINE_MACRO_NAME"
+
+            # Look ahead and read macro parameter list
+            lexdata = t.lexer.lexdata
+            pos = t.lexpos + len(t.value) + 1
+            while lexdata[pos] not in "\n)":
+                pos += 1
+            params = lexdata[t.lexpos + len(t.value) + 1 : pos]
+            paramlist = [x.strip() for x in params.split(",") if x.strip()]
+            t.lexer.macro_params = paramlist
+
+        else:
+            t.type = "PP_DEFINE_NAME"
+
+        t.lexer.next_is_define_name = False
+    elif t.value in t.lexer.macro_params:
+        t.type = "PP_MACRO_PARAM"
+    else:
+        t.type = "IDENTIFIER"
+    return t
+
+
+FLOAT_LITERAL = sub(
+    r"(?P<p1>{D}+)?(?P<dp>[.]?)(?P<p2>(?(p1){D}*|{D}+))"
+    r"(?P<exp>(?:[Ee][+-]?{D}+)?)(?P<suf>{FS}?)(?!\w)"
+)
+
+
+@TOKEN(FLOAT_LITERAL)
+def t_ANY_float(t):
+    t.type = "PP_NUMBER"
+    m = t.lexer.lexmatch
+
+    p1 = m.group("p1")
+    dp = m.group("dp")
+    p2 = m.group("p2")
+    exp = m.group("exp")
+    suf = m.group("suf")
+
+    if dp or exp or (suf and re.match(subs["FS"] + "$", suf)):
+        s = m.group(0)
+        if suf:
+            s = s[: -len(suf)]
+        # Attach a prefix so the parser can figure out if should become an
+        # integer, float, or long
+        t.value = "f" + s
+    elif suf and suf in ("Ll"):
+        t.value = "l" + p1
+    else:
+        t.value = "i" + p1
+
+    return t
+
+
+INT_LITERAL = sub(r"(?P<p1>(?:0x{H}+)|(?:{D}+))(?P<suf>{IS})")
+
+
+@TOKEN(INT_LITERAL)
+def t_ANY_int(t):
+    t.type = "PP_NUMBER"
+    m = t.lexer.lexmatch
+
+    if "L" in m.group(3) or "l" in m.group(2):
+        prefix = "l"
+    else:
+        prefix = "i"
+
+    g1 = m.group(2)
+    if g1.startswith("0x"):
+        # Convert base from hexadecimal
+        g1 = str(int(g1[2:], 16))
+    elif g1[0] == "0":
+        # Convert base from octal
+        g1 = str(int(g1, 8))
+
+    t.value = prefix + g1
+
+    return t
+
+
+CHARACTER_CONSTANT = sub(r"L?'(\\.|[^\\'])+'")
+
+
+@TOKEN(CHARACTER_CONSTANT)
+def t_ANY_character_constant(t):
+    t.type = "CHARACTER_CONSTANT"
+    return t
+
+
+STRING_LITERAL = sub(r'L?"(\\.|[^\\"])*"')
+
+
+@TOKEN(STRING_LITERAL)
+def t_ANY_string_literal(t):
+    t.type = "STRING_LITERAL"
+    t.value = StringLiteral(t.value)
+    return t
+
+
+@TOKEN(r"\(")
+def t_ANY_lparen(t):
+    if t.lexpos == 0 or t.lexer.lexdata[t.lexpos - 1] not in (" \t\f\v\n"):
+        t.type = "LPAREN"
+    else:
+        t.type = "("
+    return t
+
+
+@TOKEN(r"\n")
+def t_INITIAL_newline(t):
+    t.lexer.lineno += 1
+    return None
+
+
+@TOKEN(r"\#undef")
+def t_INITIAL_pp_undefine(t):
+    t.type = "PP_UNDEFINE"
+    t.lexer.begin("DEFINE")
+    t.lexer.next_is_define_name = True
+    t.lexer.macro_params = set()
+    return t
+
+
+@TOKEN(r"\#define")
+def t_INITIAL_pp_define(t):
+    t.type = "PP_DEFINE"
+    t.lexer.begin("DEFINE")
+    t.lexer.next_is_define_name = True
+    t.lexer.macro_params = set()
+    return t
+
+
+@TOKEN(r"\#pragma")
+def t_INITIAL_pragma(t):
+    t.type = "PRAGMA"
+    t.lexer.begin("PRAGMA")
+    return t
+
+
+@TOKEN(r"pack")
+def t_PRAGMA_pack(t):
+    t.type = "PRAGMA_PACK"
+    return t
+
+
+@TOKEN(r"\n")
+def t_PRAGMA_newline(t):
+    t.type = "PRAGMA_END"
+    t.lexer.begin("INITIAL")
+    t.lexer.lineno += 1
+    return t
+
+
+@TOKEN(IDENTIFIER)
+def t_PRAGMA_identifier(t):
+    t.type = "IDENTIFIER"
+    return t
+
+
+def t_PRAGMA_error(t):
+    t.type = "OTHER"
+    t.value = t.value[0:30]
+    t.lexer.lexpos += 1  # Skip it if it's an error in a #pragma
+    return t
+
+
+@TOKEN(r"\n")
+def t_DEFINE_newline(t):
+    t.type = "PP_END_DEFINE"
+    t.lexer.begin("INITIAL")
+    t.lexer.lineno += 1
+    del t.lexer.macro_params
+
+    # Damage control in case the token immediately after the #define failed
+    # to handle this
+    t.lexer.next_is_define_name = False
+    return t
+
+
+@TOKEN(r"(\#\#)|(\#)")
+def t_DEFINE_pp_param_op(t):
+    if t.value == "#":
+        t.type = "PP_STRINGIFY"
+    else:
+        t.type = "PP_IDENTIFIER_PASTE"
+    return t
+
+
+def t_INITIAL_error(t):
+    t.type = "OTHER"
+    return t
+
+
+def t_DEFINE_error(t):
+    t.type = "OTHER"
+    t.value = t.value[0]
+    t.lexer.lexpos += 1  # Skip it if it's an error in a #define
+    return t
+
+
+t_ANY_ignore = " \t\v\f\r"

+ 91 - 84
python/grass/ctypes/ctypesgencore/parser/preprocessor.py

@@ -1,29 +1,20 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
-'''Preprocess a C source file using gcc and convert the result into
+"""Preprocess a C source file using gcc and convert the result into
    a token stream
    a token stream
 
 
 Reference is C99:
 Reference is C99:
   * http://www.open-std.org/JTC1/SC22/WG14/www/docs/n1124.pdf
   * http://www.open-std.org/JTC1/SC22/WG14/www/docs/n1124.pdf
 
 
-'''
+"""
 
 
-__docformat__ = 'restructuredtext'
-
-import os
-import re
-import shlex
-import subprocess
-import sys
-import tokenize
-import traceback
+__docformat__ = "restructuredtext"
 
 
+import os, re, shlex, sys, tokenize, traceback, subprocess
 import ctypes
 import ctypes
-from . import lex
+from . import lex, yacc
+from .lex import TOKEN, LexError
 from . import pplexer
 from . import pplexer
-from . import yacc
-from .lex import TOKEN
-
 
 
 # --------------------------------------------------------------------------
 # --------------------------------------------------------------------------
 # Lexers
 # Lexers
@@ -31,10 +22,9 @@ from .lex import TOKEN
 
 
 
 
 class PreprocessorLexer(lex.Lexer):
 class PreprocessorLexer(lex.Lexer):
-
     def __init__(self):
     def __init__(self):
         lex.Lexer.__init__(self)
         lex.Lexer.__init__(self)
-        self.filename = '<input>'
+        self.filename = "<input>"
         self.in_define = False
         self.in_define = False
 
 
     def input(self, data, filename=None):
     def input(self, data, filename=None):
@@ -46,8 +36,7 @@ class PreprocessorLexer(lex.Lexer):
         lex.Lexer.input(self, data)
         lex.Lexer.input(self, data)
 
 
     def push_input(self, data, filename):
     def push_input(self, data, filename):
-        self.input_stack.append(
-            (self.lexdata, self.lexpos, self.filename, self.lineno))
+        self.input_stack.append((self.lexdata, self.lexpos, self.filename, self.lineno))
         self.lexdata = data
         self.lexdata = data
         self.lexpos = 0
         self.lexpos = 0
         self.lineno = 1
         self.lineno = 1
@@ -55,8 +44,7 @@ class PreprocessorLexer(lex.Lexer):
         self.lexlen = len(self.lexdata)
         self.lexlen = len(self.lexdata)
 
 
     def pop_input(self):
     def pop_input(self):
-        self.lexdata, self.lexpos, self.filename, self.lineno = \
-            self.input_stack.pop()
+        self.lexdata, self.lexpos, self.filename, self.lineno = self.input_stack.pop()
         self.lexlen = len(self.lexdata)
         self.lexlen = len(self.lexdata)
 
 
     def token(self):
     def token(self):
@@ -75,7 +63,6 @@ class PreprocessorLexer(lex.Lexer):
 
 
 
 
 class TokenListLexer(object):
 class TokenListLexer(object):
-
     def __init__(self, tokens):
     def __init__(self, tokens):
         self.tokens = tokens
         self.tokens = tokens
         self.pos = 0
         self.pos = 0
@@ -95,12 +82,12 @@ def symbol_to_token(sym):
     elif isinstance(sym, lex.LexToken):
     elif isinstance(sym, lex.LexToken):
         return sym
         return sym
     else:
     else:
-        assert False, 'Not a symbol: %r' % sym
+        assert False, "Not a symbol: %r" % sym
 
 
 
 
 def create_token(type, value, production=None):
 def create_token(type, value, production=None):
-    '''Create a token of type and value, at the position where 'production'
-    was reduced.  Don`t specify production if the token is built-in'''
+    """Create a token of type and value, at the position where 'production'
+    was reduced.  Don't specify production if the token is built-in"""
     t = lex.LexToken()
     t = lex.LexToken()
     t.type = type
     t.type = type
     t.value = value
     t.value = value
@@ -110,35 +97,42 @@ def create_token(type, value, production=None):
         t.filename = production.slice[1].filename
         t.filename = production.slice[1].filename
     else:
     else:
         t.lineno = -1
         t.lineno = -1
-        t.filename = '<builtin>'
+        t.filename = "<builtin>"
     return t
     return t
 
 
+
 # --------------------------------------------------------------------------
 # --------------------------------------------------------------------------
 # Grammars
 # Grammars
 # --------------------------------------------------------------------------
 # --------------------------------------------------------------------------
 
 
 
 
 class PreprocessorParser(object):
 class PreprocessorParser(object):
-
     def __init__(self, options, cparser):
     def __init__(self, options, cparser):
-        self.defines = ["inline=", "__inline__=", "__extension__=",
-                        "_Bool=uint8_t", "__const=const", "__asm__(x)=",
-                        "__asm(x)=", "CTYPESGEN=1"]
+        self.defines = [
+            "inline=",
+            "__inline__=",
+            "__extension__=",
+            "__const=const",
+            "__asm__(x)=",
+            "__asm(x)=",
+            "CTYPESGEN=1",
+        ]
 
 
         # On OSX, explicitly add these defines to keep from getting syntax
         # On OSX, explicitly add these defines to keep from getting syntax
         # errors in the OSX standard headers.
         # errors in the OSX standard headers.
-        if hasattr(os, 'uname') and os.uname()[0] == 'Darwin':
-            self.defines += ["__uint16_t=uint16_t",
-                             "__uint32_t=uint32_t",
-                             "__uint64_t=uint64_t"]
+        if sys.platform == "darwin":
+            self.defines += ["__uint16_t=uint16_t", "__uint32_t=uint32_t", "__uint64_t=uint64_t"]
 
 
         self.matches = []
         self.matches = []
         self.output = []
         self.output = []
-        self.lexer = lex.lex(cls=PreprocessorLexer,
-                             optimize=1,
-                             lextab='lextab',
-                             outputdir=os.path.dirname(__file__),
-                             module=pplexer)
+        optimize = options.optimize_lexer if hasattr(options, "optimize_lexer") else False
+        self.lexer = lex.lex(
+            cls=PreprocessorLexer,
+            optimize=optimize,
+            lextab="lextab",
+            outputdir=os.path.dirname(__file__),
+            module=pplexer,
+        )
 
 
         self.options = options
         self.options = options
         self.cparser = cparser  # An instance of CParser
         self.cparser = cparser  # An instance of CParser
@@ -149,43 +143,50 @@ class PreprocessorParser(object):
         cmd = self.options.cpp
         cmd = self.options.cpp
         cmd += " -U __GNUC__ -dD"
         cmd += " -U __GNUC__ -dD"
 
 
+        for undefine in self.options.cpp_undefines:
+            cmd += " -U%s" % undefine
+
         # This fixes Issue #6 where OS X 10.6+ adds a C extension that breaks
         # This fixes Issue #6 where OS X 10.6+ adds a C extension that breaks
         # the parser.  Blocks shouldn't be needed for ctypesgen support anyway.
         # the parser.  Blocks shouldn't be needed for ctypesgen support anyway.
-        if sys.platform == 'darwin':
+        if sys.platform == "darwin":
             cmd += " -U __BLOCKS__"
             cmd += " -U __BLOCKS__"
 
 
         for path in self.options.include_search_paths:
         for path in self.options.include_search_paths:
-            cmd += " -I%s" % path
-        for define in self.defines:
+            cmd += ' -I"%s"' % path
+        for define in self.defines + self.options.cpp_defines:
             cmd += ' "-D%s"' % define
             cmd += ' "-D%s"' % define
         cmd += ' "' + filename + '"'
         cmd += ' "' + filename + '"'
 
 
         self.cparser.handle_status(cmd)
         self.cparser.handle_status(cmd)
 
 
-        if sys.platform == 'win32':
-            cmd = ['sh.exe', '-c', cmd]
+        if sys.platform == "win32":
+            cmd = ["sh.exe", "-c", cmd]
 
 
-        pp = subprocess.Popen(cmd,
-                              shell=True,
-                              universal_newlines=True,
-                              stdout=subprocess.PIPE,
-                              stderr=subprocess.PIPE)
+        pp = subprocess.Popen(
+            cmd,
+            shell=True,
+            universal_newlines=True,
+            stdout=subprocess.PIPE,
+            stderr=subprocess.PIPE,
+        )
         try:
         try:
             ppout, pperr = pp.communicate()
             ppout, pperr = pp.communicate()
         except UnicodeError:
         except UnicodeError:
             # Fix for https://trac.osgeo.org/grass/ticket/3883,
             # Fix for https://trac.osgeo.org/grass/ticket/3883,
             # handling file(s) encoded with mac_roman
             # handling file(s) encoded with mac_roman
-            if sys.platform == 'darwin':
-                pp = subprocess.Popen(cmd,
-                                      shell=True,
-                                      universal_newlines=False,  # read as binary
-                                      stdout=subprocess.PIPE,
-                                      stderr=subprocess.PIPE)
+            if sys.platform == "darwin":
+                pp = subprocess.Popen(
+                    cmd,
+                    shell=True,
+                    universal_newlines=False,  # read as binary
+                    stdout=subprocess.PIPE,
+                    stderr=subprocess.PIPE,
+                )
                 ppout, pperr = pp.communicate()
                 ppout, pperr = pp.communicate()
 
 
-                data = ppout.decode('utf8', errors='replace')
-                ppout = data.replace('\r\n', '\n').replace('\r', '\n')
-                pperr = pperr.decode('utf8', errors='replace')
+                data = ppout.decode("utf8", errors="replace")
+                ppout = data.replace("\r\n", "\n").replace("\r", "\n")
+                pperr = pperr.decode("utf8", errors="replace")
             else:
             else:
                 raise UnicodeError
                 raise UnicodeError
 
 
@@ -193,51 +194,57 @@ class PreprocessorParser(object):
             if line:
             if line:
                 self.cparser.handle_pp_error(line)
                 self.cparser.handle_pp_error(line)
 
 
-        # We separate lines that are #defines and lines that are source code
+        # We separate lines to two groups: directives and c-source.  Note that
+        # #pragma directives actually belong to the source category for this.
+        # This is necessary because some source files intermix preprocessor
+        # directives with source--this is not tolerated by ctypesgen's single
+        # grammar.
         # We put all the source lines first, then all the #define lines.
         # We put all the source lines first, then all the #define lines.
 
 
         source_lines = []
         source_lines = []
         define_lines = []
         define_lines = []
 
 
+        first_token_reg = re.compile(r"^#\s*([^ ]+)($|\s)")
+
         for line in ppout.split("\n"):
         for line in ppout.split("\n"):
-            line = line.rstrip('\r')
-            line = line + "\n"
-            if line.startswith("# "):
+            line += "\n"
+            search = first_token_reg.match(line)
+            hash_token = search.group(1) if search else None
+
+            if (not hash_token) or hash_token == "pragma":
+                source_lines.append(line)
+                define_lines.append("\n")
+
+            elif hash_token.isdigit():
                 # Line number information has to go with both groups
                 # Line number information has to go with both groups
                 source_lines.append(line)
                 source_lines.append(line)
                 define_lines.append(line)
                 define_lines.append(line)
 
 
-            elif line.startswith("#define"):
+            else:  # hash_token in ("define", "undef"):
                 source_lines.append("\n")
                 source_lines.append("\n")
                 define_lines.append(line)
                 define_lines.append(line)
 
 
-            elif line.startswith("#"):
-                # It's a directive, but not a #define. Remove it
-                source_lines.append("\n")
-                define_lines.append("\n")
-
-            else:
-                source_lines.append(line)
-                define_lines.append("\n")
-
         text = "".join(source_lines + define_lines)
         text = "".join(source_lines + define_lines)
 
 
         if self.options.save_preprocessed_headers:
         if self.options.save_preprocessed_headers:
-            self.cparser.handle_status("Saving preprocessed headers to %s." %
-                                       self.options.save_preprocessed_headers)
+            self.cparser.handle_status(
+                "Saving preprocessed headers to %s." % self.options.save_preprocessed_headers
+            )
             try:
             try:
-                f = open(self.options.save_preprocessed_headers, "w")
-                f.write(text)
-                f.close()
+                with open(self.options.save_preprocessed_headers, "w") as f:
+                    f.write(text)
             except IOError:
             except IOError:
                 self.cparser.handle_error("Couldn't save headers.")
                 self.cparser.handle_error("Couldn't save headers.")
 
 
         self.lexer.input(text)
         self.lexer.input(text)
         self.output = []
         self.output = []
 
 
-        while True:
-            token = self.lexer.token()
-            if token is not None:
-                self.output.append(token)
-            else:
-                break
+        try:
+            while True:
+                token = self.lexer.token()
+                if token is not None:
+                    self.output.append(token)
+                else:
+                    break
+        except LexError as e:
+            self.cparser.handle_error("{}; {}".format(e, e.text.partition("\n")[0]), filename, 0)

A diferenza do arquivo foi suprimida porque é demasiado grande
+ 318 - 275
python/grass/ctypes/ctypesgencore/parser/yacc.py


+ 1 - 1
python/grass/ctypes/ctypesgencore/printer/__init__.py

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
 This module is the backend to ctypesgen; it contains classes to
 This module is the backend to ctypesgen; it contains classes to

+ 150 - 0
python/grass/ctypes/ctypesgen/printer_json/printer.py

@@ -0,0 +1,150 @@
+#!/usr/bin/env python
+
+import os, sys, time, json
+from ctypesgen.descriptions import *
+from ctypesgen.ctypedescs import *
+from ctypesgen.messages import *
+
+import ctypesgen.libraryloader  # So we can get the path to it
+from . import test  # So we can find the path to local files in the printer package
+
+
+def path_to_local_file(name, known_local_module=test):
+    basedir = os.path.dirname(known_local_module.__file__)
+    return os.path.join(basedir, name)
+
+
+# From http://stackoverflow.com/questions/1036409/recursively-convert-python-object-graph-to-dictionary
+def todict(obj, classkey="Klass"):
+    if isinstance(obj, dict):
+        for k in obj.keys():
+            obj[k] = todict(obj[k], classkey)
+        return obj
+    elif isinstance(obj, str) or isinstance(obj, bytes):
+        # must handle strings before __iter__ test, since they now have __iter__
+        # in Python3
+        return obj
+    elif hasattr(obj, "__iter__"):
+        return [todict(v, classkey) for v in obj]
+    elif hasattr(obj, "__dict__"):
+        data = dict(
+            [
+                (key, todict(value, classkey))
+                for key, value in obj.__dict__.items()
+                if not callable(value) and not key.startswith("_")
+            ]
+        )
+        if classkey is not None and hasattr(obj, "__class__"):
+            data[classkey] = obj.__class__.__name__
+        return data
+    else:
+        return obj
+
+
+class WrapperPrinter:
+    def __init__(self, outpath, options, data):
+        status_message("Writing to %s." % (outpath or "stdout"))
+
+        self.file = open(outpath, "w") if outpath else sys.stdout
+        self.options = options
+
+        if self.options.strip_build_path and self.options.strip_build_path[-1] != os.path.sep:
+            self.options.strip_build_path += os.path.sep
+
+        self.print_group(self.options.libraries, "libraries", self.print_library)
+
+        method_table = {
+            "function": self.print_function,
+            "macro": self.print_macro,
+            "struct": self.print_struct,
+            "struct-body": self.print_struct_members,
+            "typedef": self.print_typedef,
+            "variable": self.print_variable,
+            "enum": self.print_enum,
+            "constant": self.print_constant,
+            "undef": self.print_undef,
+        }
+
+        res = []
+        for kind, desc in data.output_order:
+            if desc.included:
+                item = method_table[kind](desc)
+                if item:
+                    res.append(item)
+        self.file.write(json.dumps(res, sort_keys=True, indent=4))
+        self.file.write("\n")
+
+    def __del__(self):
+        self.file.close()
+
+    def print_group(self, list, name, function):
+        if list:
+            return [function(obj) for obj in list]
+
+    def print_library(self, library):
+        return {"load_library": library}
+
+    def print_constant(self, constant):
+        return {"type": "constant", "name": constant.name, "value": constant.value.py_string(False)}
+
+    def print_undef(self, undef):
+        return {"type": "undef", "value": undef.macro.py_string(False)}
+
+    def print_typedef(self, typedef):
+        return {"type": "typedef", "name": typedef.name, "ctype": todict(typedef.ctype)}
+
+    def print_struct(self, struct):
+        res = {"type": struct.variety, "name": struct.tag, "attrib": struct.attrib}
+        if not struct.opaque:
+            res["fields"] = []
+            for name, ctype in struct.members:
+                field = {"name": name, "ctype": todict(ctype)}
+                if isinstance(ctype, CtypesBitfield):
+                    field["bitfield"] = ctype.bitfield.py_string(False)
+                res["fields"].append(field)
+        return res
+
+    def print_struct_members(self, struct):
+        pass
+
+    def print_enum(self, enum):
+        res = {"type": "enum", "name": enum.tag}
+
+        if not enum.opaque:
+            res["fields"] = []
+            for name, ctype in enum.members:
+                field = {"name": name, "ctype": todict(ctype)}
+                res["fields"].append(field)
+        return res
+
+    def print_function(self, function):
+        res = {
+            "type": "function",
+            "name": function.c_name(),
+            "variadic": function.variadic,
+            "args": todict(function.argtypes),
+            "return": todict(function.restype),
+            "attrib": function.attrib,
+        }
+        if function.source_library:
+            res["source"] = function.source_library
+        return res
+
+    def print_variable(self, variable):
+        res = {"type": "variable", "ctype": todict(variable.ctype), "name": variable.c_name()}
+        if variable.source_library:
+            res["source"] = variable.source_library
+        return res
+
+    def print_macro(self, macro):
+        if macro.params:
+            return {
+                "type": "macro_function",
+                "name": macro.name,
+                "args": macro.params,
+                "body": macro.expr.py_string(True),
+            }
+        else:
+            # The macro translator makes heroic efforts but it occasionally fails.
+            # Beware the contents of the value!
+            return {"type": "macro", "name": macro.name, "value": macro.expr.py_string(True)}

+ 6 - 0
python/grass/ctypes/ctypesgen/printer_json/test.py

@@ -0,0 +1,6 @@
+"""
+ctypesgen.printer.printer imports this module so that it can find the path
+to defaulttemplate.py and defaultloader.py.
+"""
+
+pass

+ 10 - 0
python/grass/ctypes/ctypesgen/printer_python/__init__.py

@@ -0,0 +1,10 @@
+#!/usr/bin/env python
+
+"""
+This module is the backend to ctypesgen; it contains classes to
+produce the final .py output files.
+"""
+
+from .printer import WrapperPrinter
+
+__all__ = ["WrapperPrinter"]

+ 9 - 0
python/grass/ctypes/ctypesgen/printer_python/defaultheader.py

@@ -0,0 +1,9 @@
+r"""Wrapper for %(name)s
+
+Generated with:
+%(argv)s
+
+Do not modify this file.
+"""
+
+__docformat__ = "restructuredtext"

+ 98 - 77
python/grass/ctypes/ctypesgencore/printer/preamble.py

@@ -1,16 +1,8 @@
-import ctypes
-import os
-import sys
-import six
+import ctypes, os, sys
 from ctypes import *
 from ctypes import *
-from grass.script.utils import encode
-
-if sys.version_info.major >= 3:
-    long = int
-    unicode = str
 
 
 _int_types = (c_int16, c_int32)
 _int_types = (c_int16, c_int32)
-if hasattr(ctypes, 'c_int64'):
+if hasattr(ctypes, "c_int64"):
     # Some builds of ctypes apparently do not have c_int64
     # Some builds of ctypes apparently do not have c_int64
     # defined; it's a pretty good bet that these builds do not
     # defined; it's a pretty good bet that these builds do not
     # have 64-bit pointers.
     # have 64-bit pointers.
@@ -26,7 +18,7 @@ class c_void(Structure):
     # c_void_p is a buggy return type, converting to int, so
     # c_void_p is a buggy return type, converting to int, so
     # POINTER(None) == c_void_p is actually written as
     # POINTER(None) == c_void_p is actually written as
     # POINTER(c_void), so it can be treated as a real pointer.
     # POINTER(c_void), so it can be treated as a real pointer.
-    _fields_ = [('dummy', c_int)]
+    _fields_ = [("dummy", c_int)]
 
 
 
 
 def POINTER(obj):
 def POINTER(obj):
@@ -35,11 +27,13 @@ def POINTER(obj):
     # Convert None to a real NULL pointer to work around bugs
     # Convert None to a real NULL pointer to work around bugs
     # in how ctypes handles None on 64-bit platforms
     # in how ctypes handles None on 64-bit platforms
     if not isinstance(p.from_param, classmethod):
     if not isinstance(p.from_param, classmethod):
+
         def from_param(cls, x):
         def from_param(cls, x):
             if x is None:
             if x is None:
                 return cls()
                 return cls()
             else:
             else:
                 return x
                 return x
+
         p.from_param = classmethod(from_param)
         p.from_param = classmethod(from_param)
 
 
     return p
     return p
@@ -47,26 +41,33 @@ def POINTER(obj):
 
 
 class UserString:
 class UserString:
     def __init__(self, seq):
     def __init__(self, seq):
-        if isinstance(seq, str):
+        if isinstance(seq, basestring):
             self.data = seq
             self.data = seq
         elif isinstance(seq, UserString):
         elif isinstance(seq, UserString):
             self.data = seq.data[:]
             self.data = seq.data[:]
         else:
         else:
             self.data = str(seq)
             self.data = str(seq)
 
 
-    def __str__(self): return str(self.data)
+    def __str__(self):
+        return str(self.data)
 
 
-    def __repr__(self): return repr(self.data)
+    def __repr__(self):
+        return repr(self.data)
 
 
-    def __int__(self): return int(self.data)
+    def __int__(self):
+        return int(self.data)
 
 
-    def __long__(self): return long(self.data)
+    def __long__(self):
+        return long(self.data)
 
 
-    def __float__(self): return float(self.data)
+    def __float__(self):
+        return float(self.data)
 
 
-    def __complex__(self): return complex(self.data)
+    def __complex__(self):
+        return complex(self.data)
 
 
-    def __hash__(self): return hash(self.data)
+    def __hash__(self):
+        return hash(self.data)
 
 
     def __cmp__(self, string):
     def __cmp__(self, string):
         if isinstance(string, UserString):
         if isinstance(string, UserString):
@@ -77,9 +78,11 @@ class UserString:
     def __contains__(self, char):
     def __contains__(self, char):
         return char in self.data
         return char in self.data
 
 
-    def __len__(self): return len(self.data)
+    def __len__(self):
+        return len(self.data)
 
 
-    def __getitem__(self, index): return self.__class__(self.data[index])
+    def __getitem__(self, index):
+        return self.__class__(self.data[index])
 
 
     def __getslice__(self, start, end):
     def __getslice__(self, start, end):
         start = max(start, 0)
         start = max(start, 0)
@@ -89,31 +92,33 @@ class UserString:
     def __add__(self, other):
     def __add__(self, other):
         if isinstance(other, UserString):
         if isinstance(other, UserString):
             return self.__class__(self.data + other.data)
             return self.__class__(self.data + other.data)
-        elif isinstance(other, str):
+        elif isinstance(other, basestring):
             return self.__class__(self.data + other)
             return self.__class__(self.data + other)
         else:
         else:
             return self.__class__(self.data + str(other))
             return self.__class__(self.data + str(other))
 
 
     def __radd__(self, other):
     def __radd__(self, other):
-        if isinstance(other, str):
+        if isinstance(other, basestring):
             return self.__class__(other + self.data)
             return self.__class__(other + self.data)
         else:
         else:
             return self.__class__(str(other) + self.data)
             return self.__class__(str(other) + self.data)
 
 
     def __mul__(self, n):
     def __mul__(self, n):
         return self.__class__(self.data * n)
         return self.__class__(self.data * n)
+
     __rmul__ = __mul__
     __rmul__ = __mul__
 
 
     def __mod__(self, args):
     def __mod__(self, args):
         return self.__class__(self.data % args)
         return self.__class__(self.data % args)
 
 
     # the following methods are defined in alphabetical order:
     # the following methods are defined in alphabetical order:
-    def capitalize(self): return self.__class__(self.data.capitalize())
+    def capitalize(self):
+        return self.__class__(self.data.capitalize())
 
 
     def center(self, width, *args):
     def center(self, width, *args):
         return self.__class__(self.data.center(width, *args))
         return self.__class__(self.data.center(width, *args))
 
 
-    def count(self, sub, start=0, end=sys.maxsize):
+    def count(self, sub, start=0, end=sys.maxint):
         return self.data.count(sub, start, end)
         return self.data.count(sub, start, end)
 
 
     def decode(self, encoding=None, errors=None):  # XXX improve this?
     def decode(self, encoding=None, errors=None):  # XXX improve this?
@@ -134,44 +139,56 @@ class UserString:
         else:
         else:
             return self.__class__(self.data.encode())
             return self.__class__(self.data.encode())
 
 
-    def endswith(self, suffix, start=0, end=sys.maxsize):
+    def endswith(self, suffix, start=0, end=sys.maxint):
         return self.data.endswith(suffix, start, end)
         return self.data.endswith(suffix, start, end)
 
 
     def expandtabs(self, tabsize=8):
     def expandtabs(self, tabsize=8):
         return self.__class__(self.data.expandtabs(tabsize))
         return self.__class__(self.data.expandtabs(tabsize))
 
 
-    def find(self, sub, start=0, end=sys.maxsize):
+    def find(self, sub, start=0, end=sys.maxint):
         return self.data.find(sub, start, end)
         return self.data.find(sub, start, end)
 
 
-    def index(self, sub, start=0, end=sys.maxsize):
+    def index(self, sub, start=0, end=sys.maxint):
         return self.data.index(sub, start, end)
         return self.data.index(sub, start, end)
 
 
-    def isalpha(self): return self.data.isalpha()
+    def isalpha(self):
+        return self.data.isalpha()
 
 
-    def isalnum(self): return self.data.isalnum()
+    def isalnum(self):
+        return self.data.isalnum()
 
 
-    def isdecimal(self): return self.data.isdecimal()
+    def isdecimal(self):
+        return self.data.isdecimal()
 
 
-    def isdigit(self): return self.data.isdigit()
+    def isdigit(self):
+        return self.data.isdigit()
 
 
-    def islower(self): return self.data.islower()
+    def islower(self):
+        return self.data.islower()
 
 
-    def isnumeric(self): return self.data.isnumeric()
+    def isnumeric(self):
+        return self.data.isnumeric()
 
 
-    def isspace(self): return self.data.isspace()
+    def isspace(self):
+        return self.data.isspace()
 
 
-    def istitle(self): return self.data.istitle()
+    def istitle(self):
+        return self.data.istitle()
 
 
-    def isupper(self): return self.data.isupper()
+    def isupper(self):
+        return self.data.isupper()
 
 
-    def join(self, seq): return self.data.join(seq)
+    def join(self, seq):
+        return self.data.join(seq)
 
 
     def ljust(self, width, *args):
     def ljust(self, width, *args):
         return self.__class__(self.data.ljust(width, *args))
         return self.__class__(self.data.ljust(width, *args))
 
 
-    def lower(self): return self.__class__(self.data.lower())
+    def lower(self):
+        return self.__class__(self.data.lower())
 
 
-    def lstrip(self, chars=None): return self.__class__(self.data.lstrip(chars))
+    def lstrip(self, chars=None):
+        return self.__class__(self.data.lstrip(chars))
 
 
     def partition(self, sep):
     def partition(self, sep):
         return self.data.partition(sep)
         return self.data.partition(sep)
@@ -179,10 +196,10 @@ class UserString:
     def replace(self, old, new, maxsplit=-1):
     def replace(self, old, new, maxsplit=-1):
         return self.__class__(self.data.replace(old, new, maxsplit))
         return self.__class__(self.data.replace(old, new, maxsplit))
 
 
-    def rfind(self, sub, start=0, end=sys.maxsize):
+    def rfind(self, sub, start=0, end=sys.maxint):
         return self.data.rfind(sub, start, end)
         return self.data.rfind(sub, start, end)
 
 
-    def rindex(self, sub, start=0, end=sys.maxsize):
+    def rindex(self, sub, start=0, end=sys.maxint):
         return self.data.rindex(sub, start, end)
         return self.data.rindex(sub, start, end)
 
 
     def rjust(self, width, *args):
     def rjust(self, width, *args):
@@ -191,7 +208,8 @@ class UserString:
     def rpartition(self, sep):
     def rpartition(self, sep):
         return self.data.rpartition(sep)
         return self.data.rpartition(sep)
 
 
-    def rstrip(self, chars=None): return self.__class__(self.data.rstrip(chars))
+    def rstrip(self, chars=None):
+        return self.__class__(self.data.rstrip(chars))
 
 
     def split(self, sep=None, maxsplit=-1):
     def split(self, sep=None, maxsplit=-1):
         return self.data.split(sep, maxsplit)
         return self.data.split(sep, maxsplit)
@@ -199,23 +217,29 @@ class UserString:
     def rsplit(self, sep=None, maxsplit=-1):
     def rsplit(self, sep=None, maxsplit=-1):
         return self.data.rsplit(sep, maxsplit)
         return self.data.rsplit(sep, maxsplit)
 
 
-    def splitlines(self, keepends=0): return self.data.splitlines(keepends)
+    def splitlines(self, keepends=0):
+        return self.data.splitlines(keepends)
 
 
-    def startswith(self, prefix, start=0, end=sys.maxsize):
+    def startswith(self, prefix, start=0, end=sys.maxint):
         return self.data.startswith(prefix, start, end)
         return self.data.startswith(prefix, start, end)
 
 
-    def strip(self, chars=None): return self.__class__(self.data.strip(chars))
+    def strip(self, chars=None):
+        return self.__class__(self.data.strip(chars))
 
 
-    def swapcase(self): return self.__class__(self.data.swapcase())
+    def swapcase(self):
+        return self.__class__(self.data.swapcase())
 
 
-    def title(self): return self.__class__(self.data.title())
+    def title(self):
+        return self.__class__(self.data.title())
 
 
     def translate(self, *args):
     def translate(self, *args):
         return self.__class__(self.data.translate(*args))
         return self.__class__(self.data.translate(*args))
 
 
-    def upper(self): return self.__class__(self.data.upper())
+    def upper(self):
+        return self.__class__(self.data.upper())
 
 
-    def zfill(self, width): return self.__class__(self.data.zfill(width))
+    def zfill(self, width):
+        return self.__class__(self.data.zfill(width))
 
 
 
 
 class MutableString(UserString):
 class MutableString(UserString):
@@ -245,21 +269,21 @@ class MutableString(UserString):
             index += len(self.data)
             index += len(self.data)
         if index < 0 or index >= len(self.data):
         if index < 0 or index >= len(self.data):
             raise IndexError
             raise IndexError
-        self.data = self.data[:index] + sub + self.data[index + 1:]
+        self.data = self.data[:index] + sub + self.data[index + 1 :]
 
 
     def __delitem__(self, index):
     def __delitem__(self, index):
         if index < 0:
         if index < 0:
             index += len(self.data)
             index += len(self.data)
         if index < 0 or index >= len(self.data):
         if index < 0 or index >= len(self.data):
             raise IndexError
             raise IndexError
-        self.data = self.data[:index] + self.data[index + 1:]
+        self.data = self.data[:index] + self.data[index + 1 :]
 
 
     def __setslice__(self, start, end, sub):
     def __setslice__(self, start, end, sub):
         start = max(start, 0)
         start = max(start, 0)
         end = max(end, 0)
         end = max(end, 0)
         if isinstance(sub, UserString):
         if isinstance(sub, UserString):
             self.data = self.data[:start] + sub.data + self.data[end:]
             self.data = self.data[:start] + sub.data + self.data[end:]
-        elif isinstance(sub, str):
+        elif isinstance(sub, basestring):
             self.data = self.data[:start] + sub + self.data[end:]
             self.data = self.data[:start] + sub + self.data[end:]
         else:
         else:
             self.data = self.data[:start] + str(sub) + self.data[end:]
             self.data = self.data[:start] + str(sub) + self.data[end:]
@@ -275,7 +299,7 @@ class MutableString(UserString):
     def __iadd__(self, other):
     def __iadd__(self, other):
         if isinstance(other, UserString):
         if isinstance(other, UserString):
             self.data += other.data
             self.data += other.data
-        elif isinstance(other, str):
+        elif isinstance(other, basestring):
             self.data += other
             self.data += other
         else:
         else:
             self.data += str(other)
             self.data += str(other)
@@ -288,12 +312,11 @@ class MutableString(UserString):
 
 
 class String(MutableString, Union):
 class String(MutableString, Union):
 
 
-    _fields_ = [('raw', POINTER(c_char)),
-                ('data', c_char_p)]
+    _fields_ = [("raw", POINTER(c_char)), ("data", c_char_p)]
 
 
     def __init__(self, obj=""):
     def __init__(self, obj=""):
-        if isinstance(obj, (str, unicode, bytes, UserString)):
-            self.data = encode(obj)
+        if isinstance(obj, (str, unicode, UserString)):
+            self.data = str(obj)
         else:
         else:
             self.raw = obj
             self.raw = obj
 
 
@@ -310,11 +333,7 @@ class String(MutableString, Union):
             return obj
             return obj
 
 
         # Convert from str
         # Convert from str
-        elif isinstance(obj, bytes):
-            return cls(obj)
-
-        # Convert from str/unicode
-        elif isinstance(obj, (str, unicode)):
+        elif isinstance(obj, str):
             return cls(obj)
             return cls(obj)
 
 
         # Convert from c_char_p
         # Convert from c_char_p
@@ -329,19 +348,17 @@ class String(MutableString, Union):
         elif isinstance(obj, int):
         elif isinstance(obj, int):
             return cls(cast(obj, POINTER(c_char)))
             return cls(cast(obj, POINTER(c_char)))
 
 
-        # Convert from c_char array
-        elif isinstance(obj, c_char * len(obj)):
-            return obj
-
         # Convert from object
         # Convert from object
         else:
         else:
             return String.from_param(obj._as_parameter_)
             return String.from_param(obj._as_parameter_)
+
     from_param = classmethod(from_param)
     from_param = classmethod(from_param)
 
 
 
 
 def ReturnString(obj, func=None, arguments=None):
 def ReturnString(obj, func=None, arguments=None):
     return String.from_param(obj)
     return String.from_param(obj)
 
 
+
 # As of ctypes 1.0, ctypes does not support custom error-checking
 # As of ctypes 1.0, ctypes does not support custom error-checking
 # functions on callbacks, nor does it support custom datatypes on
 # functions on callbacks, nor does it support custom datatypes on
 # callbacks, so we must ensure that all callbacks return
 # callbacks, so we must ensure that all callbacks return
@@ -349,27 +366,20 @@ def ReturnString(obj, func=None, arguments=None):
 #
 #
 # Non-primitive return values wrapped with UNCHECKED won't be
 # Non-primitive return values wrapped with UNCHECKED won't be
 # typechecked, and will be converted to c_void_p.
 # typechecked, and will be converted to c_void_p.
-
-
 def UNCHECKED(type):
 def UNCHECKED(type):
-    if (hasattr(type, "_type_") and isinstance(type._type_, str)
-            and type._type_ != "P"):
+    if hasattr(type, "_type_") and isinstance(type._type_, str) and type._type_ != "P":
         return type
         return type
     else:
     else:
         return c_void_p
         return c_void_p
 
 
+
 # ctypes doesn't have direct support for variadic functions, so we have to write
 # ctypes doesn't have direct support for variadic functions, so we have to write
 # our own wrapper class
 # our own wrapper class
-
-
 class _variadic_function(object):
 class _variadic_function(object):
-
-    def __init__(self, func, restype, argtypes, errcheck):
+    def __init__(self, func, restype, argtypes):
         self.func = func
         self.func = func
         self.func.restype = restype
         self.func.restype = restype
         self.argtypes = argtypes
         self.argtypes = argtypes
-        if errcheck:
-            self.func.errcheck = errcheck
 
 
     def _as_parameter_(self):
     def _as_parameter_(self):
         # So we can pass this variadic function as a function pointer
         # So we can pass this variadic function as a function pointer
@@ -383,3 +393,14 @@ class _variadic_function(object):
             fixed_args.append(argtype.from_param(args[i]))
             fixed_args.append(argtype.from_param(args[i]))
             i += 1
             i += 1
         return self.func(*fixed_args + list(args[i:]))
         return self.func(*fixed_args + list(args[i:]))
+
+
+def ord_if_char(value):
+    """
+    Simple helper used for casts to simple builtin types:  if the argument is a
+    string type, it will be converted to it's ordinal value.
+
+    This function will raise an exception if the argument is string with more
+    than one characters.
+    """
+    return ord(value) if isinstance(value, str) else value

+ 95 - 93
python/grass/ctypes/preamble.py

@@ -1,16 +1,8 @@
-import ctypes
-import os
-import sys
-import six
+import ctypes, os, sys
 from ctypes import *
 from ctypes import *
-from grass.script.utils import encode
-
-if sys.version_info.major >= 3:
-    long = int
-    unicode = str
 
 
 _int_types = (c_int16, c_int32)
 _int_types = (c_int16, c_int32)
-if hasattr(ctypes, 'c_int64'):
+if hasattr(ctypes, "c_int64"):
     # Some builds of ctypes apparently do not have c_int64
     # Some builds of ctypes apparently do not have c_int64
     # defined; it's a pretty good bet that these builds do not
     # defined; it's a pretty good bet that these builds do not
     # have 64-bit pointers.
     # have 64-bit pointers.
@@ -22,51 +14,35 @@ del t
 del _int_types
 del _int_types
 
 
 
 
-class c_void(Structure):
-    # c_void_p is a buggy return type, converting to int, so
-    # POINTER(None) == c_void_p is actually written as
-    # POINTER(c_void), so it can be treated as a real pointer.
-    _fields_ = [('dummy', c_int)]
-
-
-def POINTER(obj):
-    p = ctypes.POINTER(obj)
-
-    # Convert None to a real NULL pointer to work around bugs
-    # in how ctypes handles None on 64-bit platforms
-    if not isinstance(p.from_param, classmethod):
-        def from_param(cls, x):
-            if x is None:
-                return cls()
-            else:
-                return x
-        p.from_param = classmethod(from_param)
-
-    return p
-
-
 class UserString:
 class UserString:
     def __init__(self, seq):
     def __init__(self, seq):
-        if isinstance(seq, str):
+        if isinstance(seq, basestring):
             self.data = seq
             self.data = seq
         elif isinstance(seq, UserString):
         elif isinstance(seq, UserString):
             self.data = seq.data[:]
             self.data = seq.data[:]
         else:
         else:
             self.data = str(seq)
             self.data = str(seq)
 
 
-    def __str__(self): return str(self.data)
+    def __str__(self):
+        return str(self.data)
 
 
-    def __repr__(self): return repr(self.data)
+    def __repr__(self):
+        return repr(self.data)
 
 
-    def __int__(self): return int(self.data)
+    def __int__(self):
+        return int(self.data)
 
 
-    def __long__(self): return long(self.data)
+    def __long__(self):
+        return long(self.data)
 
 
-    def __float__(self): return float(self.data)
+    def __float__(self):
+        return float(self.data)
 
 
-    def __complex__(self): return complex(self.data)
+    def __complex__(self):
+        return complex(self.data)
 
 
-    def __hash__(self): return hash(self.data)
+    def __hash__(self):
+        return hash(self.data)
 
 
     def __cmp__(self, string):
     def __cmp__(self, string):
         if isinstance(string, UserString):
         if isinstance(string, UserString):
@@ -77,9 +53,11 @@ class UserString:
     def __contains__(self, char):
     def __contains__(self, char):
         return char in self.data
         return char in self.data
 
 
-    def __len__(self): return len(self.data)
+    def __len__(self):
+        return len(self.data)
 
 
-    def __getitem__(self, index): return self.__class__(self.data[index])
+    def __getitem__(self, index):
+        return self.__class__(self.data[index])
 
 
     def __getslice__(self, start, end):
     def __getslice__(self, start, end):
         start = max(start, 0)
         start = max(start, 0)
@@ -89,31 +67,33 @@ class UserString:
     def __add__(self, other):
     def __add__(self, other):
         if isinstance(other, UserString):
         if isinstance(other, UserString):
             return self.__class__(self.data + other.data)
             return self.__class__(self.data + other.data)
-        elif isinstance(other, str):
+        elif isinstance(other, basestring):
             return self.__class__(self.data + other)
             return self.__class__(self.data + other)
         else:
         else:
             return self.__class__(self.data + str(other))
             return self.__class__(self.data + str(other))
 
 
     def __radd__(self, other):
     def __radd__(self, other):
-        if isinstance(other, str):
+        if isinstance(other, basestring):
             return self.__class__(other + self.data)
             return self.__class__(other + self.data)
         else:
         else:
             return self.__class__(str(other) + self.data)
             return self.__class__(str(other) + self.data)
 
 
     def __mul__(self, n):
     def __mul__(self, n):
         return self.__class__(self.data * n)
         return self.__class__(self.data * n)
+
     __rmul__ = __mul__
     __rmul__ = __mul__
 
 
     def __mod__(self, args):
     def __mod__(self, args):
         return self.__class__(self.data % args)
         return self.__class__(self.data % args)
 
 
     # the following methods are defined in alphabetical order:
     # the following methods are defined in alphabetical order:
-    def capitalize(self): return self.__class__(self.data.capitalize())
+    def capitalize(self):
+        return self.__class__(self.data.capitalize())
 
 
     def center(self, width, *args):
     def center(self, width, *args):
         return self.__class__(self.data.center(width, *args))
         return self.__class__(self.data.center(width, *args))
 
 
-    def count(self, sub, start=0, end=sys.maxsize):
+    def count(self, sub, start=0, end=sys.maxint):
         return self.data.count(sub, start, end)
         return self.data.count(sub, start, end)
 
 
     def decode(self, encoding=None, errors=None):  # XXX improve this?
     def decode(self, encoding=None, errors=None):  # XXX improve this?
@@ -134,44 +114,56 @@ class UserString:
         else:
         else:
             return self.__class__(self.data.encode())
             return self.__class__(self.data.encode())
 
 
-    def endswith(self, suffix, start=0, end=sys.maxsize):
+    def endswith(self, suffix, start=0, end=sys.maxint):
         return self.data.endswith(suffix, start, end)
         return self.data.endswith(suffix, start, end)
 
 
     def expandtabs(self, tabsize=8):
     def expandtabs(self, tabsize=8):
         return self.__class__(self.data.expandtabs(tabsize))
         return self.__class__(self.data.expandtabs(tabsize))
 
 
-    def find(self, sub, start=0, end=sys.maxsize):
+    def find(self, sub, start=0, end=sys.maxint):
         return self.data.find(sub, start, end)
         return self.data.find(sub, start, end)
 
 
-    def index(self, sub, start=0, end=sys.maxsize):
+    def index(self, sub, start=0, end=sys.maxint):
         return self.data.index(sub, start, end)
         return self.data.index(sub, start, end)
 
 
-    def isalpha(self): return self.data.isalpha()
+    def isalpha(self):
+        return self.data.isalpha()
 
 
-    def isalnum(self): return self.data.isalnum()
+    def isalnum(self):
+        return self.data.isalnum()
 
 
-    def isdecimal(self): return self.data.isdecimal()
+    def isdecimal(self):
+        return self.data.isdecimal()
 
 
-    def isdigit(self): return self.data.isdigit()
+    def isdigit(self):
+        return self.data.isdigit()
 
 
-    def islower(self): return self.data.islower()
+    def islower(self):
+        return self.data.islower()
 
 
-    def isnumeric(self): return self.data.isnumeric()
+    def isnumeric(self):
+        return self.data.isnumeric()
 
 
-    def isspace(self): return self.data.isspace()
+    def isspace(self):
+        return self.data.isspace()
 
 
-    def istitle(self): return self.data.istitle()
+    def istitle(self):
+        return self.data.istitle()
 
 
-    def isupper(self): return self.data.isupper()
+    def isupper(self):
+        return self.data.isupper()
 
 
-    def join(self, seq): return self.data.join(seq)
+    def join(self, seq):
+        return self.data.join(seq)
 
 
     def ljust(self, width, *args):
     def ljust(self, width, *args):
         return self.__class__(self.data.ljust(width, *args))
         return self.__class__(self.data.ljust(width, *args))
 
 
-    def lower(self): return self.__class__(self.data.lower())
+    def lower(self):
+        return self.__class__(self.data.lower())
 
 
-    def lstrip(self, chars=None): return self.__class__(self.data.lstrip(chars))
+    def lstrip(self, chars=None):
+        return self.__class__(self.data.lstrip(chars))
 
 
     def partition(self, sep):
     def partition(self, sep):
         return self.data.partition(sep)
         return self.data.partition(sep)
@@ -179,10 +171,10 @@ class UserString:
     def replace(self, old, new, maxsplit=-1):
     def replace(self, old, new, maxsplit=-1):
         return self.__class__(self.data.replace(old, new, maxsplit))
         return self.__class__(self.data.replace(old, new, maxsplit))
 
 
-    def rfind(self, sub, start=0, end=sys.maxsize):
+    def rfind(self, sub, start=0, end=sys.maxint):
         return self.data.rfind(sub, start, end)
         return self.data.rfind(sub, start, end)
 
 
-    def rindex(self, sub, start=0, end=sys.maxsize):
+    def rindex(self, sub, start=0, end=sys.maxint):
         return self.data.rindex(sub, start, end)
         return self.data.rindex(sub, start, end)
 
 
     def rjust(self, width, *args):
     def rjust(self, width, *args):
@@ -191,7 +183,8 @@ class UserString:
     def rpartition(self, sep):
     def rpartition(self, sep):
         return self.data.rpartition(sep)
         return self.data.rpartition(sep)
 
 
-    def rstrip(self, chars=None): return self.__class__(self.data.rstrip(chars))
+    def rstrip(self, chars=None):
+        return self.__class__(self.data.rstrip(chars))
 
 
     def split(self, sep=None, maxsplit=-1):
     def split(self, sep=None, maxsplit=-1):
         return self.data.split(sep, maxsplit)
         return self.data.split(sep, maxsplit)
@@ -199,23 +192,29 @@ class UserString:
     def rsplit(self, sep=None, maxsplit=-1):
     def rsplit(self, sep=None, maxsplit=-1):
         return self.data.rsplit(sep, maxsplit)
         return self.data.rsplit(sep, maxsplit)
 
 
-    def splitlines(self, keepends=0): return self.data.splitlines(keepends)
+    def splitlines(self, keepends=0):
+        return self.data.splitlines(keepends)
 
 
-    def startswith(self, prefix, start=0, end=sys.maxsize):
+    def startswith(self, prefix, start=0, end=sys.maxint):
         return self.data.startswith(prefix, start, end)
         return self.data.startswith(prefix, start, end)
 
 
-    def strip(self, chars=None): return self.__class__(self.data.strip(chars))
+    def strip(self, chars=None):
+        return self.__class__(self.data.strip(chars))
 
 
-    def swapcase(self): return self.__class__(self.data.swapcase())
+    def swapcase(self):
+        return self.__class__(self.data.swapcase())
 
 
-    def title(self): return self.__class__(self.data.title())
+    def title(self):
+        return self.__class__(self.data.title())
 
 
     def translate(self, *args):
     def translate(self, *args):
         return self.__class__(self.data.translate(*args))
         return self.__class__(self.data.translate(*args))
 
 
-    def upper(self): return self.__class__(self.data.upper())
+    def upper(self):
+        return self.__class__(self.data.upper())
 
 
-    def zfill(self, width): return self.__class__(self.data.zfill(width))
+    def zfill(self, width):
+        return self.__class__(self.data.zfill(width))
 
 
 
 
 class MutableString(UserString):
 class MutableString(UserString):
@@ -245,21 +244,21 @@ class MutableString(UserString):
             index += len(self.data)
             index += len(self.data)
         if index < 0 or index >= len(self.data):
         if index < 0 or index >= len(self.data):
             raise IndexError
             raise IndexError
-        self.data = self.data[:index] + sub + self.data[index + 1:]
+        self.data = self.data[:index] + sub + self.data[index + 1 :]
 
 
     def __delitem__(self, index):
     def __delitem__(self, index):
         if index < 0:
         if index < 0:
             index += len(self.data)
             index += len(self.data)
         if index < 0 or index >= len(self.data):
         if index < 0 or index >= len(self.data):
             raise IndexError
             raise IndexError
-        self.data = self.data[:index] + self.data[index + 1:]
+        self.data = self.data[:index] + self.data[index + 1 :]
 
 
     def __setslice__(self, start, end, sub):
     def __setslice__(self, start, end, sub):
         start = max(start, 0)
         start = max(start, 0)
         end = max(end, 0)
         end = max(end, 0)
         if isinstance(sub, UserString):
         if isinstance(sub, UserString):
             self.data = self.data[:start] + sub.data + self.data[end:]
             self.data = self.data[:start] + sub.data + self.data[end:]
-        elif isinstance(sub, str):
+        elif isinstance(sub, basestring):
             self.data = self.data[:start] + sub + self.data[end:]
             self.data = self.data[:start] + sub + self.data[end:]
         else:
         else:
             self.data = self.data[:start] + str(sub) + self.data[end:]
             self.data = self.data[:start] + str(sub) + self.data[end:]
@@ -275,7 +274,7 @@ class MutableString(UserString):
     def __iadd__(self, other):
     def __iadd__(self, other):
         if isinstance(other, UserString):
         if isinstance(other, UserString):
             self.data += other.data
             self.data += other.data
-        elif isinstance(other, str):
+        elif isinstance(other, basestring):
             self.data += other
             self.data += other
         else:
         else:
             self.data += str(other)
             self.data += str(other)
@@ -288,12 +287,11 @@ class MutableString(UserString):
 
 
 class String(MutableString, Union):
 class String(MutableString, Union):
 
 
-    _fields_ = [('raw', POINTER(c_char)),
-                ('data', c_char_p)]
+    _fields_ = [("raw", POINTER(c_char)), ("data", c_char_p)]
 
 
     def __init__(self, obj=""):
     def __init__(self, obj=""):
-        if isinstance(obj, (str, unicode, bytes, UserString)):
-            self.data = encode(obj)
+        if isinstance(obj, (str, unicode, UserString)):
+            self.data = str(obj)
         else:
         else:
             self.raw = obj
             self.raw = obj
 
 
@@ -309,12 +307,8 @@ class String(MutableString, Union):
         elif isinstance(obj, String):
         elif isinstance(obj, String):
             return obj
             return obj
 
 
-        # Convert from bytes
-        elif isinstance(obj, bytes):
-            return cls(obj)
-
-        # Convert from str/unicode
-        elif isinstance(obj, (str, unicode)):
+        # Convert from str
+        elif isinstance(obj, str):
             return cls(obj)
             return cls(obj)
 
 
         # Convert from c_char_p
         # Convert from c_char_p
@@ -336,12 +330,14 @@ class String(MutableString, Union):
         # Convert from object
         # Convert from object
         else:
         else:
             return String.from_param(obj._as_parameter_)
             return String.from_param(obj._as_parameter_)
+
     from_param = classmethod(from_param)
     from_param = classmethod(from_param)
 
 
 
 
 def ReturnString(obj, func=None, arguments=None):
 def ReturnString(obj, func=None, arguments=None):
     return String.from_param(obj)
     return String.from_param(obj)
 
 
+
 # As of ctypes 1.0, ctypes does not support custom error-checking
 # As of ctypes 1.0, ctypes does not support custom error-checking
 # functions on callbacks, nor does it support custom datatypes on
 # functions on callbacks, nor does it support custom datatypes on
 # callbacks, so we must ensure that all callbacks return
 # callbacks, so we must ensure that all callbacks return
@@ -349,21 +345,16 @@ def ReturnString(obj, func=None, arguments=None):
 #
 #
 # Non-primitive return values wrapped with UNCHECKED won't be
 # Non-primitive return values wrapped with UNCHECKED won't be
 # typechecked, and will be converted to c_void_p.
 # typechecked, and will be converted to c_void_p.
-
-
 def UNCHECKED(type):
 def UNCHECKED(type):
-    if (hasattr(type, "_type_") and isinstance(type._type_, str)
-            and type._type_ != "P"):
+    if hasattr(type, "_type_") and isinstance(type._type_, str) and type._type_ != "P":
         return type
         return type
     else:
     else:
         return c_void_p
         return c_void_p
 
 
+
 # ctypes doesn't have direct support for variadic functions, so we have to write
 # ctypes doesn't have direct support for variadic functions, so we have to write
 # our own wrapper class
 # our own wrapper class
-
-
 class _variadic_function(object):
 class _variadic_function(object):
-
     def __init__(self, func, restype, argtypes, errcheck):
     def __init__(self, func, restype, argtypes, errcheck):
         self.func = func
         self.func = func
         self.func.restype = restype
         self.func.restype = restype
@@ -383,3 +374,14 @@ class _variadic_function(object):
             fixed_args.append(argtype.from_param(args[i]))
             fixed_args.append(argtype.from_param(args[i]))
             i += 1
             i += 1
         return self.func(*fixed_args + list(args[i:]))
         return self.func(*fixed_args + list(args[i:]))
+
+
+def ord_if_char(value):
+    """
+    Simple helper used for casts to simple builtin types:  if the argument is a
+    string type, it will be converted to it's ordinal value.
+
+    This function will raise an exception if the argument is string with more
+    than one characters.
+    """
+    return ord(value) if isinstance(value, str) else value

+ 448 - 0
python/grass/ctypes/ctypesgen/printer_python/preamble/3_2.py

@@ -0,0 +1,448 @@
+import ctypes, os, sys
+from ctypes import *
+
+_int_types = (c_int16, c_int32)
+if hasattr(ctypes, "c_int64"):
+    # Some builds of ctypes apparently do not have c_int64
+    # defined; it's a pretty good bet that these builds do not
+    # have 64-bit pointers.
+    _int_types += (c_int64,)
+for t in _int_types:
+    if sizeof(t) == sizeof(c_size_t):
+        c_ptrdiff_t = t
+del t
+del _int_types
+
+
+def POINTER(obj):
+    p = ctypes.POINTER(obj)
+
+    # Convert None to a real NULL pointer to work around bugs
+    # in how ctypes handles None on 64-bit platforms
+    if not isinstance(p.from_param, classmethod):
+
+        def from_param(cls, x):
+            if x is None:
+                return cls()
+            else:
+                return x
+
+        p.from_param = classmethod(from_param)
+
+    return p
+
+
+class UserString:
+    def __init__(self, seq):
+        if isinstance(seq, bytes):
+            self.data = seq
+        elif isinstance(seq, UserString):
+            self.data = seq.data[:]
+        else:
+            self.data = str(seq).encode()
+
+    def __bytes__(self):
+        return self.data
+
+    def __str__(self):
+        return self.data.decode()
+
+    def __repr__(self):
+        return repr(self.data)
+
+    def __int__(self):
+        return int(self.data.decode())
+
+    def __long__(self):
+        return int(self.data.decode())
+
+    def __float__(self):
+        return float(self.data.decode())
+
+    def __complex__(self):
+        return complex(self.data.decode())
+
+    def __hash__(self):
+        return hash(self.data)
+
+    def __cmp__(self, string):
+        if isinstance(string, UserString):
+            return cmp(self.data, string.data)
+        else:
+            return cmp(self.data, string)
+
+    def __le__(self, string):
+        if isinstance(string, UserString):
+            return self.data <= string.data
+        else:
+            return self.data <= string
+
+    def __lt__(self, string):
+        if isinstance(string, UserString):
+            return self.data < string.data
+        else:
+            return self.data < string
+
+    def __ge__(self, string):
+        if isinstance(string, UserString):
+            return self.data >= string.data
+        else:
+            return self.data >= string
+
+    def __gt__(self, string):
+        if isinstance(string, UserString):
+            return self.data > string.data
+        else:
+            return self.data > string
+
+    def __eq__(self, string):
+        if isinstance(string, UserString):
+            return self.data == string.data
+        else:
+            return self.data == string
+
+    def __ne__(self, string):
+        if isinstance(string, UserString):
+            return self.data != string.data
+        else:
+            return self.data != string
+
+    def __contains__(self, char):
+        return char in self.data
+
+    def __len__(self):
+        return len(self.data)
+
+    def __getitem__(self, index):
+        return self.__class__(self.data[index])
+
+    def __getslice__(self, start, end):
+        start = max(start, 0)
+        end = max(end, 0)
+        return self.__class__(self.data[start:end])
+
+    def __add__(self, other):
+        if isinstance(other, UserString):
+            return self.__class__(self.data + other.data)
+        elif isinstance(other, bytes):
+            return self.__class__(self.data + other)
+        else:
+            return self.__class__(self.data + str(other).encode())
+
+    def __radd__(self, other):
+        if isinstance(other, bytes):
+            return self.__class__(other + self.data)
+        else:
+            return self.__class__(str(other).encode() + self.data)
+
+    def __mul__(self, n):
+        return self.__class__(self.data * n)
+
+    __rmul__ = __mul__
+
+    def __mod__(self, args):
+        return self.__class__(self.data % args)
+
+    # the following methods are defined in alphabetical order:
+    def capitalize(self):
+        return self.__class__(self.data.capitalize())
+
+    def center(self, width, *args):
+        return self.__class__(self.data.center(width, *args))
+
+    def count(self, sub, start=0, end=sys.maxsize):
+        return self.data.count(sub, start, end)
+
+    def decode(self, encoding=None, errors=None):  # XXX improve this?
+        if encoding:
+            if errors:
+                return self.__class__(self.data.decode(encoding, errors))
+            else:
+                return self.__class__(self.data.decode(encoding))
+        else:
+            return self.__class__(self.data.decode())
+
+    def encode(self, encoding=None, errors=None):  # XXX improve this?
+        if encoding:
+            if errors:
+                return self.__class__(self.data.encode(encoding, errors))
+            else:
+                return self.__class__(self.data.encode(encoding))
+        else:
+            return self.__class__(self.data.encode())
+
+    def endswith(self, suffix, start=0, end=sys.maxsize):
+        return self.data.endswith(suffix, start, end)
+
+    def expandtabs(self, tabsize=8):
+        return self.__class__(self.data.expandtabs(tabsize))
+
+    def find(self, sub, start=0, end=sys.maxsize):
+        return self.data.find(sub, start, end)
+
+    def index(self, sub, start=0, end=sys.maxsize):
+        return self.data.index(sub, start, end)
+
+    def isalpha(self):
+        return self.data.isalpha()
+
+    def isalnum(self):
+        return self.data.isalnum()
+
+    def isdecimal(self):
+        return self.data.isdecimal()
+
+    def isdigit(self):
+        return self.data.isdigit()
+
+    def islower(self):
+        return self.data.islower()
+
+    def isnumeric(self):
+        return self.data.isnumeric()
+
+    def isspace(self):
+        return self.data.isspace()
+
+    def istitle(self):
+        return self.data.istitle()
+
+    def isupper(self):
+        return self.data.isupper()
+
+    def join(self, seq):
+        return self.data.join(seq)
+
+    def ljust(self, width, *args):
+        return self.__class__(self.data.ljust(width, *args))
+
+    def lower(self):
+        return self.__class__(self.data.lower())
+
+    def lstrip(self, chars=None):
+        return self.__class__(self.data.lstrip(chars))
+
+    def partition(self, sep):
+        return self.data.partition(sep)
+
+    def replace(self, old, new, maxsplit=-1):
+        return self.__class__(self.data.replace(old, new, maxsplit))
+
+    def rfind(self, sub, start=0, end=sys.maxsize):
+        return self.data.rfind(sub, start, end)
+
+    def rindex(self, sub, start=0, end=sys.maxsize):
+        return self.data.rindex(sub, start, end)
+
+    def rjust(self, width, *args):
+        return self.__class__(self.data.rjust(width, *args))
+
+    def rpartition(self, sep):
+        return self.data.rpartition(sep)
+
+    def rstrip(self, chars=None):
+        return self.__class__(self.data.rstrip(chars))
+
+    def split(self, sep=None, maxsplit=-1):
+        return self.data.split(sep, maxsplit)
+
+    def rsplit(self, sep=None, maxsplit=-1):
+        return self.data.rsplit(sep, maxsplit)
+
+    def splitlines(self, keepends=0):
+        return self.data.splitlines(keepends)
+
+    def startswith(self, prefix, start=0, end=sys.maxsize):
+        return self.data.startswith(prefix, start, end)
+
+    def strip(self, chars=None):
+        return self.__class__(self.data.strip(chars))
+
+    def swapcase(self):
+        return self.__class__(self.data.swapcase())
+
+    def title(self):
+        return self.__class__(self.data.title())
+
+    def translate(self, *args):
+        return self.__class__(self.data.translate(*args))
+
+    def upper(self):
+        return self.__class__(self.data.upper())
+
+    def zfill(self, width):
+        return self.__class__(self.data.zfill(width))
+
+
+class MutableString(UserString):
+    """mutable string objects
+
+    Python strings are immutable objects.  This has the advantage, that
+    strings may be used as dictionary keys.  If this property isn't needed
+    and you insist on changing string values in place instead, you may cheat
+    and use MutableString.
+
+    But the purpose of this class is an educational one: to prevent
+    people from inventing their own mutable string class derived
+    from UserString and than forget thereby to remove (override) the
+    __hash__ method inherited from UserString.  This would lead to
+    errors that would be very hard to track down.
+
+    A faster and better solution is to rewrite your program using lists."""
+
+    def __init__(self, string=""):
+        self.data = string
+
+    def __hash__(self):
+        raise TypeError("unhashable type (it is mutable)")
+
+    def __setitem__(self, index, sub):
+        if index < 0:
+            index += len(self.data)
+        if index < 0 or index >= len(self.data):
+            raise IndexError
+        self.data = self.data[:index] + sub + self.data[index + 1 :]
+
+    def __delitem__(self, index):
+        if index < 0:
+            index += len(self.data)
+        if index < 0 or index >= len(self.data):
+            raise IndexError
+        self.data = self.data[:index] + self.data[index + 1 :]
+
+    def __setslice__(self, start, end, sub):
+        start = max(start, 0)
+        end = max(end, 0)
+        if isinstance(sub, UserString):
+            self.data = self.data[:start] + sub.data + self.data[end:]
+        elif isinstance(sub, bytes):
+            self.data = self.data[:start] + sub + self.data[end:]
+        else:
+            self.data = self.data[:start] + str(sub).encode() + self.data[end:]
+
+    def __delslice__(self, start, end):
+        start = max(start, 0)
+        end = max(end, 0)
+        self.data = self.data[:start] + self.data[end:]
+
+    def immutable(self):
+        return UserString(self.data)
+
+    def __iadd__(self, other):
+        if isinstance(other, UserString):
+            self.data += other.data
+        elif isinstance(other, bytes):
+            self.data += other
+        else:
+            self.data += str(other).encode()
+        return self
+
+    def __imul__(self, n):
+        self.data *= n
+        return self
+
+
+class String(MutableString, Union):
+
+    _fields_ = [("raw", POINTER(c_char)), ("data", c_char_p)]
+
+    def __init__(self, obj=b""):
+        if isinstance(obj, (bytes, UserString)):
+            self.data = bytes(obj)
+        else:
+            self.raw = obj
+
+    def __len__(self):
+        return self.data and len(self.data) or 0
+
+    def from_param(cls, obj):
+        # Convert None or 0
+        if obj is None or obj == 0:
+            return cls(POINTER(c_char)())
+
+        # Convert from String
+        elif isinstance(obj, String):
+            return obj
+
+        # Convert from bytes
+        elif isinstance(obj, bytes):
+            return cls(obj)
+
+        # Convert from str
+        elif isinstance(obj, str):
+            return cls(obj.encode())
+
+        # Convert from c_char_p
+        elif isinstance(obj, c_char_p):
+            return obj
+
+        # Convert from POINTER(c_char)
+        elif isinstance(obj, POINTER(c_char)):
+            return obj
+
+        # Convert from raw pointer
+        elif isinstance(obj, int):
+            return cls(cast(obj, POINTER(c_char)))
+
+        # Convert from c_char array
+        elif isinstance(obj, c_char * len(obj)):
+            return obj
+
+        # Convert from object
+        else:
+            return String.from_param(obj._as_parameter_)
+
+    from_param = classmethod(from_param)
+
+
+def ReturnString(obj, func=None, arguments=None):
+    return String.from_param(obj)
+
+
+# As of ctypes 1.0, ctypes does not support custom error-checking
+# functions on callbacks, nor does it support custom datatypes on
+# callbacks, so we must ensure that all callbacks return
+# primitive datatypes.
+#
+# Non-primitive return values wrapped with UNCHECKED won't be
+# typechecked, and will be converted to c_void_p.
+def UNCHECKED(type):
+    if hasattr(type, "_type_") and isinstance(type._type_, str) and type._type_ != "P":
+        return type
+    else:
+        return c_void_p
+
+
+# ctypes doesn't have direct support for variadic functions, so we have to write
+# our own wrapper class
+class _variadic_function(object):
+    def __init__(self, func, restype, argtypes, errcheck):
+        self.func = func
+        self.func.restype = restype
+        self.argtypes = argtypes
+        if errcheck:
+            self.func.errcheck = errcheck
+
+    def _as_parameter_(self):
+        # So we can pass this variadic function as a function pointer
+        return self.func
+
+    def __call__(self, *args):
+        fixed_args = []
+        i = 0
+        for argtype in self.argtypes:
+            # Typecheck what we can
+            fixed_args.append(argtype.from_param(args[i]))
+            i += 1
+        return self.func(*fixed_args + list(args[i:]))
+
+
+def ord_if_char(value):
+    """
+    Simple helper used for casts to simple builtin types:  if the argument is a
+    string type, it will be converted to it's ordinal value.
+
+    This function will raise an exception if the argument is string with more
+    than one characters.
+    """
+    return ord(value) if (isinstance(value, bytes) or isinstance(value, str)) else value

+ 0 - 0
python/grass/ctypes/ctypesgen/printer_python/preamble/__init__.py


+ 460 - 0
python/grass/ctypes/ctypesgen/printer_python/printer.py

@@ -0,0 +1,460 @@
+#!/usr/bin/env python
+
+import os, sys, time, glob, re
+from ..descriptions import *
+from ..ctypedescs import *
+from ..messages import *
+from .. import expressions
+
+from .. import libraryloader  # So we can get the path to it
+from . import test  # So we can find the path to local files in the printer package
+
+
+def path_to_local_file(name, known_local_module=test):
+    basedir = os.path.dirname(known_local_module.__file__)
+    return os.path.join(basedir, name)
+
+
+THIS_DIR = os.path.dirname(__file__)
+PREAMBLE_PATH = os.path.join(THIS_DIR, "preamble", "[0-9]_[0-9].py")
+
+
+def get_preamble(major=None, minor=None):
+    """get the available preambles"""
+    preambles = dict()
+    for fp in glob.glob(PREAMBLE_PATH):
+        m = re.search("(\d)_(\d).py$", fp)
+        if not m:
+            continue
+        preambles[(int(m.group(1)), int(m.group(2)))] = fp
+
+    if None not in (major, minor):
+        v = (int(major), int(minor))
+    else:
+        L = sorted(preambles.keys())
+        v = L[0]
+        for vi in L[1:]:
+            if vi > sys.version_info[:2]:
+                break
+            v = vi
+    return preambles[v], v
+
+
+class WrapperPrinter:
+    def __init__(self, outpath, options, data):
+        status_message("Writing to %s." % (outpath or "stdout"))
+
+        self.file = open(outpath, "w") if outpath else sys.stdout
+        self.options = options
+
+        if self.options.strip_build_path and self.options.strip_build_path[-1] != os.path.sep:
+            self.options.strip_build_path += os.path.sep
+
+        self.print_header()
+        self.file.write("\n")
+
+        self.print_preamble()
+        self.file.write("\n")
+
+        self.print_loader()
+        self.file.write("\n")
+
+        self.print_group(self.options.libraries, "libraries", self.print_library)
+        self.print_group(self.options.modules, "modules", self.print_module)
+
+        method_table = {
+            "function": self.print_function,
+            "macro": self.print_macro,
+            "struct": self.print_struct,
+            "struct-body": self.print_struct_members,
+            "typedef": self.print_typedef,
+            "variable": self.print_variable,
+            "enum": self.print_enum,
+            "constant": self.print_constant,
+            "undef": self.print_undef,
+        }
+
+        for kind, desc in data.output_order:
+            if desc.included:
+                method_table[kind](desc)
+                self.file.write("\n")
+
+        self.print_group(self.options.inserted_files, "inserted files", self.insert_file)
+        self.strip_prefixes()
+
+    def __del__(self):
+        self.file.close()
+
+    def print_group(self, list, name, function):
+        if list:
+            self.file.write("# Begin %s\n" % name)
+            for obj in list:
+                function(obj)
+            self.file.write("\n")
+            self.file.write("# %d %s\n" % (len(list), name))
+            self.file.write("# End %s\n" % name)
+        else:
+            self.file.write("# No %s\n" % name)
+        self.file.write("\n")
+
+    def srcinfo(self, src):
+        if src == None:
+            self.file.write("\n")
+        else:
+            filename, lineno = src
+            if filename in ("<built-in>", "<command line>"):
+                self.file.write("# %s\n" % filename)
+            else:
+                if self.options.strip_build_path and filename.startswith(
+                    self.options.strip_build_path
+                ):
+                    filename = filename[len(self.options.strip_build_path) :]
+                self.file.write("# %s: %s\n" % (filename, lineno))
+
+    def template_subs(self):
+        template_subs = {
+            "date": time.ctime(),
+            "argv": " ".join([x for x in sys.argv if not x.startswith("--strip-build-path")]),
+            "name": os.path.basename(self.options.headers[0]),
+        }
+
+        for opt, value in self.options.__dict__.items():
+            if type(value) == str:
+                template_subs[opt] = value
+            elif isinstance(value, (list, tuple)):
+                template_subs[opt] = (os.path.sep).join(value)
+            else:
+                template_subs[opt] = repr(value)
+
+        return template_subs
+
+    def print_header(self):
+        template_file = None
+
+        if self.options.header_template:
+            path = self.options.header_template
+            try:
+                template_file = open(path, "r")
+            except IOError:
+                error_message(
+                    'Cannot load header template from file "%s" '
+                    " - using default template." % path,
+                    cls="missing-file",
+                )
+
+        if not template_file:
+            path = path_to_local_file("defaultheader.py")
+            template_file = open(path, "r")
+
+        template_subs = self.template_subs()
+        self.file.write(template_file.read() % template_subs)
+
+        template_file.close()
+
+    def print_preamble(self):
+        m = re.match("py((?P<major>[0-9])(?P<minor>[0-9]))?", self.options.output_language)
+        path, v = get_preamble(**m.groupdict())
+
+        self.file.write("# Begin preamble for Python v{}\n\n".format(v))
+        self.file.write("from .ctypes_preamble import *\n")
+        self.file.write("from .ctypes_preamble import _variadic_function\n")
+        # preamble_file = open(path, "r")
+        # self.file.write(preamble_file.read())
+        # preamble_file.close()
+        self.file.write("\n# End preamble\n")
+
+    def print_loader(self):
+        self.file.write("_libs = {}\n")
+        self.file.write("_libdirs = %s\n\n" % self.options.compile_libdirs)
+        self.file.write("# Begin loader\n\n")
+        self.file.write("from .ctypes_loader import *\n")        
+        # path = path_to_local_file("libraryloader.py", libraryloader)
+        # loader_file = open(path, "r")
+        # self.file.write(loader_file.read())
+        # loader_file.close()
+        self.file.write("\n# End loader\n\n")
+        self.file.write(
+            "add_library_search_dirs([%s])"
+            % ", ".join([repr(d) for d in self.options.runtime_libdirs])
+        )
+        self.file.write("\n")
+
+    def print_library(self, library):
+        self.file.write('_libs["%s"] = load_library("%s")\n' % (library, library))
+
+    def print_module(self, module):
+        self.file.write("from %s import *\n" % module)
+
+    def print_constant(self, constant):
+        self.file.write("%s = %s" % (constant.name, constant.value.py_string(False)))
+        self.srcinfo(constant.src)
+
+    def print_undef(self, undef):
+        self.srcinfo(undef.src)
+        self.file.write(
+            "# #undef {macro}\n"
+            "try:\n"
+            "    del {macro}\n"
+            "except NameError:\n"
+            "    pass\n".format(macro=undef.macro.py_string(False))
+        )
+
+    def print_typedef(self, typedef):
+        self.file.write("%s = %s" % (typedef.name, typedef.ctype.py_string()))
+        self.srcinfo(typedef.src)
+
+    def print_struct(self, struct):
+        self.srcinfo(struct.src)
+        base = {"union": "Union", "struct": "Structure"}[struct.variety]
+        self.file.write("class %s_%s(%s):\n" "    pass\n" % (struct.variety, struct.tag, base))
+
+    def print_struct_members(self, struct):
+        if struct.opaque:
+            return
+
+        # is this supposed to be packed?
+        if struct.attrib.get("packed", False):
+            aligned = struct.attrib.get("aligned", [1])
+            assert len(aligned) == 1, "cgrammar gave more than one arg for aligned attribute"
+            aligned = aligned[0]
+            if isinstance(aligned, expressions.ExpressionNode):
+                # TODO: for non-constant expression nodes, this will fail:
+                aligned = aligned.evaluate(None)
+            self.file.write("{}_{}._pack_ = {}\n".format(struct.variety, struct.tag, aligned))
+
+        # handle unnamed fields.
+        unnamed_fields = []
+        names = set([x[0] for x in struct.members])
+        anon_prefix = "unnamed_"
+        n = 1
+        for mi in range(len(struct.members)):
+            mem = list(struct.members[mi])
+            if mem[0] is None:
+                while True:
+                    name = "%s%i" % (anon_prefix, n)
+                    n += 1
+                    if name not in names:
+                        break
+                mem[0] = name
+                names.add(name)
+                if type(mem[1]) is CtypesStruct:
+                    unnamed_fields.append(name)
+                struct.members[mi] = mem
+
+        self.file.write("%s_%s.__slots__ = [\n" % (struct.variety, struct.tag))
+        for name, ctype in struct.members:
+            self.file.write("    '%s',\n" % name)
+        self.file.write("]\n")
+
+        if len(unnamed_fields) > 0:
+            self.file.write("%s_%s._anonymous_ = [\n" % (struct.variety, struct.tag))
+            for name in unnamed_fields:
+                self.file.write("    '%s',\n" % name)
+            self.file.write("]\n")
+
+        self.file.write("%s_%s._fields_ = [\n" % (struct.variety, struct.tag))
+        for name, ctype in struct.members:
+            if isinstance(ctype, CtypesBitfield):
+                self.file.write(
+                    "    ('%s', %s, %s),\n"
+                    % (name, ctype.py_string(), ctype.bitfield.py_string(False))
+                )
+            else:
+                self.file.write("    ('%s', %s),\n" % (name, ctype.py_string()))
+        self.file.write("]\n")
+
+    def print_enum(self, enum):
+        self.file.write("enum_%s = c_int" % enum.tag)
+        self.srcinfo(enum.src)
+        # Values of enumerator are output as constants.
+
+    def print_function(self, function):
+        if function.variadic:
+            self.print_variadic_function(function)
+        else:
+            self.print_fixed_function(function)
+
+    def print_fixed_function(self, function):
+        self.srcinfo(function.src)
+
+        CC = "stdcall" if function.attrib.get("stdcall", False) else "cdecl"
+
+        # If we know what library the function lives in, look there.
+        # Otherwise, check all the libraries.
+        if function.source_library:
+            self.file.write(
+                'if _libs["{L}"].has("{CN}", "{CC}"):\n'
+                '    {PN} = _libs["{L}"].get("{CN}", "{CC}")\n'.format(
+                    L=function.source_library, CN=function.c_name(), PN=function.py_name(), CC=CC
+                )
+            )
+        else:
+            self.file.write(
+                "for _lib in _libs.values():\n"
+                '    if not _lib.has("{CN}", "{CC}"):\n'
+                "        continue\n"
+                '    {PN} = _lib.get("{CN}", "{CC}")\n'.format(
+                    CN=function.c_name(), PN=function.py_name(), CC=CC
+                )
+            )
+
+        # Argument types
+        self.file.write(
+            "    %s.argtypes = [%s]\n"
+            % (function.py_name(), ", ".join([a.py_string() for a in function.argtypes]))
+        )
+
+        # Return value
+        if function.restype.py_string() == "String":
+            self.file.write(
+                "    if sizeof(c_int) == sizeof(c_void_p):\n"
+                "        {PN}.restype = ReturnString\n"
+                "    else:\n"
+                "        {PN}.restype = {RT}\n"
+                "        {PN}.errcheck = ReturnString\n".format(
+                    PN=function.py_name(), RT=function.restype.py_string()
+                )
+            )
+        else:
+            self.file.write(
+                "    %s.restype = %s\n" % (function.py_name(), function.restype.py_string())
+            )
+            if function.errcheck:
+                self.file.write(
+                    "    %s.errcheck = %s\n" % (function.py_name(), function.errcheck.py_string())
+                )
+
+        if not function.source_library:
+            self.file.write("    break\n")
+
+    def print_variadic_function(self, function):
+        CC = "stdcall" if function.attrib.get("stdcall", False) else "cdecl"
+
+        self.srcinfo(function.src)
+        if function.source_library:
+            self.file.write(
+                'if _libs["{L}"].has("{CN}", "{CC}"):\n'
+                '    _func = _libs["{L}"].get("{CN}", "{CC}")\n'
+                "    _restype = {RT}\n"
+                "    _errcheck = {E}\n"
+                "    _argtypes = [{t0}]\n"
+                "    {PN} = _variadic_function(_func,_restype,_argtypes,_errcheck)\n".format(
+                    L=function.source_library,
+                    CN=function.c_name(),
+                    RT=function.restype.py_string(),
+                    E=function.errcheck.py_string(),
+                    t0=", ".join([a.py_string() for a in function.argtypes]),
+                    PN=function.py_name(),
+                    CC=CC,
+                )
+            )
+        else:
+            self.file.write(
+                "for _lib in _libs.values():\n"
+                '    if _lib.has("{CN}", "{CC}"):\n'
+                '        _func = _lib.get("{CN}", "{CC}")\n'
+                "        _restype = {RT}\n"
+                "        _errcheck = {E}\n"
+                "        _argtypes = [{t0}]\n"
+                "        {PN} = _variadic_function(_func,_restype,_argtypes,_errcheck)\n".format(
+                    CN=function.c_name(),
+                    RT=function.restype.py_string(),
+                    E=function.errcheck.py_string(),
+                    t0=", ".join([a.py_string() for a in function.argtypes]),
+                    PN=function.py_name(),
+                    CC=CC,
+                )
+            )
+
+    def print_variable(self, variable):
+        self.srcinfo(variable.src)
+        if variable.source_library:
+            self.file.write(
+                "try:\n"
+                '    {PN} = ({PS}).in_dll(_libs["{L}"], "{CN}")\n'
+                "except:\n"
+                "    pass\n".format(
+                    PN=variable.py_name(),
+                    PS=variable.ctype.py_string(),
+                    L=variable.source_library,
+                    CN=variable.c_name(),
+                )
+            )
+        else:
+            self.file.write(
+                "for _lib in _libs.values():\n"
+                "    try:\n"
+                '        {PN} = ({PS}).in_dll(_lib, "{CN}")\n'
+                "        break\n"
+                "    except:\n"
+                "        pass\n".format(
+                    PN=variable.py_name(), PS=variable.ctype.py_string(), CN=variable.c_name()
+                )
+            )
+
+    def print_macro(self, macro):
+        if macro.params:
+            self.print_func_macro(macro)
+        else:
+            self.print_simple_macro(macro)
+
+    def print_simple_macro(self, macro):
+        # The macro translator makes heroic efforts but it occasionally fails.
+        # We want to contain the failures as much as possible.
+        # Hence the try statement.
+        self.srcinfo(macro.src)
+        self.file.write(
+            "try:\n"
+            "    {MN} = {ME}\n"
+            "except:\n"
+            "    pass\n".format(MN=macro.name, ME=macro.expr.py_string(True))
+        )
+
+    def print_func_macro(self, macro):
+        self.srcinfo(macro.src)
+        self.file.write(
+            "def {MN}({MP}):\n"
+            "    return {ME}\n".format(
+                MN=macro.name, MP=", ".join(macro.params), ME=macro.expr.py_string(True)
+            )
+        )
+
+    def strip_prefixes(self):
+        if not self.options.strip_prefixes:
+            self.file.write("# No prefix-stripping\n\n")
+            return
+
+        self.file.write(
+            "# Begin prefix-stripping\n"
+            "\n"
+            "# Strip prefixes from all symbols following regular expression:\n"
+            "# {expr}\n"
+            "\n"
+            "import re as __re_module\n"
+            "\n"
+            "__strip_expr = __re_module.compile('{expr}')\n"
+            "for __k, __v in globals().copy().items():\n"
+            "    __m = __strip_expr.match(__k)\n"
+            "    if __m:\n"
+            "        globals()[__k[__m.end():]] = __v\n"
+            "        # remove symbol with prefix(?)\n"
+            "        # globals().pop(__k)\n"
+            "del __re_module, __k, __v, __m, __strip_expr\n"
+            "\n"
+            "# End prefix-stripping\n"
+            "\n".format(expr="({})".format("|".join(self.options.strip_prefixes)))
+        )
+
+    def insert_file(self, filename):
+        try:
+            inserted_file = open(filename, "r")
+        except IOError:
+            error_message('Cannot open file "%s". Skipped it.' % filename, cls="missing-file")
+
+        self.file.write(
+            '# Begin "{filename}"\n'
+            "\n{file}\n"
+            '# End "{filename}"\n'.format(filename=filename, file=inserted_file.read())
+        )
+
+        inserted_file.close()

+ 6 - 0
python/grass/ctypes/ctypesgen/printer_python/test.py

@@ -0,0 +1,6 @@
+"""
+ctypesgen.printer.printer imports this module so that it can find the path
+to defaulttemplate.py and defaultloader.py.
+"""
+
+pass

+ 1 - 1
python/grass/ctypes/ctypesgencore/processor/__init__.py

@@ -1,4 +1,4 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
 This module contains functions to operate on the DeclarationCollection produced
 This module contains functions to operate on the DeclarationCollection produced

+ 46 - 27
python/grass/ctypes/ctypesgencore/processor/dependencies.py

@@ -1,13 +1,13 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
 The dependencies module determines which descriptions depend on which other
 The dependencies module determines which descriptions depend on which other
 descriptions.
 descriptions.
 """
 """
 
 
-from ctypesgencore.ctypedescs import *
-from ctypesgencore.descriptions import *
-from ctypesgencore.messages import *
+from ..descriptions import *
+from ..ctypedescs import *
+from ..messages import *
 
 
 
 
 def find_dependencies(data, opts):
 def find_dependencies(data, opts):
@@ -45,6 +45,22 @@ description."""
         else:
         else:
             return False
             return False
 
 
+    def co_depend(desc, nametable, name):
+        """
+        Try to add `name` as a requirement for `desc`, looking `name` up in
+        `nametable`.  Also try to add desc as a requirement for `name`.
+
+        Returns Description of `name` if found.
+        """
+
+        requirement = nametable.get(name, None)
+        if requirement is None:
+            return
+
+        desc.add_requirements([requirement])
+        requirement.add_requirements([desc])
+        return requirement
+
     def find_dependencies_for(desc, kind):
     def find_dependencies_for(desc, kind):
         """Find all the descriptions that `desc` depends on and add them as
         """Find all the descriptions that `desc` depends on and add them as
 dependencies for `desc`. Also collect error messages regarding `desc` and
 dependencies for `desc`. Also collect error messages regarding `desc` and
@@ -52,23 +68,25 @@ convert unlocateable descriptions into error messages."""
 
 
         if kind == "constant":
         if kind == "constant":
             roots = [desc.value]
             roots = [desc.value]
-        if kind == "struct":
+        elif kind == "struct":
             roots = []
             roots = []
-        if kind == "struct-body":
+        elif kind == "struct-body":
             roots = [desc.ctype]
             roots = [desc.ctype]
-        if kind == "enum":
+        elif kind == "enum":
             roots = []
             roots = []
-        if kind == "typedef":
+        elif kind == "typedef":
             roots = [desc.ctype]
             roots = [desc.ctype]
-        if kind == "function":
+        elif kind == "function":
             roots = desc.argtypes + [desc.restype]
             roots = desc.argtypes + [desc.restype]
-        if kind == "variable":
+        elif kind == "variable":
             roots = [desc.ctype]
             roots = [desc.ctype]
-        if kind == "macro":
+        elif kind == "macro":
             if desc.expr:
             if desc.expr:
                 roots = [desc.expr]
                 roots = [desc.expr]
             else:
             else:
                 roots = []
                 roots = []
+        elif kind == "undef":
+            roots = [desc.macro]
 
 
         cstructs, cenums, ctypedefs, errors, identifiers = [], [], [], [], []
         cstructs, cenums, ctypedefs, errors, identifiers = [], [], [], [], []
 
 
@@ -83,33 +101,37 @@ convert unlocateable descriptions into error messages."""
         unresolvables = []
         unresolvables = []
 
 
         for cstruct in cstructs:
         for cstruct in cstructs:
-            if kind == "struct" and desc.variety == cstruct.variety and \
-                    desc.tag == cstruct.tag:
+            if kind == "struct" and desc.variety == cstruct.variety and desc.tag == cstruct.tag:
                 continue
                 continue
             if not depend(desc, struct_names, (cstruct.variety, cstruct.tag)):
             if not depend(desc, struct_names, (cstruct.variety, cstruct.tag)):
-                unresolvables.append("%s \"%s\"" %
-                                     (cstruct.variety, cstruct.tag))
+                unresolvables.append('%s "%s"' % (cstruct.variety, cstruct.tag))
 
 
         for cenum in cenums:
         for cenum in cenums:
             if kind == "enum" and desc.tag == cenum.tag:
             if kind == "enum" and desc.tag == cenum.tag:
                 continue
                 continue
             if not depend(desc, enum_names, cenum.tag):
             if not depend(desc, enum_names, cenum.tag):
-                unresolvables.append("enum \"%s\"" % cenum.tag)
+                unresolvables.append('enum "%s"' % cenum.tag)
 
 
         for ctypedef in ctypedefs:
         for ctypedef in ctypedefs:
             if not depend(desc, typedef_names, ctypedef):
             if not depend(desc, typedef_names, ctypedef):
-                unresolvables.append("typedef \"%s\"" % ctypedef)
+                unresolvables.append('typedef "%s"' % ctypedef)
 
 
         for ident in identifiers:
         for ident in identifiers:
-            if isinstance(desc, MacroDescription) and \
-                    desc.params and ident in desc.params:
+            if isinstance(desc, MacroDescription) and desc.params and ident in desc.params:
                 continue
                 continue
-            if not depend(desc, ident_names, ident):
-                unresolvables.append("identifier \"%s\"" % ident)
+
+            elif opts.include_undefs and isinstance(desc, UndefDescription):
+                macro_desc = None
+                if ident == desc.macro.name:
+                    macro_desc = co_depend(desc, ident_names, ident)
+                if macro_desc is None or not isinstance(macro_desc, MacroDescription):
+                    unresolvables.append('identifier "%s"' % ident)
+
+            elif not depend(desc, ident_names, ident):
+                unresolvables.append('identifier "%s"' % ident)
 
 
         for u in unresolvables:
         for u in unresolvables:
-            errors.append(("%s depends on an unknown %s." %
-                           (desc.casual_name(), u), None))
+            errors.append(("%s depends on an unknown %s." % (desc.casual_name(), u), None))
 
 
         for err, cls in errors:
         for err, cls in errors:
             err += " %s will not be output" % desc.casual_name()
             err += " %s will not be output" % desc.casual_name()
@@ -136,13 +158,10 @@ it can find it."""
     # no other type of description can look ahead like that.
     # no other type of description can look ahead like that.
 
 
     for kind, desc in data.output_order:
     for kind, desc in data.output_order:
+        add_to_lookup_table(desc, kind)
         if kind != "macro":
         if kind != "macro":
             find_dependencies_for(desc, kind)
             find_dependencies_for(desc, kind)
-            add_to_lookup_table(desc, kind)
 
 
     for kind, desc in data.output_order:
     for kind, desc in data.output_order:
         if kind == "macro":
         if kind == "macro":
-            add_to_lookup_table(desc, kind)
-    for kind, desc in data.output_order:
-        if kind == "macro":
             find_dependencies_for(desc, kind)
             find_dependencies_for(desc, kind)

+ 119 - 61
python/grass/ctypes/ctypesgencore/processor/operations.py

@@ -1,21 +1,15 @@
-#!/usr/bin/env python3
+#!/usr/bin/env python
 
 
 """
 """
 The operations module contains various functions to process the
 The operations module contains various functions to process the
 DescriptionCollection and prepare it for output.
 DescriptionCollection and prepare it for output.
-ctypesgencore.processor.pipeline calls the operations module.
+ctypesgen.processor.pipeline calls the operations module.
 """
 """
 
 
-import keyword
-import os
-import re
-import sys
-
-import ctypes
-import ctypesgencore.libraryloader
-from ctypesgencore.descriptions import *
-from ctypesgencore.messages import *
-
+import ctypes, re, os, sys, keyword
+from ..descriptions import *
+from ..messages import *
+from .. import libraryloader
 
 
 # Processor functions
 # Processor functions
 
 
@@ -27,9 +21,7 @@ def automatically_typedef_structs(data, options):
 
 
     for struct in data.structs:
     for struct in data.structs:
         if not struct.ctype.anonymous:  # Don't alias anonymous structs
         if not struct.ctype.anonymous:  # Don't alias anonymous structs
-            typedef = TypedefDescription(struct.tag,
-                                         struct.ctype,
-                                         src=struct.src)
+            typedef = TypedefDescription(struct.tag, struct.ctype, src=struct.src)
             typedef.add_requirements(set([struct]))
             typedef.add_requirements(set([struct]))
 
 
             data.typedefs.append(typedef)
             data.typedefs.append(typedef)
@@ -53,7 +45,7 @@ def remove_descriptions_in_system_headers(data, opts):
     known_headers = [os.path.basename(x) for x in opts.headers]
     known_headers = [os.path.basename(x) for x in opts.headers]
 
 
     for description in data.all:
     for description in data.all:
-        if description.src is not None:
+        if description.src != None:
             if description.src[0] == "<command line>":
             if description.src[0] == "<command line>":
                 description.include_rule = "if_needed"
                 description.include_rule = "if_needed"
             elif description.src[0] == "<built-in>":
             elif description.src[0] == "<built-in>":
@@ -77,7 +69,7 @@ def filter_by_regexes_exclude(data, opts):
     """filter_by_regexes_exclude() uses regular expressions specified by options
     """filter_by_regexes_exclude() uses regular expressions specified by options
     dictionary to filter symbols."""
     dictionary to filter symbols."""
     if opts.exclude_symbols:
     if opts.exclude_symbols:
-        expr = re.compile(opts.exclude_symbols)
+        expr = re.compile("({})".format("|".join(opts.exclude_symbols)))
         for object in data.all:
         for object in data.all:
             if expr.match(object.py_name()):
             if expr.match(object.py_name()):
                 object.include_rule = "never"
                 object.include_rule = "never"
@@ -87,7 +79,7 @@ def filter_by_regexes_include(data, opts):
     """filter_by_regexes_include() uses regular expressions specified by options
     """filter_by_regexes_include() uses regular expressions specified by options
     dictionary to re-include symbols previously rejected by other operations."""
     dictionary to re-include symbols previously rejected by other operations."""
     if opts.include_symbols:
     if opts.include_symbols:
-        expr = re.compile(opts.include_symbols)
+        expr = re.compile("({})".format("|".join(opts.include_symbols)))
         for object in data.all:
         for object in data.all:
             if object.include_rule != "never":
             if object.include_rule != "never":
                 if expr.match(object.py_name()):
                 if expr.match(object.py_name()):
@@ -100,8 +92,15 @@ def fix_conflicting_names(data, opts):
     the name conflict."""
     the name conflict."""
 
 
     # This is the order of priority for names
     # This is the order of priority for names
-    descriptions = data.functions + data.variables + data.structs + \
-        data.typedefs + data.enums + data.constants + data.macros
+    descriptions = (
+        data.functions
+        + data.variables
+        + data.structs
+        + data.typedefs
+        + data.enums
+        + data.constants
+        + data.macros
+    )
 
 
     # This dictionary maps names to a string representing where the name
     # This dictionary maps names to a string representing where the name
     # came from.
     # came from.
@@ -109,17 +108,72 @@ def fix_conflicting_names(data, opts):
 
 
     preamble_names = set()
     preamble_names = set()
     preamble_names = preamble_names.union(
     preamble_names = preamble_names.union(
-        ['DarwinLibraryLoader', 'LibraryLoader', 'LinuxLibraryLoader', 'WindowsLibraryLoader',
-         '_WindowsLibrary', 'add_library_search_dirs', '_environ_path', 'ctypes', 'load_library',
-         'loader', 'os', 're', 'sys'])
+        [
+            "DarwinLibraryLoader",
+            "LibraryLoader",
+            "LinuxLibraryLoader",
+            "WindowsLibraryLoader",
+            "_WindowsLibrary",
+            "add_library_search_dirs",
+            "_environ_path",
+            "ctypes",
+            "load_library",
+            "loader",
+            "os",
+            "re",
+            "sys",
+        ]
+    )
     preamble_names = preamble_names.union(
     preamble_names = preamble_names.union(
-        ['ArgumentError', 'CFUNCTYPE', 'POINTER', 'ReturnString', 'String', 'Structure',
-         'UNCHECKED', 'Union', 'UserString', '_variadic_function', 'addressof', 'c_buffer',
-         'c_byte', 'c_char', 'c_char_p', 'c_double', 'c_float', 'c_int', 'c_int16', 'c_int32',
-         'c_int64', 'c_int8', 'c_long', 'c_longlong', 'c_ptrdiff_t', 'c_short', 'c_size_t',
-         'c_ubyte', 'c_uint', 'c_uint16', 'c_uint32', 'c_uint64', 'c_uint8', 'c_ulong',
-         'c_ulonglong', 'c_ushort', 'c_void', 'c_void_p', 'c_voidp', 'c_wchar', 'c_wchar_p', 'cast',
-         'ctypes', 'os', 'pointer', 'sizeof'])
+        [
+            "ArgumentError",
+            "CFUNCTYPE",
+            "POINTER",
+            "ReturnString",
+            "String",
+            "Structure",
+            "UNCHECKED",
+            "Union",
+            "UserString",
+            "_variadic_function",
+            "addressof",
+            "c_buffer",
+            "c_byte",
+            "c_char",
+            "c_char_p",
+            "c_double",
+            "c_float",
+            "c_int",
+            "c_int16",
+            "c_int32",
+            "c_int64",
+            "c_int8",
+            "c_long",
+            "c_longlong",
+            "c_ptrdiff_t",
+            "c_short",
+            "c_size_t",
+            "c_ubyte",
+            "c_uint",
+            "c_uint16",
+            "c_uint32",
+            "c_uint64",
+            "c_uint8",
+            "c_ulong",
+            "c_ulonglong",
+            "c_ushort",
+            "c_void",
+            "c_void_p",
+            "c_voidp",
+            "c_wchar",
+            "c_wchar_p",
+            "cast",
+            "ctypes",
+            "os",
+            "pointer",
+            "sizeof",
+        ]
+    )
     for name in preamble_names:
     for name in preamble_names:
         important_names[name] = "a name needed by ctypes or ctypesgen"
         important_names[name] = "a name needed by ctypes or ctypesgen"
     for name in dir(__builtins__):
     for name in dir(__builtins__):
@@ -135,33 +189,31 @@ def fix_conflicting_names(data, opts):
 
 
             original_name = description.casual_name()
             original_name = description.casual_name()
             while description.py_name() in important_names:
             while description.py_name() in important_names:
-                if isinstance(description,
-                              (StructDescription, EnumDescription)):
+                if isinstance(description, (StructDescription, EnumDescription)):
                     description.tag += "_"
                     description.tag += "_"
                 else:
                 else:
                     description.name = "_" + description.name
                     description.name = "_" + description.name
 
 
             if not description.dependents:
             if not description.dependents:
-                description.warning("%s has been renamed to %s due to a name "
-                                    "conflict with %s." %
-                                    (original_name,
-                                     description.casual_name(),
-                                     conflict_name),
-                                    cls='rename')
+                description.warning(
+                    "%s has been renamed to %s due to a name "
+                    "conflict with %s." % (original_name, description.casual_name(), conflict_name),
+                    cls="rename",
+                )
             else:
             else:
-                description.warning("%s has been renamed to %s due to a name "
-                                    "conflict with %s. Other objects depend on %s - those "
-                                    "objects will be skipped." %
-                                    (original_name, description.casual_name(),
-                                     conflict_name, original_name),
-                                    cls='rename')
+                description.warning(
+                    "%s has been renamed to %s due to a name "
+                    "conflict with %s. Other objects depend on %s - those "
+                    "objects will be skipped."
+                    % (original_name, description.casual_name(), conflict_name, original_name),
+                    cls="rename",
+                )
 
 
                 for dependent in description.dependents:
                 for dependent in description.dependents:
                     dependent.include_rule = "never"
                     dependent.include_rule = "never"
 
 
             if description.include_rule == "yes":
             if description.include_rule == "yes":
-                important_names[description.py_name()] = \
-                    description.casual_name()
+                important_names[description.py_name()] = description.casual_name()
 
 
     # Names of struct members don't conflict with much, but they can conflict
     # Names of struct members don't conflict with much, but they can conflict
     # with Python keywords.
     # with Python keywords.
@@ -171,10 +223,12 @@ def fix_conflicting_names(data, opts):
             for i, (name, type) in enumerate(struct.members):
             for i, (name, type) in enumerate(struct.members):
                 if name in keyword.kwlist:
                 if name in keyword.kwlist:
                     struct.members[i] = ("_" + name, type)
                     struct.members[i] = ("_" + name, type)
-                    struct.warning("Member \"%s\" of %s has been renamed to "
-                                   "\"%s\" because it has the same name as a Python "
-                                   "keyword." % (name, struct.casual_name(), "_" + name),
-                                   cls='rename')
+                    struct.warning(
+                        'Member "%s" of %s has been renamed to '
+                        '"%s" because it has the same name as a Python '
+                        "keyword." % (name, struct.casual_name(), "_" + name),
+                        cls="rename",
+                    )
 
 
     # Macro arguments may be have names that conflict with Python keywords.
     # Macro arguments may be have names that conflict with Python keywords.
     # In a perfect world, this would simply rename the parameter instead
     # In a perfect world, this would simply rename the parameter instead
@@ -184,10 +238,12 @@ def fix_conflicting_names(data, opts):
         if macro.params:
         if macro.params:
             for param in macro.params:
             for param in macro.params:
                 if param in keyword.kwlist:
                 if param in keyword.kwlist:
-                    macro.error("One of the parameters to %s, \"%s\" has the "
-                                "same name as a Python keyword. %s will be skipped." %
-                                (macro.casual_name(), param, macro.casual_name()),
-                                cls='name-conflict')
+                    macro.error(
+                        'One of the parameters to %s, "%s" has the '
+                        "same name as a Python keyword. %s will be skipped."
+                        % (macro.casual_name(), param, macro.casual_name()),
+                        cls="name-conflict",
+                    )
 
 
 
 
 def find_source_libraries(data, opts):
 def find_source_libraries(data, opts):
@@ -199,17 +255,19 @@ def find_source_libraries(data, opts):
     for symbol in all_symbols:
     for symbol in all_symbols:
         symbol.source_library = None
         symbol.source_library = None
 
 
-    ctypesgencore.libraryloader.add_library_search_dirs(opts.compile_libdirs)
+    libraryloader.add_library_search_dirs(opts.compile_libdirs)
 
 
     for library_name in opts.libraries:
     for library_name in opts.libraries:
         try:
         try:
-            library = ctypesgencore.libraryloader.load_library(library_name)
-        except (ImportError,OSError) as e:
-            warning_message("Could not load library \"%s\". Okay, I'll "
-                            "try to load it at runtime instead. " % (library_name),
-                            cls='missing-library')
+            library = libraryloader.load_library(library_name)
+        except ImportError as e:
+            warning_message(
+                'Could not load library "%s". Okay, I\'ll '
+                "try to load it at runtime instead. " % (library_name),
+                cls="missing-library",
+            )
             continue
             continue
         for symbol in all_symbols:
         for symbol in all_symbols:
-            if symbol.source_library is None:
+            if symbol.source_library == None:
                 if hasattr(library, symbol.c_name()):
                 if hasattr(library, symbol.c_name()):
                     symbol.source_library = library_name
                     symbol.source_library = library_name

+ 16 - 18
python/grass/ctypes/ctypesgencore/processor/pipeline.py

@@ -1,14 +1,10 @@
-#!/usr/bin/env python3
-
-import os
-import re
-
-import ctypes
-from ctypesgencore.ctypedescs import *
-from ctypesgencore.messages import *
-from ctypesgencore.processor.dependencies import find_dependencies
-from ctypesgencore.processor.operations import *
+#!/usr/bin/env python
 
 
+import ctypes, re, os
+from ..ctypedescs import *
+from ..messages import *
+from .operations import *
+from .dependencies import find_dependencies
 
 
 """
 """
 A brief explanation of the processing steps:
 A brief explanation of the processing steps:
@@ -76,7 +72,7 @@ def calculate_final_inclusion(data, opts):
     """
     """
 
 
     def can_include_desc(desc):
     def can_include_desc(desc):
-        if desc.can_include is None:
+        if desc.can_include == None:
             if desc.include_rule == "no":
             if desc.include_rule == "no":
                 desc.can_include = False
                 desc.can_include = False
             elif desc.include_rule == "yes" or desc.include_rule == "if_needed":
             elif desc.include_rule == "yes" or desc.include_rule == "if_needed":
@@ -106,7 +102,7 @@ def calculate_final_inclusion(data, opts):
 def print_errors_encountered(data, opts):
 def print_errors_encountered(data, opts):
     # See descriptions.py for an explanation of the error-handling mechanism
     # See descriptions.py for an explanation of the error-handling mechanism
     for desc in data.all:
     for desc in data.all:
-        # If description would not have been included, don't bother user by
+        # If description would not have been included, dont bother user by
         # printing warnings.
         # printing warnings.
         if desc.included or opts.show_all_errors:
         if desc.included or opts.show_all_errors:
             if opts.show_long_errors or len(desc.errors) + len(desc.warnings) <= 2:
             if opts.show_long_errors or len(desc.errors) + len(desc.warnings) <= 2:
@@ -127,16 +123,18 @@ def print_errors_encountered(data, opts):
                     numerrs = len(desc.errors) - 1
                     numerrs = len(desc.errors) - 1
                     numwarns = len(desc.warnings)
                     numwarns = len(desc.warnings)
                     if numwarns:
                     if numwarns:
-                        error_message("%d more errors and %d more warnings "
-                                      "for %s" % (numerrs, numwarns, desc.casual_name()))
+                        error_message(
+                            "%d more errors and %d more warnings "
+                            "for %s" % (numerrs, numwarns, desc.casual_name())
+                        )
                     else:
                     else:
-                        error_message("%d more errors for %s " %
-                                      (numerrs, desc.casual_name()))
+                        error_message("%d more errors for %s " % (numerrs, desc.casual_name()))
                 else:
                 else:
                     warning1, cls1 = desc.warnings[0]
                     warning1, cls1 = desc.warnings[0]
                     warning_message(warning1, cls1)
                     warning_message(warning1, cls1)
-                    warning_message("%d more errors for %s" %
-                                    (len(desc.warnings) - 1, desc.casual_name()))
+                    warning_message(
+                        "%d more errors for %s" % (len(desc.warnings) - 1, desc.casual_name())
+                    )
         if desc.errors:
         if desc.errors:
             # process() will recalculate to take this into account
             # process() will recalculate to take this into account
             desc.include_rule = "never"
             desc.include_rule = "never"

+ 2 - 0
python/grass/ctypes/ctypesgen/test/.gitignore

@@ -0,0 +1,2 @@
+temp.h
+temp.py

+ 88 - 0
python/grass/ctypes/ctypesgen/test/ctypesgentest.py

@@ -0,0 +1,88 @@
+# -*- coding: ascii -*-
+# vim:ts=4:sw=4:softtabstop=4:smarttab:expandtab
+import os
+import sys
+import io
+import optparse
+import glob
+import json
+
+try:
+    # should succeed for py3
+    from importlib import reload as reload_module
+except:
+    reload_module = reload
+
+# ensure that we can load the ctypesgen library
+PACKAGE_DIR = os.path.join(os.path.dirname(__file__), os.path.pardir, os.path.pardir)
+sys.path.insert(0, PACKAGE_DIR)
+import ctypesgen
+
+"""ctypesgentest is a simple module for testing ctypesgen on various C constructs. It consists of a
+single function, test(). test() takes a string that represents a C header file, along with some
+keyword arguments representing options. It processes the header using ctypesgen and returns a tuple
+containing the resulting module object and the output that ctypesgen produced."""
+
+# set redirect_stdout to False if using console based debugger like pdb
+redirect_stdout = True
+
+
+def test(header, **more_options):
+
+    assert isinstance(header, str)
+    with open("temp.h", "w") as f:
+        f.write(header)
+
+    options = ctypesgen.options.get_default_options()
+    options.headers = ["temp.h"]
+    for opt, val in more_options.items():
+        setattr(options, opt, val)
+
+    if redirect_stdout:
+        # Redirect output
+        sys.stdout = io.StringIO()
+
+    # Step 1: Parse
+    descriptions = ctypesgen.parser.parse(options.headers, options)
+
+    # Step 2: Process
+    ctypesgen.processor.process(descriptions, options)
+
+    # Step 3: Print
+    printer = None
+    if options.output_language.startswith("py"):
+        ctypesgen.printer_python.WrapperPrinter("temp.py", options, descriptions)
+
+        # Load the module we have just produced
+        module = __import__("temp")
+        # import twice, this hack ensure that "temp" is force loaded
+        # (there *must* be a better way to do this)
+        reload_module(module)
+        retval = module
+
+    elif options.output_language == "json":
+        # for ease and consistency with test results, we are going to cheat by
+        # resetting the anonymous tag number
+        ctypesgen.ctypedescs.last_tagnum = 0
+        ctypesgen.printer_json.WrapperPrinter("temp.json", options, descriptions)
+        with open("temp.json") as f:
+            JSON = json.load(f)
+        retval = JSON
+    else:
+        raise RuntimeError("No such output language `" + options.output_language + "'")
+
+    if redirect_stdout:
+        # Un-redirect output
+        output = sys.stdout.getvalue()
+        sys.stdout.close()
+        sys.stdout = sys.__stdout__
+    else:
+        output = ""
+
+    return retval, output
+
+
+def cleanup(filepattern="temp.*"):
+    fnames = glob.glob(filepattern)
+    for fname in fnames:
+        os.unlink(fname)

A diferenza do arquivo foi suprimida porque é demasiado grande
+ 2352 - 0
python/grass/ctypes/ctypesgen/test/testsuite.py


+ 89 - 0
python/grass/ctypes/ctypesgen/version.py

@@ -0,0 +1,89 @@
+#!/usr/bin/env python3
+# vim: ts=2:sw=2:tw=80:nowrap
+
+from subprocess import Popen, PIPE
+import os
+from os import path
+
+THIS_DIR = path.dirname(__file__)
+VERSION_FILE = path.join(THIS_DIR, "VERSION")
+DEFAULT_PREFIX = "ctypesgen"
+
+__all__ = ["VERSION", "version_tuple", "version", "compatible"]
+
+
+def version_tuple(v):
+    try:
+        vs = v.split("-")
+        t = tuple(int(i) for i in vs[1].split("."))
+        if len(vs) > 2:
+            t += (int(vs[2]),)
+        return t
+    except:
+        return (-1, -1, -1, v)
+
+
+def read_file_version():
+    f = open(VERSION_FILE)
+    v = f.readline()
+    f.close()
+    return v.strip()
+
+
+def version():
+    try:
+        args = {"cwd": THIS_DIR}
+        devnull = open(os.devnull, "w")
+        p = Popen(["git", "describe"], stdout=PIPE, stderr=devnull, **args)
+        out, err = p.communicate()
+        if p.returncode:
+            raise RuntimeError("no version defined?")
+        return out.strip().decode()
+    except:
+        # failover is to try VERSION_FILE instead
+        try:
+            return read_file_version()
+        except:
+            return DEFAULT_PREFIX + "-0.0.0"
+
+
+def version_number():
+    return version().partition("-")[-1]
+
+
+def compatible(v0, v1):
+    v0 = version_tuple(v0)
+    v1 = version_tuple(v1)
+    return v0[:2] == v1[:2]
+
+
+def write_version_file(v=None):
+    if v is None:
+        v = version()
+    f = open(VERSION_FILE, "w")
+    f.write(v)
+    f.close()
+
+
+VERSION = version()
+VERSION_NUMBER = version_number()
+
+
+if __name__ == "__main__":
+    import sys, argparse
+
+    p = argparse.ArgumentParser()
+    p.add_argument("--save", action="store_true", help="Store version to " + VERSION_FILE)
+    p.add_argument(
+        "--read-file-version",
+        action="store_true",
+        help="Read the version stored in " + VERSION_FILE,
+    )
+    args = p.parse_args()
+
+    v = version()
+    if args.save:
+        write_version_file(v)
+    if args.read_file_version:
+        v = read_file_version()
+    print(v)

+ 0 - 319
python/grass/ctypes/ctypesgencore/libraryloader.py

@@ -1,319 +0,0 @@
-# ----------------------------------------------------------------------------
-# Copyright (c) 2008 David James
-# Copyright (c) 2006-2008 Alex Holkner
-# All rights reserved.
-#
-# Redistribution and use in source and binary forms, with or without
-# modification, are permitted provided that the following conditions
-# are met:
-#
-#  * Redistributions of source code must retain the above copyright
-#    notice, this list of conditions and the following disclaimer.
-#  * Redistributions in binary form must reproduce the above copyright
-#    notice, this list of conditions and the following disclaimer in
-#    the documentation and/or other materials provided with the
-#    distribution.
-#  * Neither the name of pyglet nor the names of its
-#    contributors may be used to endorse or promote products
-#    derived from this software without specific prior written
-#    permission.
-#
-# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
-# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
-# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
-# FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
-# COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
-# INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
-# BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
-# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
-# CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
-# LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN
-# ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
-# POSSIBILITY OF SUCH DAMAGE.
-# ----------------------------------------------------------------------------
-
-import glob
-import os.path
-import re
-import sys
-import platform
-
-import ctypes
-import ctypes.util
-
-
-def _environ_path(name):
-    if name in os.environ:
-        return os.environ[name].split(":")
-    else:
-        return []
-
-
-class LibraryLoader(object):
-
-    def __init__(self):
-        self.other_dirs = []
-
-    def load_library(self, libname):
-        """Given the name of a library, load it."""
-        paths = self.getpaths(libname)
-
-        for path in paths:
-            if os.path.exists(path):
-                return self.load(path)
-
-        raise ImportError("%s not found." % libname)
-
-    def load(self, path):
-        """Given a path to a library, load it."""
-        try:
-            # Darwin requires dlopen to be called with mode RTLD_GLOBAL instead
-            # of the default RTLD_LOCAL.  Without this, you end up with
-            # libraries not being loadable, resulting in "Symbol not found"
-            # errors
-            if sys.platform == 'darwin':
-                return ctypes.CDLL(path, ctypes.RTLD_GLOBAL)
-            else:
-                return ctypes.cdll.LoadLibrary(path)
-        except OSError as e:
-            raise ImportError(e)
-
-    def getpaths(self, libname):
-        """Return a list of paths where the library might be found."""
-        if os.path.isabs(libname):
-            yield libname
-
-        else:
-            for path in self.getplatformpaths(libname):
-                yield path
-
-            path = ctypes.util.find_library(libname)
-            if path:
-                yield path
-
-    def getplatformpaths(self, libname):
-        return []
-
-# Darwin (Mac OS X)
-
-
-class DarwinLibraryLoader(LibraryLoader):
-    name_formats = ["lib%s.dylib", "lib%s.so", "lib%s.bundle", "%s.dylib",
-                    "%s.so", "%s.bundle", "%s"]
-
-    def getplatformpaths(self, libname):
-        if os.path.pathsep in libname:
-            names = [libname]
-        else:
-            names = [format % libname for format in self.name_formats]
-
-        for dir in self.getdirs(libname):
-            for name in names:
-                yield os.path.join(dir, name)
-
-    def getdirs(self, libname):
-        '''Implements the dylib search as specified in Apple documentation:
-
-        http://developer.apple.com/documentation/DeveloperTools/Conceptual/
-            DynamicLibraries/Articles/DynamicLibraryUsageGuidelines.html
-
-        Before commencing the standard search, the method first checks
-        the bundle's ``Frameworks`` directory if the application is running
-        within a bundle (OS X .app).
-        '''
-
-        dyld_fallback_library_path = _environ_path("DYLD_FALLBACK_LIBRARY_PATH")
-        if not dyld_fallback_library_path:
-            dyld_fallback_library_path = [os.path.expanduser('~/lib'),
-                                          '/usr/local/lib', '/usr/lib']
-
-        dirs = []
-
-        if '/' in libname:
-            dirs.extend(_environ_path("DYLD_LIBRARY_PATH"))
-        else:
-            dirs.extend(_environ_path("LD_LIBRARY_PATH"))
-            dirs.extend(_environ_path("DYLD_LIBRARY_PATH"))
-
-        dirs.extend(self.other_dirs)
-        dirs.append(".")
-        dirs.append(os.path.dirname(__file__))
-
-        if hasattr(sys, 'frozen') and sys.frozen == 'macosx_app':
-            dirs.append(os.path.join(
-                os.environ['RESOURCEPATH'],
-                '..',
-                'Frameworks'))
-
-        dirs.extend(dyld_fallback_library_path)
-
-        return dirs
-
-# Posix
-
-
-class PosixLibraryLoader(LibraryLoader):
-    _ld_so_cache = None
-
-    def _create_ld_so_cache(self):
-        # Recreate search path followed by ld.so.  This is going to be
-        # slow to build, and incorrect (ld.so uses ld.so.cache, which may
-        # not be up-to-date).  Used only as fallback for distros without
-        # /sbin/ldconfig.
-        #
-        # We assume the DT_RPATH and DT_RUNPATH binary sections are omitted.
-
-        directories = []
-        for name in ("LD_LIBRARY_PATH",
-                     "SHLIB_PATH",  # HPUX
-                     "LIBPATH",  # OS/2, AIX
-                     "LIBRARY_PATH",  # BE/OS
-                     ):
-            if name in os.environ:
-                directories.extend(os.environ[name].split(os.pathsep))
-        directories.extend(self.other_dirs)
-        directories.append(".")
-        directories.append(os.path.dirname(__file__))
-
-        try:
-            directories.extend([dir.strip() for dir in open('/etc/ld.so.conf')])
-        except IOError:
-            pass
-
-        unix_lib_dirs_list = ['/lib', '/usr/lib', '/lib64', '/usr/lib64']
-        if sys.platform.startswith('linux'):
-            # Try and support multiarch work in Ubuntu
-            # https://wiki.ubuntu.com/MultiarchSpec
-            bitage = platform.architecture()[0]
-            if bitage.startswith('32'):
-                # Assume Intel/AMD x86 compat
-                unix_lib_dirs_list += ['/lib/i386-linux-gnu', '/usr/lib/i386-linux-gnu']
-            elif bitage.startswith('64'):
-                # Assume Intel/AMD x86 compat
-                unix_lib_dirs_list += ['/lib/x86_64-linux-gnu', '/usr/lib/x86_64-linux-gnu']
-            else:
-                # guess...
-                unix_lib_dirs_list += glob.glob('/lib/*linux-gnu')
-        directories.extend(unix_lib_dirs_list)
-
-        cache = {}
-        lib_re = re.compile(r'lib(.*)\.s[ol]')
-        ext_re = re.compile(r'\.s[ol]$')
-        for dir in directories:
-            try:
-                for path in glob.glob("%s/*.s[ol]*" % dir):
-                    file = os.path.basename(path)
-
-                    # Index by filename
-                    if file not in cache:
-                        cache[file] = path
-
-                    # Index by library name
-                    match = lib_re.match(file)
-                    if match:
-                        library = match.group(1)
-                        if library not in cache:
-                            cache[library] = path
-            except OSError:
-                pass
-
-        self._ld_so_cache = cache
-
-    def getplatformpaths(self, libname):
-        if self._ld_so_cache is None:
-            self._create_ld_so_cache()
-
-        result = self._ld_so_cache.get(libname)
-        if result:
-            yield result
-
-        path = ctypes.util.find_library(libname)
-        if path:
-            yield os.path.join("/lib", path)
-
-# Windows
-
-
-class _WindowsLibrary(object):
-
-    def __init__(self, path):
-        self.cdll = ctypes.cdll.LoadLibrary(path)
-        self.windll = ctypes.windll.LoadLibrary(path)
-
-    def __getattr__(self, name):
-        try:
-            return getattr(self.cdll, name)
-        except AttributeError:
-            try:
-                return getattr(self.windll, name)
-            except AttributeError:
-                raise
-
-
-class WindowsLibraryLoader(LibraryLoader):
-    name_formats = ["%s.dll", "lib%s.dll"]
-
-    def load_library(self, libname):
-        try:
-            result = LibraryLoader.load_library(self, libname)
-        except ImportError:
-            result = None
-            if os.path.sep not in libname:
-                for name in self.name_formats:
-                    try:
-                        result = getattr(ctypes.cdll, name % libname)
-                        if result:
-                            break
-                    except WindowsError:
-                        result = None
-            if result is None:
-                try:
-                    result = getattr(ctypes.cdll, libname)
-                except WindowsError:
-                    result = None
-            if result is None:
-                raise ImportError("%s not found." % libname)
-        return result
-
-    def load(self, path):
-        return _WindowsLibrary(path)
-
-    def getplatformpaths(self, libname):
-        if os.path.sep not in libname:
-            for name in self.name_formats:
-                dll_in_current_dir = os.path.abspath(name % libname)
-                if os.path.exists(dll_in_current_dir):
-                    yield dll_in_current_dir
-                path = ctypes.util.find_library(name % libname)
-                if path:
-                    yield path
-
-# Platform switching
-
-# If your value of sys.platform does not appear in this dict, please contact
-# the Ctypesgen maintainers.
-
-loaderclass = {
-    "darwin": DarwinLibraryLoader,
-    "cygwin": WindowsLibraryLoader,
-    "win32": WindowsLibraryLoader
-}
-
-loader = loaderclass.get(sys.platform, PosixLibraryLoader)()
-
-
-def add_library_search_dirs(other_dirs):
-    """
-    Add libraries to search paths.
-    If library paths are relative, convert them to absolute with respect to this
-    file's directory
-    """
-    THIS_DIR = os.path.dirname(__file__)
-    for F in other_dirs:
-        if not os.path.isabs(F):
-            F = os.path.abspath(os.path.join(THIS_DIR, F))
-        loader.other_dirs.append(F)
-
-load_library = loader.load_library
-
-del loaderclass

+ 0 - 198
python/grass/ctypes/ctypesgencore/parser/cdeclarations.py

@@ -1,198 +0,0 @@
-#!/usr/bin/env python3
-
-'''
-This file contains classes that represent C declarations. cparser produces
-declarations in this format, and ctypesparser reformats them into a format that
-is not C-specific. The other modules don't need to touch these.
-'''
-
-__docformat__ = 'restructuredtext'
-
-# --------------------------------------------------------------------------
-# C Object Model
-# --------------------------------------------------------------------------
-
-
-class Declaration(object):
-
-    def __init__(self):
-        self.declarator = None
-        self.type = Type()
-        self.storage = None
-
-    def __repr__(self):
-        d = {
-            'declarator': self.declarator,
-            'type': self.type,
-        }
-        if self.storage:
-            d['storage'] = self.storage
-        l = ['%s=%r' % (k, v) for k, v in d.items()]
-        return 'Declaration(%s)' % ', '.join(l)
-
-
-class Declarator(object):
-    pointer = None
-
-    def __init__(self):
-        self.identifier = None
-        self.initializer = None
-        self.array = None
-        self.parameters = None
-        self.bitfield = None
-
-    # make pointer read-only to catch mistakes early
-    pointer = property(lambda self: None)
-
-    def __repr__(self):
-        s = self.identifier or ''
-        if self.bitfield:
-            s += ":%d" % self.bitfield
-        if self.array:
-            s += repr(self.array)
-        if self.initializer:
-            s += ' = %r' % self.initializer
-        if self.parameters is not None:
-            s += '(' + ', '.join([repr(p) for p in self.parameters]) + ')'
-        return s
-
-
-class Pointer(Declarator):
-    pointer = None
-
-    def __init__(self):
-        super(Pointer, self).__init__()
-        self.qualifiers = []
-
-    def __repr__(self):
-        q = ''
-        if self.qualifiers:
-            q = '<%s>' % ' '.join(self.qualifiers)
-        return 'POINTER%s(%r)' % (q, self.pointer) + \
-            super(Pointer, self).__repr__()
-
-
-class Array(object):
-
-    def __init__(self):
-        self.size = None
-        self.array = None
-
-    def __repr__(self):
-        if self.size:
-            a = '[%r]' % self.size
-        else:
-            a = '[]'
-        if self.array:
-            return repr(self.array) + a
-        else:
-            return a
-
-
-class Parameter(object):
-
-    def __init__(self):
-        self.type = Type()
-        self.storage = None
-        self.declarator = None
-
-    def __repr__(self):
-        d = {
-            'type': self.type,
-        }
-        if self.declarator:
-            d['declarator'] = self.declarator
-        if self.storage:
-            d['storage'] = self.storage
-        l = ['%s=%r' % (k, v) for k, v in d.items()]
-        return 'Parameter(%s)' % ', '.join(l)
-
-
-class Type(object):
-
-    def __init__(self):
-        self.qualifiers = []
-        self.specifiers = []
-
-    def __repr__(self):
-        return ' '.join(self.qualifiers + [str(s) for s in self.specifiers])
-
-# These are used only internally.
-
-
-class StorageClassSpecifier(str):
-    pass
-
-
-class TypeSpecifier(str):
-    pass
-
-
-class StructTypeSpecifier(object):
-
-    def __init__(self, is_union, is_packed, tag, declarations):
-        self.is_union = is_union
-        self.is_packed = is_packed
-        self.tag = tag
-        self.declarations = declarations
-
-    def __repr__(self):
-        if self.is_union:
-            s = 'union'
-        else:
-            s = 'struct'
-        if self.is_packed:
-            s += ' __attribute__((packed))'
-        if self.tag:
-            s += ' %s' % self.tag
-        if self.declarations:
-            s += ' {%s}' % '; '.join([repr(d) for d in self.declarations])
-        return s
-
-
-class EnumSpecifier(object):
-
-    def __init__(self, tag, enumerators, src=None):
-        self.tag = tag
-        self.enumerators = enumerators
-        self.src = src
-
-    def __repr__(self):
-        s = 'enum'
-        if self.tag:
-            s += ' %s' % self.tag
-        if self.enumerators:
-            s += ' {%s}' % ', '.join([repr(e) for e in self.enumerators])
-        return s
-
-
-class Enumerator(object):
-
-    def __init__(self, name, expression):
-        self.name = name
-        self.expression = expression
-
-    def __repr__(self):
-        s = self.name
-        if self.expression:
-            s += ' = %r' % self.expression
-        return s
-
-
-class TypeQualifier(str):
-    pass
-
-
-def apply_specifiers(specifiers, declaration):
-    '''Apply specifiers to the declaration (declaration may be
-    a Parameter instead).'''
-    for s in specifiers:
-        if isinstance(s, StorageClassSpecifier):
-            if declaration.storage:
-                # Multiple storage classes, technically an error... ignore it
-                pass
-            declaration.storage = s
-        elif type(s) in (TypeSpecifier, StructTypeSpecifier, EnumSpecifier):
-            declaration.type.specifiers.append(s)
-        elif isinstance(s, TypeQualifier):
-            declaration.type.qualifiers.append(s)

A diferenza do arquivo foi suprimida porque é demasiado grande
+ 0 - 282
python/grass/ctypes/ctypesgencore/parser/parsetab.py


+ 0 - 346
python/grass/ctypes/ctypesgencore/parser/pplexer.py

@@ -1,346 +0,0 @@
-#!/usr/bin/env python3
-
-'''Preprocess a C source file using gcc and convert the result into
-   a token stream
-
-Reference is C99:
-  * http://www.open-std.org/JTC1/SC22/WG14/www/docs/n1124.pdf
-
-'''
-
-__docformat__ = 'restructuredtext'
-
-import os
-import re
-import shlex
-import sys
-import tokenize
-import traceback
-
-import ctypes
-from . import lex
-from . import yacc
-from .lex import TOKEN
-
-
-PY2 = True
-if sys.version_info.major >= 3:
-    PY2 = False
-    long = int
-
-
-tokens = (
-    'HEADER_NAME', 'IDENTIFIER', 'PP_NUMBER', 'CHARACTER_CONSTANT',
-    'STRING_LITERAL', 'OTHER',
-
-    'PTR_OP', 'INC_OP', 'DEC_OP', 'LEFT_OP', 'RIGHT_OP', 'LE_OP', 'GE_OP',
-    'EQ_OP', 'NE_OP', 'AND_OP', 'OR_OP', 'MUL_ASSIGN', 'DIV_ASSIGN',
-    'MOD_ASSIGN', 'ADD_ASSIGN', 'SUB_ASSIGN', 'LEFT_ASSIGN', 'RIGHT_ASSIGN',
-    'AND_ASSIGN', 'XOR_ASSIGN', 'OR_ASSIGN', 'PERIOD', 'ELLIPSIS',
-
-    'LPAREN', 'NEWLINE',
-
-    'PP_DEFINE', 'PP_DEFINE_NAME', 'PP_DEFINE_MACRO_NAME', 'PP_MACRO_PARAM',
-    'PP_STRINGIFY', 'PP_IDENTIFIER_PASTE', 'PP_END_DEFINE'
-)
-
-states = [('DEFINE', "exclusive")]
-
-subs = {
-    'D': '[0-9]',
-    'L': '[a-zA-Z_]',
-    'H': '[a-fA-F0-9]',
-    'E': '[Ee][+-]?\s*{D}+',
-    'FS': '([FfLl]|d[dfl]|D[DFL]|[fFdD][0-9]+x?)',
-    'IS': '[uUlL]*',
-}
-# Helper: substitute {foo} with subs[foo] in string (makes regexes more lexy)
-sub_pattern = re.compile('{([^}]*)}')
-
-
-def sub_repl_match(m):
-    return subs[m.groups()[0]]
-
-
-def sub(s):
-    return sub_pattern.sub(sub_repl_match, s)
-
-# --------------------------------------------------------------------------
-# Token value types
-# --------------------------------------------------------------------------
-
-# Numbers represented as int and float types.
-# For all other tokens, type is just str representation.
-
-
-class StringLiteral(str):
-
-    def __new__(cls, value):
-        # Unescaping probably not perfect but close enough.
-        try:
-            value = re.sub(r'\\x([0-9a-fA-F])(?![0-9a-fA-F])',
-                           r'\\x0\\1', value[1:-1])
-        except ValueError as e:
-            raise ValueError("invalid \\x escape in %s" % value)
-
-        return str.__new__(cls, value)
-
-# --------------------------------------------------------------------------
-# Token declarations
-# --------------------------------------------------------------------------
-
-
-punctuators = {
-    # value: (regex, type)
-    r'...': (r'\.\.\.', 'ELLIPSIS'),
-    r'>>=': (r'>>=', 'RIGHT_ASSIGN'),
-    r'<<=': (r'<<=', 'LEFT_ASSIGN'),
-    r'+=': (r'\+=', 'ADD_ASSIGN'),
-    r'-=': (r'-=', 'SUB_ASSIGN'),
-    r'*=': (r'\*=', 'MUL_ASSIGN'),
-    r'/=': (r'/=', 'DIV_ASSIGN'),
-    r'%=': (r'%=', 'MOD_ASSIGN'),
-    r'&=': (r'&=', 'AND_ASSIGN'),
-    r'^=': (r'\^=', 'XOR_ASSIGN'),
-    r'|=': (r'\|=', 'OR_ASSIGN'),
-    r'>>': (r'>>', 'RIGHT_OP'),
-    r'<<': (r'<<', 'LEFT_OP'),
-    r'++': (r'\+\+', 'INC_OP'),
-    r'--': (r'--', 'DEC_OP'),
-    r'->': (r'->', 'PTR_OP'),
-    r'&&': (r'&&', 'AND_OP'),
-    r'||': (r'\|\|', 'OR_OP'),
-    r'<=': (r'<=', 'LE_OP'),
-    r'>=': (r'>=', 'GE_OP'),
-    r'==': (r'==', 'EQ_OP'),
-    r'!=': (r'!=', 'NE_OP'),
-    r'<:': (r'<:', '['),
-    r':>': (r':>', ']'),
-    r'<%': (r'<%', '{'),
-    r'%>': (r'%>', '}'),
-    r';': (r';', ';'),
-    r'{': (r'{', '{'),
-    r'}': (r'}', '}'),
-    r',': (r',', ','),
-    r':': (r':', ':'),
-    r'=': (r'=', '='),
-    r')': (r'\)', ')'),
-    r'[': (r'\[', '['),
-    r']': (r']', ']'),
-    r'.': (r'\.', 'PERIOD'),
-    r'&': (r'&', '&'),
-    r'!': (r'!', '!'),
-    r'~': (r'~', '~'),
-    r'-': (r'-', '-'),
-    r'+': (r'\+', '+'),
-    r'*': (r'\*', '*'),
-    r'/': (r'/', '/'),
-    r'%': (r'%', '%'),
-    r'<': (r'<', '<'),
-    r'>': (r'>', '>'),
-    r'^': (r'\^', '^'),
-    r'|': (r'\|', '|'),
-    r'?': (r'\?', '?')
-}
-
-
-def punctuator_regex(punctuators):
-    punctuator_regexes = [v[0] for v in punctuators.values()]
-    if PY2:
-        punctuator_regexes.sort(lambda a, b: -cmp(len(a), len(b)))
-    else:
-        punctuator_regexes.sort(key=lambda a: -len(a))
-    return '(%s)' % '|'.join(punctuator_regexes)
-
-
-# Process line-number directives from the preprocessor
-# See http://docs.freebsd.org/info/cpp/cpp.info.Output.html
-DIRECTIVE = r'\#\s+(\d+)\s+"([^"]+)"[ \d]*\n'
-
-
-@TOKEN(DIRECTIVE)
-def t_ANY_directive(t):
-    t.lexer.filename = t.groups[2]
-    t.lexer.lineno = int(t.groups[1])
-    return None
-
-
-@TOKEN(punctuator_regex(punctuators))
-def t_ANY_punctuator(t):
-    t.type = punctuators[t.value][1]
-    return t
-
-
-IDENTIFIER = sub('{L}({L}|{D})*')
-
-
-@TOKEN(IDENTIFIER)
-def t_INITIAL_identifier(t):
-    t.type = 'IDENTIFIER'
-    return t
-
-
-@TOKEN(IDENTIFIER)
-def t_DEFINE_identifier(t):
-    if t.lexer.next_is_define_name:
-        # This identifier is the name of a macro
-        # We need to look ahead and see if this macro takes parameters or not.
-        if t.lexpos + len(t.value) < t.lexer.lexlen and \
-                t.lexer.lexdata[t.lexpos + len(t.value)] == '(':
-
-            t.type = 'PP_DEFINE_MACRO_NAME'
-
-            # Look ahead and read macro parameter list
-            lexdata = t.lexer.lexdata
-            pos = t.lexpos + len(t.value) + 1
-            while lexdata[pos] not in '\n)':
-                pos += 1
-            params = lexdata[t.lexpos + len(t.value) + 1: pos]
-            paramlist = [x.strip() for x in params.split(",") if x.strip()]
-            t.lexer.macro_params = paramlist
-
-        else:
-            t.type = 'PP_DEFINE_NAME'
-
-        t.lexer.next_is_define_name = False
-    elif t.value in t.lexer.macro_params:
-        t.type = 'PP_MACRO_PARAM'
-    else:
-        t.type = 'IDENTIFIER'
-    return t
-
-
-FLOAT_LITERAL = sub(r"(?P<p1>{D}+)?(?P<dp>[.]?)(?P<p2>(?(p1){D}*|{D}+))"
-                    r"(?P<exp>(?:[Ee][+-]?{D}+)?)(?P<suf>{FS}?)(?!\w)")
-
-
-@TOKEN(FLOAT_LITERAL)
-def t_ANY_float(t):
-    t.type = 'PP_NUMBER'
-    m = t.lexer.lexmatch
-
-    p1 = m.group("p1")
-    dp = m.group("dp")
-    p2 = m.group("p2")
-    exp = m.group("exp")
-    suf = m.group("suf")
-
-    if dp or exp or (suf and suf not in ("Ll")):
-        s = m.group(0)
-        if suf:
-            s = s[:-len(suf)]
-        # Attach a prefix so the parser can figure out if should become an
-        # integer, float, or long
-        t.value = "f" + s
-    elif (suf and suf in ("Ll")):
-        t.value = "l" + p1
-    else:
-        t.value = "i" + p1
-
-    return t
-
-
-INT_LITERAL = sub(r"(?P<p1>(?:0x{H}+)|(?:{D}+))(?P<suf>{IS})")
-
-
-@TOKEN(INT_LITERAL)
-def t_ANY_int(t):
-    t.type = 'PP_NUMBER'
-    m = t.lexer.lexmatch
-
-    if "L" in m.group(3) or "l" in m.group(2):
-        prefix = "l"
-    else:
-        prefix = "i"
-
-    g1 = m.group(2)
-    if g1.startswith("0x"):
-        # Convert base from hexadecimal
-        g1 = str(long(g1[2:], 16))
-    elif g1[0] == "0":
-        # Convert base from octal
-        g1 = str(long(g1, 8))
-
-    t.value = prefix + g1
-
-    return t
-
-
-CHARACTER_CONSTANT = sub(r"L?'(\\.|[^\\'])+'")
-
-
-@TOKEN(CHARACTER_CONSTANT)
-def t_ANY_character_constant(t):
-    t.type = 'CHARACTER_CONSTANT'
-    return t
-
-
-STRING_LITERAL = sub(r'L?"(\\.|[^\\"])*"')
-
-
-@TOKEN(STRING_LITERAL)
-def t_ANY_string_literal(t):
-    t.type = 'STRING_LITERAL'
-    t.value = StringLiteral(t.value)
-    return t
-
-
-@TOKEN(r'\(')
-def t_ANY_lparen(t):
-    if t.lexpos == 0 or t.lexer.lexdata[t.lexpos - 1] not in (' \t\f\v\n'):
-        t.type = 'LPAREN'
-    else:
-        t.type = '('
-    return t
-
-
-@TOKEN(r'\n')
-def t_INITIAL_newline(t):
-    t.lexer.lineno += 1
-    return None
-
-
-@TOKEN(r'\#define')
-def t_INITIAL_pp_define(t):
-    t.type = 'PP_DEFINE'
-    t.lexer.begin("DEFINE")
-    t.lexer.next_is_define_name = True
-    t.lexer.macro_params = set()
-    return t
-
-
-@TOKEN(r'\n')
-def t_DEFINE_newline(t):
-    t.type = 'PP_END_DEFINE'
-    t.lexer.begin("INITIAL")
-    t.lexer.lineno += 1
-    del t.lexer.macro_params
-
-    # Damage control in case the token immediately after the #define failed
-    # to handle this
-    t.lexer.next_is_define_name = False
-    return t
-
-
-@TOKEN(r'(\#\#)|(\#)')
-def t_DEFINE_pp_param_op(t):
-    if t.value == '#':
-        t.type = 'PP_STRINGIFY'
-    else:
-        t.type = 'PP_IDENTIFIER_PASTE'
-    return t
-
-
-def t_INITIAL_error(t):
-    t.type = 'OTHER'
-    return t
-
-
-def t_DEFINE_error(t):
-    t.type = 'OTHER'
-    t.value = t.value[0]
-    t.lexer.lexpos += 1  # Skip it if it's an error in a #define
-    return t
-
-
-t_ANY_ignore = ' \t\v\f\r'

+ 0 - 9
python/grass/ctypes/ctypesgencore/printer/defaultheader.py

@@ -1,9 +0,0 @@
-'''Wrapper for %(name)s
-
-Generated with:
-%(argv)s
-
-Do not modify this file.
-'''
-
-__docformat__ = 'restructuredtext'

+ 0 - 362
python/grass/ctypes/ctypesgencore/printer/printer.py

@@ -1,362 +0,0 @@
-#!/usr/bin/env python3
-from __future__ import print_function
-
-
-import os
-import sys
-from . import test  # So we can find the path to local files in the printer package
-import time
-
-import ctypesgencore.libraryloader  # So we can get the path to it
-from ctypesgencore.ctypedescs import *
-from ctypesgencore.descriptions import *
-from ctypesgencore.messages import *
-
-
-def path_to_local_file(name, known_local_module=test):
-    basedir = os.path.dirname(known_local_module.__file__)
-    return os.path.join(basedir, name)
-
-
-class WrapperPrinter:
-
-    def __init__(self, outpath, options, data):
-        status_message("Writing to %s." % outpath)
-
-        self.file = open(outpath, "w")
-        self.options = options
-
-        if self.options.strip_build_path and \
-                self.options.strip_build_path[-1] != os.path.sep:
-            self.options.strip_build_path += os.path.sep
-
-        self.print_header()
-        print(file=self.file)
-
-        self.print_preamble()
-        print(file=self.file)
-
-        self.print_loader()
-        print(file=self.file)
-
-        self.print_group(self.options.libraries,
-                         "libraries", self.print_library)
-        self.print_group(self.options.modules, "modules", self.print_module)
-
-        method_table = {
-            'function': self.print_function,
-            'macro': self.print_macro,
-            'struct': self.print_struct,
-            'struct-body': self.print_struct_members,
-            'typedef': self.print_typedef,
-            'variable': self.print_variable,
-            'enum': self.print_enum,
-            'constant': self.print_constant
-        }
-
-        for kind, desc in data.output_order:
-            if desc.included:
-                method_table[kind](desc)
-                print(file=self.file)
-
-        self.print_group(self.options.inserted_files, "inserted files",
-                         self.insert_file)
-
-    def print_group(self, list, name, function):
-        if list:
-            print("# Begin %s" % name, file=self.file)
-            print(file=self.file)
-            for obj in list:
-                function(obj)
-            print(file=self.file)
-            print("# %d %s" % (len(list), name), file=self.file)
-            print("# End %s" % name, file=self.file)
-        else:
-            print("# No %s" % name, file=self.file)
-        print(file=self.file)
-
-    def srcinfo(self, src):
-        if src is None:
-            print(file=self.file)
-        else:
-            filename, lineno = src
-            if filename in ("<built-in>", "<command line>"):
-                print("# %s" % filename, file=self.file)
-            else:
-                if self.options.strip_build_path and \
-                        filename.startswith(self.options.strip_build_path):
-                    filename = filename[len(self.options.strip_build_path):]
-                print("# %s: %s" % (filename, lineno), file=self.file)
-
-    def template_subs(self):
-        template_subs = {
-            'date': time.ctime(),
-            'argv': ' '.join([x for x in sys.argv if not x.startswith("--strip-build-path")]),
-            'name': os.path.basename(self.options.headers[0])
-        }
-
-        for opt, value in self.options.__dict__.items():
-            if isinstance(value, str):
-                template_subs[opt] = value
-            elif isinstance(value, (list, tuple)):
-                template_subs[opt] = (os.path.sep).join(value)
-            else:
-                template_subs[opt] = repr(value)
-
-        return template_subs
-
-    def print_header(self):
-        template_file = None
-
-        if self.options.header_template:
-            path = self.options.header_template
-            try:
-                template_file = open(path, "r")
-            except IOError:
-                error_message("Cannot load header template from file \"%s\" "
-                              " - using default template." % path, cls='missing-file')
-
-        if not template_file:
-            path = path_to_local_file("defaultheader.py")
-            template_file = open(path, "r")
-
-        template_subs = self.template_subs()
-        self.file.write(template_file.read() % template_subs)
-
-        template_file.close()
-
-    def print_preamble(self):
-        path = path_to_local_file("preamble.py")
-
-        print("# Begin preamble", file=self.file)
-        print(file=self.file)
-        preamble_file = open(path, "r")
-        self.file.write(preamble_file.read())
-        preamble_file.close()
-        print(file=self.file)
-        print("# End preamble", file=self.file)
-
-    def print_loader(self):
-        print("_libs = {}", file=self.file)
-        print("_libdirs = %s" % self.options.compile_libdirs, file=self.file)
-        print(file=self.file)
-        print("# Begin loader", file=self.file)
-        print(file=self.file)
-        path = path_to_local_file("libraryloader.py",
-                                  ctypesgencore.libraryloader)
-        loader_file = open(path, "r")
-        self.file.write(loader_file.read())
-        loader_file.close()
-        print(file=self.file)
-        print("# End loader", file=self.file)
-        print(file=self.file)
-        print("add_library_search_dirs([%s])" %
-              ", ".join([repr(d) for d in self.options.runtime_libdirs]), file=self.file)
-
-    def print_library(self, library):
-        print('_libs["%s"] = load_library("%s")' % (library, library), file=self.file)
-
-    def print_module(self, module):
-        print('from %s import *' % name, file=self.file)
-
-    def print_constant(self, constant):
-        print('%s = %s' %
-              (constant.name, constant.value.py_string(False)), end=' ', file=self.file)
-        self.srcinfo(constant.src)
-
-    def print_typedef(self, typedef):
-        print('%s = %s' %
-              (typedef.name, typedef.ctype.py_string()), end=' ', file=self.file)
-        self.srcinfo(typedef.src)
-
-    def print_struct(self, struct):
-        self.srcinfo(struct.src)
-        base = {'union': 'Union', 'struct': 'Structure'}[struct.variety]
-        print('class %s_%s(%s):' %
-              (struct.variety, struct.tag, base), file=self.file)
-        print('    pass', file=self.file)
-
-    def print_struct_members(self, struct):
-        if struct.opaque:
-            return
-
-        # is this supposed to be packed?
-        if struct.packed:
-            print('{}_{}._pack_ = 1'.format(struct.variety, struct.tag),
-                  file=self.file)
-
-        # handle unnamed fields.
-        unnamed_fields = []
-        names = set([x[0] for x in struct.members])
-        anon_prefix = "unnamed_"
-        n = 1
-        for mi in range(len(struct.members)):
-            mem = list(struct.members[mi])
-            if mem[0] is None:
-                while True:
-                    name = "%s%i" % (anon_prefix, n)
-                    n += 1
-                    if name not in names:
-                        break
-                mem[0] = name
-                names.add(name)
-                if type(mem[1]) is CtypesStruct:
-                    unnamed_fields.append(name)
-                struct.members[mi] = mem
-
-        print('%s_%s.__slots__ = [' % (struct.variety, struct.tag), file=self.file)
-        for name, ctype in struct.members:
-            print("    '%s'," % name, file=self.file)
-        print(']', file=self.file)
-
-        if len(unnamed_fields) > 0:
-            print ('%s_%s._anonymous_ = [' % (struct.variety,
-                                              struct.tag), file=self.file)
-            for name in unnamed_fields:
-                print ("    '%s'," % name, file=self.file)
-            print (']', file=self.file)
-
-        print('%s_%s._fields_ = [' % (struct.variety, struct.tag), file=self.file)
-        for name, ctype in struct.members:
-            if isinstance(ctype, CtypesBitfield):
-                print("    ('%s', %s, %s)," %
-                      (name, ctype.py_string(), ctype.bitfield.py_string(False)), file=self.file)
-            else:
-                print("    ('%s', %s)," % (name, ctype.py_string()), file=self.file)
-        print(']', file=self.file)
-
-    def print_enum(self, enum):
-        print('enum_%s = c_int' % enum.tag, end=' ', file=self.file)
-        self.srcinfo(enum.src)
-        # Values of enumerator are output as constants.
-
-    def print_function(self, function):
-        if function.variadic:
-            self.print_variadic_function(function)
-        else:
-            self.print_fixed_function(function)
-
-    def print_fixed_function(self, function):
-        self.srcinfo(function.src)
-
-        # If we know what library the function lives in, look there.
-        # Otherwise, check all the libraries.
-        if function.source_library:
-            print("if hasattr(_libs[%r], %r):" %
-                  (function.source_library, function.c_name()), file=self.file)
-            print("    %s = _libs[%r].%s" %
-                  (function.py_name(), function.source_library, function.c_name()), file=self.file)
-        else:
-            print("for _lib in six.itervalues(_libs):", file=self.file)
-            print("    if not hasattr(_lib, %r):" % function.c_name(), file=self.file)
-            print("        continue", file=self.file)
-            print("    %s = _lib.%s" %
-                  (function.py_name(), function.c_name()), file=self.file)
-
-        # Argument types
-        print("    %s.argtypes = [%s]" % (function.py_name(),
-                                          ', '.join([a.py_string() for a in function.argtypes])), file=self.file)
-
-        # Return value
-        if function.restype.py_string() == "String":
-            print("    if sizeof(c_int) == sizeof(c_void_p):", file=self.file)
-            print("        %s.restype = ReturnString" %
-                  (function.py_name()), file=self.file)
-            print("    else:", file=self.file)
-            print("        %s.restype = %s" %
-                  (function.py_name(), function.restype.py_string()), file=self.file)
-            print("        %s.errcheck = ReturnString" %
-                  (function.py_name()), file=self.file)
-        else:
-            print("    %s.restype = %s" %
-                  (function.py_name(), function.restype.py_string()), file=self.file)
-            if function.errcheck:
-                print ("    %s.errcheck = %s" %
-                       (function.py_name(), function.errcheck.py_string()), file=self.file)
-
-        if not function.source_library:
-            print("    break", file=self.file)
-
-    def print_variadic_function(self, function):
-        self.srcinfo(function.src)
-        if function.source_library:
-            print("if hasattr(_libs[%r], %r):" %
-                  (function.source_library, function.c_name()), file=self.file)
-            print("    _func = _libs[%r].%s" %
-                  (function.source_library, function.c_name()), file=self.file)
-            print("    _restype = %s" % function.restype.py_string(), file=self.file)
-            print("    _errcheck = %s" % function.errcheck.py_string(), file=self.file)
-            print("    _argtypes = [%s]" %
-                  ', '.join([a.py_string() for a in function.argtypes]), file=self.file)
-            print("    %s = _variadic_function(_func,_restype,_argtypes,_errcheck)" %
-                  function.py_name(), file=self.file)
-        else:
-            print("for _lib in _libs.values():", file=self.file)
-            print("    if hasattr(_lib, %r):" % function.c_name(), file=self.file)
-            print("        _func = _lib.%s" %
-                  (function.c_name()), file=self.file)
-            print("        _restype = %s" % function.restype.py_string(), file=self.file)
-            print("        _errcheck = %s" % function.errcheck.py_string(), file=self.file)
-            print("        _argtypes = [%s]" %
-                  ', '.join([a.py_string() for a in function.argtypes]), file=self.file)
-            print("        %s = _variadic_function(_func,_restype,_argtypes,_errcheck)" %
-                  function.py_name(), file=self.file)
-
-    def print_variable(self, variable):
-        self.srcinfo(variable.src)
-        if variable.source_library:
-            print('try:', file=self.file)
-            print('    %s = (%s).in_dll(_libs[%r], %r)' %
-                  (variable.py_name(),
-                   variable.ctype.py_string(),
-                   variable.source_library,
-                   variable.c_name()), file=self.file)
-            print('except:', file=self.file)
-            print('    pass', file=self.file)
-        else:
-            print("for _lib in _libs.values():", file=self.file)
-            print('    try:', file=self.file)
-            print('        %s = (%s).in_dll(_lib, %r)' %
-                  (variable.py_name(),
-                   variable.ctype.py_string(),
-                   variable.c_name()), file=self.file)
-            print("        break", file=self.file)
-            print('    except:', file=self.file)
-            print('        pass', file=self.file)
-
-    def print_macro(self, macro):
-        if macro.params:
-            self.print_func_macro(macro)
-        else:
-            self.print_simple_macro(macro)
-
-    def print_simple_macro(self, macro):
-        # The macro translator makes heroic efforts but it occasionally fails.
-        # We want to contain the failures as much as possible.
-        # Hence the try statement.
-        self.srcinfo(macro.src)
-        print("try:", file=self.file)
-        print("    %s = %s" % (macro.name, macro.expr.py_string(True)), file=self.file)
-        print("except:", file=self.file)
-        print("    pass", file=self.file)
-
-    def print_func_macro(self, macro):
-        self.srcinfo(macro.src)
-        print("def %s(%s):" %
-              (macro.name, ", ".join(macro.params)), file=self.file)
-        print("    return %s" % macro.expr.py_string(True), file=self.file)
-
-    def insert_file(self, filename):
-        try:
-            inserted_file = open(filename, "r")
-        except IOError:
-            error_message("Cannot open file \"%s\". Skipped it." % filename,
-                          cls='missing-file')
-
-        print("# Begin \"%s\"" % filename, file=self.file)
-        print(file=self.file)
-        self.file.write(inserted_file.read())
-        print(file=self.file)
-        print("# End \"%s\"" % filename, file=self.file)
-
-        inserted_file.close()

+ 0 - 6
python/grass/ctypes/ctypesgencore/printer/test.py

@@ -1,6 +0,0 @@
-"""
-ctypesgencore.printer.printer imports this module so that it can find the path
-to defaulttemplate.py and defaultloader.py.
-"""
-
-pass

+ 0 - 7
python/grass/ctypes/fix.sed

@@ -1,7 +0,0 @@
-#!/usr/bin/sed -f
-/^# End loader$/a\
-from .ctypes_preamble import *\
-from .ctypes_preamble import _variadic_function\
-from .ctypes_loader import *
-/^# Begin preamble$/,/^# End preamble$/d
-/^# Begin loader$/,/^# End loader$/d

+ 0 - 270
python/grass/ctypes/loader.py

@@ -1,270 +0,0 @@
-# ----------------------------------------------------------------------------
-# Copyright (c) 2008 David James
-# Copyright (c) 2006-2008 Alex Holkner
-# All rights reserved.
-#
-# Redistribution and use in source and binary forms, with or without
-# modification, are permitted provided that the following conditions
-# are met:
-#
-#  * Redistributions of source code must retain the above copyright
-#    notice, this list of conditions and the following disclaimer.
-#  * Redistributions in binary form must reproduce the above copyright
-#    notice, this list of conditions and the following disclaimer in
-#    the documentation and/or other materials provided with the
-#    distribution.
-#  * Neither the name of pyglet nor the names of its
-#    contributors may be used to endorse or promote products
-#    derived from this software without specific prior written
-#    permission.
-#
-# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
-# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
-# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS
-# FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
-# COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
-# INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
-# BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
-# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
-# CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
-# LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN
-# ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
-# POSSIBILITY OF SUCH DAMAGE.
-# ----------------------------------------------------------------------------
-
-import glob
-import os.path
-import re
-import sys
-
-import ctypes
-import ctypes.util
-
-
-def _environ_path(name):
-    if name in os.environ:
-        return os.environ[name].split(":")
-    else:
-        return []
-
-
-class LibraryLoader(object):
-
-    def __init__(self):
-        self.other_dirs = []
-
-    def load_library(self, libname):
-        """Given the name of a library, load it."""
-        paths = self.getpaths(libname)
-
-        for path in paths:
-            if os.path.exists(path):
-                return self.load(path)
-
-        raise ImportError("%s not found." % libname)
-
-    def load(self, path):
-        """Given a path to a library, load it."""
-        try:
-            # Darwin requires dlopen to be called with mode RTLD_GLOBAL instead
-            # of the default RTLD_LOCAL.  Without this, you end up with
-            # libraries not being loadable, resulting in "Symbol not found"
-            # errors
-            if sys.platform == 'darwin':
-                return ctypes.CDLL(path, ctypes.RTLD_GLOBAL)
-            else:
-                return ctypes.cdll.LoadLibrary(path)
-        except OSError as e:
-            raise ImportError(e)
-
-    def getpaths(self, libname):
-        """Return a list of paths where the library might be found."""
-        if os.path.isabs(libname):
-            yield libname
-
-        else:
-            for path in self.getplatformpaths(libname):
-                yield path
-
-            path = ctypes.util.find_library(libname)
-            if path:
-                yield path
-
-    def getplatformpaths(self, libname):
-        return []
-
-# Darwin (Mac OS X)
-
-
-class DarwinLibraryLoader(LibraryLoader):
-    name_formats = ["lib%s.dylib", "lib%s.so", "lib%s.bundle", "%s.dylib",
-                    "%s.so", "%s.bundle", "%s"]
-
-    def getplatformpaths(self, libname):
-        if os.path.pathsep in libname:
-            names = [libname]
-        else:
-            names = [format % libname for format in self.name_formats]
-
-        for dir in self.getdirs(libname):
-            for name in names:
-                yield os.path.join(dir, name)
-
-    def getdirs(self, libname):
-        '''Implements the dylib search as specified in Apple documentation:
-
-        http://developer.apple.com/documentation/DeveloperTools/Conceptual/
-            DynamicLibraries/Articles/DynamicLibraryUsageGuidelines.html
-
-        Before commencing the standard search, the method first checks
-        the bundle's ``Frameworks`` directory if the application is running
-        within a bundle (OS X .app).
-        '''
-
-        dyld_fallback_library_path = _environ_path("DYLD_FALLBACK_LIBRARY_PATH")
-        if not dyld_fallback_library_path:
-            dyld_fallback_library_path = [os.path.expanduser('~/lib'),
-                                          '/usr/local/lib', '/usr/lib',
-                                          os.path.join(sys.prefix, 'lib')]
-        dyld_fallback_library_path.extend(_environ_path('LD_RUN_PATH'))
-
-        dirs = []
-
-        if '/' in libname:
-            dirs.extend(_environ_path("DYLD_LIBRARY_PATH"))
-        else:
-            dirs.extend(_environ_path("LD_LIBRARY_PATH"))
-            dirs.extend(_environ_path("DYLD_LIBRARY_PATH"))
-
-        dirs.extend(self.other_dirs)
-        dirs.append(".")
-
-        if hasattr(sys, 'frozen') and sys.frozen == 'macosx_app':
-            dirs.append(os.path.join(
-                os.environ['RESOURCEPATH'],
-                '..',
-                'Frameworks'))
-
-        dirs.extend(dyld_fallback_library_path)
-
-        return dirs
-
-# Posix
-
-
-class PosixLibraryLoader(LibraryLoader):
-    _ld_so_cache = None
-
-    def _create_ld_so_cache(self):
-        # Recreate search path followed by ld.so.  This is going to be
-        # slow to build, and incorrect (ld.so uses ld.so.cache, which may
-        # not be up-to-date).  Used only as fallback for distros without
-        # /sbin/ldconfig.
-        #
-        # We assume the DT_RPATH and DT_RUNPATH binary sections are omitted.
-
-        directories = []
-        for name in ("LD_LIBRARY_PATH",
-                     "SHLIB_PATH",  # HPUX
-                     "LIBPATH",  # OS/2, AIX
-                     "LIBRARY_PATH",  # BE/OS
-                     ):
-            if name in os.environ:
-                directories.extend(os.environ[name].split(os.pathsep))
-        directories.extend(self.other_dirs)
-        directories.append(".")
-
-        try:
-            directories.extend([dir.strip() for dir in open('/etc/ld.so.conf')])
-        except IOError:
-            pass
-
-        directories.extend(['/lib', '/usr/lib', '/lib64', '/usr/lib64'])
-
-        cache = {}
-        lib_re = re.compile(r'lib(.*)\.s[ol]')
-        ext_re = re.compile(r'\.s[ol]$')
-        for dir in directories:
-            try:
-                for path in glob.glob("%s/*.s[ol]*" % dir):
-                    file = os.path.basename(path)
-
-                    # Index by filename
-                    if file not in cache:
-                        cache[file] = path
-
-                    # Index by library name
-                    match = lib_re.match(file)
-                    if match:
-                        library = match.group(1)
-                        if library not in cache:
-                            cache[library] = path
-            except OSError:
-                pass
-
-        self._ld_so_cache = cache
-
-    def getplatformpaths(self, libname):
-        if self._ld_so_cache is None:
-            self._create_ld_so_cache()
-
-        result = self._ld_so_cache.get(libname)
-        if result:
-            yield result
-
-        path = ctypes.util.find_library(libname)
-        if path:
-            yield os.path.join("/lib", path)
-
-# Windows
-
-
-class _WindowsLibrary(object):
-
-    def __init__(self, path):
-        self.cdll = ctypes.cdll.LoadLibrary(path)
-        self.windll = ctypes.windll.LoadLibrary(path)
-
-    def __getattr__(self, name):
-        try:
-            return getattr(self.cdll, name)
-        except AttributeError:
-            try:
-                return getattr(self.windll, name)
-            except AttributeError:
-                raise
-
-
-class WindowsLibraryLoader(LibraryLoader):
-    name_formats = ["%s.dll", "lib%s.dll"]
-
-    def load(self, path):
-        return _WindowsLibrary(path)
-
-    def getplatformpaths(self, libname):
-        if os.path.sep not in libname:
-            for name in self.name_formats:
-                path = ctypes.util.find_library(name % libname)
-                if path:
-                    yield path
-
-# Platform switching
-
-# If your value of sys.platform does not appear in this dict, please contact
-# the Ctypesgen maintainers.
-
-loaderclass = {
-    "darwin": DarwinLibraryLoader,
-    "cygwin": WindowsLibraryLoader,
-    "win32": WindowsLibraryLoader
-}
-
-loader = loaderclass.get(sys.platform, PosixLibraryLoader)()
-
-
-def add_library_search_dirs(other_dirs):
-    loader.other_dirs = other_dirs
-
-load_library = loader.load_library
-
-del loaderclass

+ 12 - 0
python/grass/ctypes/run.py

@@ -0,0 +1,12 @@
+#!/usr/bin/env python3
+
+import sys, os
+
+THIS_DIR = os.path.dirname(__file__)
+# ensure that we can load the ctypesgen library
+sys.path.insert(0, THIS_DIR)
+
+import ctypesgen.main
+
+if __name__ == "__main__":
+    ctypesgen.main.main()

+ 6 - 6
python/grass/pygrass/vector/table.py

@@ -33,7 +33,7 @@ from grass.script.db import db_table_in_vector
 from grass.script.core import warning
 from grass.script.core import warning
 
 
 from grass.pygrass.vector import sql
 from grass.pygrass.vector import sql
-from grass.lib.ctypes_preamble import String
+from grass.lib.ctypes_preamble import ReturnString
 
 
 
 
 if sys.version_info.major >= 3:
 if sys.version_info.major >= 3:
@@ -678,7 +678,7 @@ class Link(object):
         return decode(self.c_fieldinfo.contents.name)
         return decode(self.c_fieldinfo.contents.name)
 
 
     def _set_name(self, name):
     def _set_name(self, name):
-        self.c_fieldinfo.contents.name = String(name)
+        self.c_fieldinfo.contents.name = ReturnString(name)
 
 
     name = property(fget=_get_name, fset=_set_name, doc="Set and obtain name vale")
     name = property(fget=_get_name, fset=_set_name, doc="Set and obtain name vale")
 
 
@@ -686,7 +686,7 @@ class Link(object):
         return decode(self.c_fieldinfo.contents.table)
         return decode(self.c_fieldinfo.contents.table)
 
 
     def _set_table(self, new_name):
     def _set_table(self, new_name):
-        self.c_fieldinfo.contents.table = String(new_name)
+        self.c_fieldinfo.contents.table = ReturnString(new_name)
 
 
     table_name = property(
     table_name = property(
         fget=_get_table, fset=_set_table, doc="Set and obtain table name value"
         fget=_get_table, fset=_set_table, doc="Set and obtain table name value"
@@ -696,7 +696,7 @@ class Link(object):
         return decode(self.c_fieldinfo.contents.key)
         return decode(self.c_fieldinfo.contents.key)
 
 
     def _set_key(self, key):
     def _set_key(self, key):
-        self.c_fieldinfo.contents.key = String(key)
+        self.c_fieldinfo.contents.key = ReturnString(key)
 
 
     key = property(fget=_get_key, fset=_set_key, doc="Set and obtain cat value")
     key = property(fget=_get_key, fset=_set_key, doc="Set and obtain cat value")
 
 
@@ -704,7 +704,7 @@ class Link(object):
         return decode(self.c_fieldinfo.contents.database)
         return decode(self.c_fieldinfo.contents.database)
 
 
     def _set_database(self, database):
     def _set_database(self, database):
-        self.c_fieldinfo.contents.database = String(database)
+        self.c_fieldinfo.contents.database = ReturnString(database)
 
 
     database = property(
     database = property(
         fget=_get_database, fset=_set_database, doc="Set and obtain database value"
         fget=_get_database, fset=_set_database, doc="Set and obtain database value"
@@ -717,7 +717,7 @@ class Link(object):
         if driver not in ("sqlite", "pg"):
         if driver not in ("sqlite", "pg"):
             str_err = "Driver not supported, use: %s." % ", ".join(DRIVERS)
             str_err = "Driver not supported, use: %s." % ", ".join(DRIVERS)
             raise TypeError(str_err)
             raise TypeError(str_err)
-        self.c_fieldinfo.contents.driver = String(driver)
+        self.c_fieldinfo.contents.driver = ReturnString(driver)
 
 
     driver = property(
     driver = property(
         fget=_get_driver,
         fget=_get_driver,